![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/compressed.gif) | 007 - The World Is Not Enough (USA).zip | 2019-05-30 04:05 | 441M | |
![[ ]](/icons/compressed.gif) | 007 - Tomorrow Never Dies (USA).zip | 2019-05-30 04:05 | 347M | |
![[ ]](/icons/compressed.gif) | 007 Racing (USA).zip | 2019-05-30 04:05 | 341M | |
![[ ]](/icons/compressed.gif) | 1Xtreme (USA).zip | 2019-05-30 04:05 | 474M | |
![[ ]](/icons/compressed.gif) | 2Xtreme (USA).zip | 2019-05-30 04:05 | 425M | |
![[ ]](/icons/compressed.gif) | 3D Baseball (USA).zip | 2019-05-30 04:05 | 163M | |
![[ ]](/icons/compressed.gif) | 3D Lemmings (USA).zip | 2019-05-30 04:05 | 445M | |
![[ ]](/icons/compressed.gif) | 3Xtreme (USA).zip | 2019-05-30 04:05 | 250M | |
![[ ]](/icons/compressed.gif) | 16 Tales 2 (USA).zip | 2019-05-30 04:05 | 510M | |
![[ ]](/icons/compressed.gif) | 40 Winks (USA).zip | 2019-05-30 04:05 | 394M | |
![[ ]](/icons/compressed.gif) | 2002 FIFA World Cup (USA) (En,Es).zip | 2019-05-30 04:05 | 379M | |
![[ ]](/icons/compressed.gif) | A-Train - Trains, Power, Money (USA) (En,Ja,Fr,De).zip | 2019-05-30 04:05 | 60M | |
![[ ]](/icons/compressed.gif) | ASCII Entertainment Demo CD (USA).zip | 2019-05-30 04:05 | 143M | |
![[ ]](/icons/compressed.gif) | ATV - Quad Power Racing (USA).zip | 2019-05-30 04:05 | 134M | |
![[ ]](/icons/compressed.gif) | ATV Mania (USA).zip | 2019-05-30 04:05 | 243M | |
![[ ]](/icons/compressed.gif) | ATV Racers (USA).zip | 2019-05-30 04:05 | 37M | |
![[ ]](/icons/compressed.gif) | Ace Combat 2 (USA).zip | 2019-05-30 04:05 | 346M | |
![[ ]](/icons/compressed.gif) | Ace Combat 3 - Electrosphere (USA).zip | 2019-05-30 04:05 | 355M | |
![[ ]](/icons/compressed.gif) | Aces of the Air (USA).zip | 2019-05-30 04:05 | 552M | |
![[ ]](/icons/compressed.gif) | Action Bass (USA).zip | 2019-05-30 04:05 | 80M | |
![[ ]](/icons/compressed.gif) | Action Man - Operation Extreme (USA).zip | 2019-05-30 04:05 | 247M | |
![[ ]](/icons/compressed.gif) | Action Replay 2 Version 2.30 (USA) (En,Fr,Es,Pt) (Disc 2) (Bonus PSone Codes!) (Unl).zip | 2019-05-30 04:05 | 1.5M | |
![[ ]](/icons/compressed.gif) | Activision Classics (USA).zip | 2019-05-30 04:05 | 56M | |
![[ ]](/icons/compressed.gif) | Adidas Power Soccer (USA).zip | 2019-05-30 04:05 | 295M | |
![[ ]](/icons/compressed.gif) | Adidas Power Soccer 98 (USA).zip | 2019-05-30 04:05 | 478M | |
![[ ]](/icons/compressed.gif) | Advanced Dungeons & Dragons - Iron & Blood - Warriors of Ravenloft (USA) (Demo).zip | 2019-05-30 04:05 | 53M | |
![[ ]](/icons/compressed.gif) | Advanced Dungeons & Dragons - Iron & Blood - Warriors of Ravenloft (USA).zip | 2019-05-30 04:05 | 169M | |
![[ ]](/icons/compressed.gif) | Adventures of Lomax, The (USA).zip | 2019-05-30 04:05 | 577M | |
![[ ]](/icons/compressed.gif) | Agile Warrior - F-111X (USA).zip | 2019-05-30 04:05 | 482M | |
![[ ]](/icons/compressed.gif) | Air Combat (USA).zip | 2019-05-30 04:05 | 442M | |
![[ ]](/icons/compressed.gif) | Air Hockey (USA).zip | 2019-05-30 04:05 | 4.8M | |
![[ ]](/icons/compressed.gif) | Akuji the Heartless (USA).zip | 2019-05-30 04:05 | 178M | |
![[ ]](/icons/compressed.gif) | Alexi Lalas International Soccer (USA) (En,Fr,De,Es,It).zip | 2019-05-30 04:05 | 51M | |
![[ ]](/icons/compressed.gif) | Alien Resurrection (USA).zip | 2019-05-30 04:05 | 194M | |
![[ ]](/icons/compressed.gif) | Alien Trilogy (USA).zip | 2019-05-30 04:05 | 391M | |
![[ ]](/icons/compressed.gif) | All-Star Baseball 97 featuring Frank Thomas (USA).zip | 2019-05-30 04:05 | 161M | |
![[ ]](/icons/compressed.gif) | All-Star Slammin' D-Ball (USA).zip | 2019-05-30 04:05 | 82M | |
![[ ]](/icons/compressed.gif) | All Star Racing (USA).zip | 2019-05-30 04:05 | 262M | |
![[ ]](/icons/compressed.gif) | All Star Racing 2 (USA).zip | 2019-05-30 04:05 | 275M | |
![[ ]](/icons/compressed.gif) | Allied General (USA).zip | 2019-05-30 04:05 | 377M | |
![[ ]](/icons/compressed.gif) | Alone in the Dark - One-Eyed Jack's Revenge (USA).zip | 2019-05-30 04:05 | 205M | |
![[ ]](/icons/compressed.gif) | Alone in the Dark - The New Nightmare (USA) (Disc 1).zip | 2019-05-30 04:05 | 427M | |
![[ ]](/icons/compressed.gif) | Alone in the Dark - The New Nightmare (USA) (Disc 2).zip | 2019-05-30 04:05 | 457M | |
![[ ]](/icons/compressed.gif) | Alundra (USA) (v1.0).zip | 2019-05-30 04:05 | 331M | |
![[ ]](/icons/compressed.gif) | Alundra (USA) (v1.1).zip | 2019-05-30 04:05 | 331M | |
![[ ]](/icons/compressed.gif) | Alundra 2 - A New Legend Begins (USA).zip | 2019-05-30 04:05 | 400M | |
![[ ]](/icons/compressed.gif) | Amazing Virtual Sea-Monkeys, The (USA) (En,Es).zip | 2019-05-30 04:05 | 529M | |
![[ ]](/icons/compressed.gif) | American Pool (USA).zip | 2019-05-30 04:05 | 1.2M | |
![[ ]](/icons/compressed.gif) | Andretti Racing (USA).zip | 2019-05-30 04:05 | 547M | |
![[ ]](/icons/compressed.gif) | Animaniacs - Ten Pin Alley (USA).zip | 2019-05-30 04:05 | 130M | |
![[ ]](/icons/compressed.gif) | Animorphs - Shattered Reality (USA).zip | 2019-05-30 04:05 | 231M | |
![[ ]](/icons/compressed.gif) | Ape Escape (USA) (Demo).zip | 2019-05-30 04:05 | 46M | |
![[ ]](/icons/compressed.gif) | Ape Escape (USA).zip | 2019-05-30 04:05 | 132M | |
![[ ]](/icons/compressed.gif) | Apocalypse (USA).zip | 2019-05-30 04:05 | 235M | |
![[ ]](/icons/compressed.gif) | Aquanaut's Holiday (USA).zip | 2019-05-30 04:05 | 107M | |
![[ ]](/icons/compressed.gif) | Arcade's Greatest Hits - The Atari Collection 1 (USA).zip | 2019-05-30 04:05 | 434M | |
![[ ]](/icons/compressed.gif) | Arcade's Greatest Hits - The Atari Collection 2 (USA).zip | 2019-05-30 04:05 | 142M | |
![[ ]](/icons/compressed.gif) | Arcade's Greatest Hits - The Midway Collection 2 (USA).zip | 2019-05-30 04:05 | 329M | |
![[ ]](/icons/compressed.gif) | Arcade Party Pak (USA).zip | 2019-05-30 04:05 | 423M | |
![[ ]](/icons/compressed.gif) | Arc the Lad Collection - Arc Arena - Monster Tournament (USA).zip | 2019-05-30 04:05 | 70M | |
![[ ]](/icons/compressed.gif) | Arc the Lad Collection - Arc the Lad (USA).zip | 2019-05-30 04:05 | 309M | |
![[ ]](/icons/compressed.gif) | Arc the Lad Collection - Arc the Lad II (USA).zip | 2019-05-30 04:05 | 374M | |
![[ ]](/icons/compressed.gif) | Arc the Lad Collection - Arc the Lad III (USA) (Disc 1).zip | 2019-05-30 04:05 | 305M | |
![[ ]](/icons/compressed.gif) | Arc the Lad Collection - Arc the Lad III (USA) (Disc 2).zip | 2019-05-30 04:05 | 406M | |
![[ ]](/icons/compressed.gif) | Arc the Lad Collection - The Making of Arc the Lad (USA).zip | 2019-05-30 04:05 | 495M | |
![[ ]](/icons/compressed.gif) | Area 51 (USA) (v1.0).zip | 2019-05-30 04:05 | 431M | |
![[ ]](/icons/compressed.gif) | Area 51 (USA) (v1.1).zip | 2019-05-30 04:05 | 433M | |
![[ ]](/icons/compressed.gif) | Armored Core (USA) (v1.0).zip | 2019-05-30 04:05 | 227M | |
![[ ]](/icons/compressed.gif) | Armored Core (USA) (v1.1).zip | 2019-05-30 04:05 | 228M | |
![[ ]](/icons/compressed.gif) | Armored Core - Master of Arena (USA) (Disc 1).zip | 2019-05-30 04:05 | 330M | |
![[ ]](/icons/compressed.gif) | Armored Core - Master of Arena (USA) (Disc 2).zip | 2019-05-30 04:05 | 330M | |
![[ ]](/icons/compressed.gif) | Armored Core - Project Phantasma (USA).zip | 2019-05-30 04:05 | 185M | |
![[ ]](/icons/compressed.gif) | Armorines - Project S.W.A.R.M. (USA).zip | 2019-05-30 04:05 | 252M | |
![[ ]](/icons/compressed.gif) | Army Men - Air Attack (USA).zip | 2019-05-30 04:05 | 314M | |
![[ ]](/icons/compressed.gif) | Army Men - Air Attack 2 (USA).zip | 2019-05-30 04:05 | 437M | |
![[ ]](/icons/compressed.gif) | Army Men - Green Rogue (USA).zip | 2019-05-30 04:05 | 321M | |
![[ ]](/icons/compressed.gif) | Army Men - Sarge's Heroes (USA).zip | 2019-05-30 04:06 | 488M | |
![[ ]](/icons/compressed.gif) | Army Men - Sarge's Heroes 2 (USA).zip | 2019-05-30 04:06 | 440M | |
![[ ]](/icons/compressed.gif) | Army Men - World War (USA).zip | 2019-05-30 04:06 | 263M | |
![[ ]](/icons/compressed.gif) | Army Men - World War - Final Front (USA).zip | 2019-05-30 04:06 | 219M | |
![[ ]](/icons/compressed.gif) | Army Men - World War - Land, Sea, Air (USA).zip | 2019-05-30 04:06 | 182M | |
![[ ]](/icons/compressed.gif) | Army Men - World War - Team Assault (USA).zip | 2019-05-30 04:06 | 176M | |
![[ ]](/icons/compressed.gif) | Army Men 3D (USA).zip | 2019-05-30 04:06 | 591M | |
![[ ]](/icons/compressed.gif) | Arthur! Ready to Race (USA).zip | 2019-05-30 04:06 | 109M | |
![[ ]](/icons/compressed.gif) | Assault - Retribution (USA).zip | 2019-05-30 04:06 | 119M | |
![[ ]](/icons/compressed.gif) | Assault Rigs (USA).zip | 2019-05-30 04:06 | 518M | |
![[ ]](/icons/compressed.gif) | Asteroids (USA).zip | 2019-05-30 04:06 | 112M | |
![[ ]](/icons/compressed.gif) | Atari Anniversary Edition Redux (USA).zip | 2019-05-30 04:06 | 422M | |
![[ ]](/icons/compressed.gif) | Austin Powers Pinball (USA).zip | 2019-05-30 04:06 | 67M | |
![[ ]](/icons/compressed.gif) | Auto Destruct (USA).zip | 2019-05-30 04:06 | 125M | |
![[ ]](/icons/compressed.gif) | Azure Dreams (USA).zip | 2019-05-30 04:06 | 139M | |
![[ ]](/icons/compressed.gif) | Backstreet Billiards (USA).zip | 2019-05-30 04:06 | 309M | |
![[ ]](/icons/compressed.gif) | Backyard Soccer (USA).zip | 2019-05-30 04:06 | 215M | |
![[ ]](/icons/compressed.gif) | Baldies (USA).zip | 2019-05-30 04:06 | 206M | |
![[ ]](/icons/compressed.gif) | BallBlazer Champions (USA).zip | 2019-05-30 04:06 | 295M | |
![[ ]](/icons/compressed.gif) | Ball Breakers (USA).zip | 2019-05-30 04:06 | 291M | |
![[ ]](/icons/compressed.gif) | Ballerburg - Castle Chaos (USA).zip | 2019-05-30 04:06 | 441M | |
![[ ]](/icons/compressed.gif) | Ballistic (USA).zip | 2019-05-30 04:06 | 164M | |
![[ ]](/icons/compressed.gif) | Barbie - Explorer (USA).zip | 2019-05-30 04:06 | 114M | |
![[ ]](/icons/compressed.gif) | Barbie - Gotta Have Games (USA).zip | 2019-05-30 04:06 | 119M | |
![[ ]](/icons/compressed.gif) | Barbie - Race & Ride (USA).zip | 2019-05-30 04:06 | 458M | |
![[ ]](/icons/compressed.gif) | Barbie - Super Sports (USA).zip | 2019-05-30 04:06 | 145M | |
![[ ]](/icons/compressed.gif) | Bases Loaded '96 - Double Header (USA).zip | 2019-05-30 04:06 | 104M | |
![[ ]](/icons/compressed.gif) | Bass Landing (USA).zip | 2019-05-30 04:06 | 200M | |
![[ ]](/icons/compressed.gif) | Bass Rise (USA).zip | 2019-05-30 04:06 | 50M | |
![[ ]](/icons/compressed.gif) | Batman & Robin (USA).zip | 2019-05-30 04:06 | 366M | |
![[ ]](/icons/compressed.gif) | Batman - Gotham City Racer (USA).zip | 2019-05-30 04:06 | 383M | |
![[ ]](/icons/compressed.gif) | Batman Beyond - Return of the Joker (USA).zip | 2019-05-30 04:06 | 477M | |
![[ ]](/icons/compressed.gif) | Batman Forever - The Arcade Game (USA).zip | 2019-05-30 04:06 | 43M | |
![[ ]](/icons/compressed.gif) | Battle Arena Toshinden (USA).zip | 2019-05-30 04:06 | 381M | |
![[ ]](/icons/compressed.gif) | Battle Arena Toshinden 2 (USA).zip | 2019-05-30 04:06 | 618M | |
![[ ]](/icons/compressed.gif) | Battle Arena Toshinden 3 (USA) (En,Ja).zip | 2019-05-30 04:06 | 437M | |
![[ ]](/icons/compressed.gif) | Battle Hunter (USA).zip | 2019-05-30 04:06 | 45M | |
![[ ]](/icons/compressed.gif) | BattleSport (USA).zip | 2019-05-30 04:06 | 480M | |
![[ ]](/icons/compressed.gif) | Battle Stations (USA).zip | 2019-05-30 04:06 | 199M | |
![[ ]](/icons/compressed.gif) | BattleTanx - Global Assault (USA).zip | 2019-05-30 04:06 | 387M | |
![[ ]](/icons/compressed.gif) | Beast Wars - Transformers (USA).zip | 2019-05-30 04:06 | 230M | |
![[ ]](/icons/compressed.gif) | Best Buy Demo CD (USA).zip | 2019-05-30 04:06 | 132M | |
![[ ]](/icons/compressed.gif) | Beyblade (USA).zip | 2019-05-30 04:06 | 152M | |
![[ ]](/icons/compressed.gif) | Beyond the Beyond (USA).zip | 2019-05-30 04:06 | 54M | |
![[ ]](/icons/compressed.gif) | Big Air (USA).zip | 2019-05-30 04:06 | 205M | |
![[ ]](/icons/compressed.gif) | Big Bass Fishing (USA).zip | 2019-05-30 04:06 | 109M | |
![[ ]](/icons/compressed.gif) | Big Bass World Championship (USA).zip | 2019-05-30 04:06 | 257M | |
![[ ]](/icons/compressed.gif) | Big League Slugger Baseball (USA).zip | 2019-05-30 04:06 | 2.4M | |
![[ ]](/icons/compressed.gif) | Big Ol' Bass 2 (USA).zip | 2019-05-30 04:06 | 110M | |
![[ ]](/icons/compressed.gif) | Big Strike Bowling (USA).zip | 2019-05-30 04:06 | 138M | |
![[ ]](/icons/compressed.gif) | Billiards (USA).zip | 2019-05-30 04:06 | 83M | |
![[ ]](/icons/compressed.gif) | Bio F.R.E.A.K.S. (USA).zip | 2019-05-30 04:06 | 183M | |
![[ ]](/icons/compressed.gif) | Black Bass with Blue Marlin (USA).zip | 2019-05-30 04:06 | 151M | |
![[ ]](/icons/compressed.gif) | Black Dawn (USA).zip | 2019-05-30 04:06 | 497M | |
![[ ]](/icons/compressed.gif) | Blade (USA).zip | 2019-05-30 04:06 | 284M | |
![[ ]](/icons/compressed.gif) | Blast Chamber (USA).zip | 2019-05-30 04:06 | 427M | |
![[ ]](/icons/compressed.gif) | Blast Lacrosse (USA).zip | 2019-05-30 04:06 | 193M | |
![[ ]](/icons/compressed.gif) | Blast Radius (USA).zip | 2019-05-30 04:06 | 568M | |
![[ ]](/icons/compressed.gif) | Blaster Master - Blasting Again (USA).zip | 2019-05-30 04:06 | 376M | |
![[ ]](/icons/compressed.gif) | Blasto (USA).zip | 2019-05-30 04:06 | 220M | |
![[ ]](/icons/compressed.gif) | Blazing Dragons (USA).zip | 2019-05-30 04:06 | 133M | |
![[ ]](/icons/compressed.gif) | Blockids (USA).zip | 2019-05-30 04:06 | 617M | |
![[ ]](/icons/compressed.gif) | Blood Omen - Legacy of Kain (USA).zip | 2019-05-30 04:06 | 490M | |
![[ ]](/icons/compressed.gif) | Bloody Roar (USA).zip | 2019-05-30 04:06 | 308M | |
![[ ]](/icons/compressed.gif) | Bloody Roar II (USA).zip | 2019-05-30 04:06 | 303M | |
![[ ]](/icons/compressed.gif) | Blue's Clues - Blue's Big Musical (USA).zip | 2019-05-30 04:06 | 446M | |
![[ ]](/icons/compressed.gif) | Board Game - Top Shop (USA).zip | 2019-05-30 04:06 | 20M | |
![[ ]](/icons/compressed.gif) | Bob the Builder - Can We Fix It (USA).zip | 2019-05-30 04:06 | 79M | |
![[ ]](/icons/compressed.gif) | Bogey - Dead 6 (USA).zip | 2019-05-30 04:06 | 275M | |
![[ ]](/icons/compressed.gif) | Bomberman - Party Edition (USA).zip | 2019-05-30 04:06 | 244M | |
![[ ]](/icons/compressed.gif) | Bomberman Fantasy Race (USA).zip | 2019-05-30 04:06 | 137M | |
![[ ]](/icons/compressed.gif) | Bomberman World (USA).zip | 2019-05-30 04:06 | 316M | |
![[ ]](/icons/compressed.gif) | Bombing Islands, The (USA).zip | 2019-05-30 04:06 | 279M | |
![[ ]](/icons/compressed.gif) | BoomBots (USA).zip | 2019-05-30 04:06 | 248M | |
![[ ]](/icons/compressed.gif) | Bottom of the 9th '97 (USA).zip | 2019-05-30 04:06 | 294M | |
![[ ]](/icons/compressed.gif) | Bottom of the 9th '99 (USA).zip | 2019-05-30 04:06 | 294M | |
![[ ]](/icons/compressed.gif) | Bottom of the 9th (USA).zip | 2019-05-30 04:06 | 180M | |
![[ ]](/icons/compressed.gif) | Bowling (USA).zip | 2019-05-30 04:06 | 96M | |
![[ ]](/icons/compressed.gif) | Boxing (USA).zip | 2019-05-30 04:06 | 57M | |
![[ ]](/icons/compressed.gif) | Brahma Force - The Assault on Beltlogger 9 (USA).zip | 2019-05-30 04:06 | 394M | |
![[ ]](/icons/compressed.gif) | BrainDead 13 (USA) (Disc 1).zip | 2019-05-30 04:06 | 534M | |
![[ ]](/icons/compressed.gif) | BrainDead 13 (USA) (Disc 2).zip | 2019-05-30 04:06 | 425M | |
![[ ]](/icons/compressed.gif) | Bratz - Dress Up, Get Down and Be a Bratz Superstar! (USA) (En,Fr,Es).zip | 2019-05-30 04:06 | 127M | |
![[ ]](/icons/compressed.gif) | Brave Fencer Musashi (USA).zip | 2019-05-30 04:06 | 235M | |
![[ ]](/icons/compressed.gif) | Bravo Air Race (USA).zip | 2019-05-30 04:06 | 482M | |
![[ ]](/icons/compressed.gif) | Break Out (USA).zip | 2019-05-30 04:06 | 609M | |
![[ ]](/icons/compressed.gif) | Breath of Fire III (USA).zip | 2019-05-30 04:06 | 178M | |
![[ ]](/icons/compressed.gif) | Breath of Fire IV (USA).zip | 2019-05-30 04:06 | 261M | |
![[ ]](/icons/compressed.gif) | Brigandine - The Legend of Forsena (USA).zip | 2019-05-30 04:06 | 432M | |
![[ ]](/icons/compressed.gif) | Broken Helix (USA).zip | 2019-05-30 04:06 | 509M | |
![[ ]](/icons/compressed.gif) | Broken Sword - The Shadow of the Templars (USA).zip | 2019-05-30 04:06 | 347M | |
![[ ]](/icons/compressed.gif) | Broken Sword II - The Smoking Mirror (USA).zip | 2019-05-30 04:06 | 437M | |
![[ ]](/icons/compressed.gif) | Brunswick Circuit Pro Bowling (USA).zip | 2019-05-30 04:07 | 504M | |
![[ ]](/icons/compressed.gif) | Brunswick Circuit Pro Bowling 2 (USA).zip | 2019-05-30 04:07 | 564M | |
![[ ]](/icons/compressed.gif) | Bubble Bobble also featuring Rainbow Islands (USA).zip | 2019-05-30 04:07 | 67M | |
![[ ]](/icons/compressed.gif) | Bubsy 3D - Furbitten Planet (USA).zip | 2019-05-30 04:07 | 321M | |
![[ ]](/icons/compressed.gif) | Bugriders - The Race of Kings (USA).zip | 2019-05-30 04:07 | 575M | |
![[ ]](/icons/compressed.gif) | Bugs Bunny & Taz - Time Busters (USA) (En,Fr,Es).zip | 2019-05-30 04:07 | 424M | |
![[ ]](/icons/compressed.gif) | Bugs Bunny - Lost in Time (USA) (En,Fr,Es).zip | 2019-05-30 04:07 | 262M | |
![[ ]](/icons/compressed.gif) | Builder's Block (USA).zip | 2019-05-30 04:07 | 299M | |
![[ ]](/icons/compressed.gif) | Burning Road (USA).zip | 2019-05-30 04:07 | 378M | |
![[ ]](/icons/compressed.gif) | BursTrick - Wake Boarding!! (USA).zip | 2019-05-30 04:07 | 137M | |
![[ ]](/icons/compressed.gif) | Bushido Blade (USA).zip | 2019-05-30 04:07 | 286M | |
![[ ]](/icons/compressed.gif) | Bushido Blade 2 (USA).zip | 2019-05-30 04:07 | 329M | |
![[ ]](/icons/compressed.gif) | Bust-A-Move '99 (USA).zip | 2019-05-30 04:07 | 308M | |
![[ ]](/icons/compressed.gif) | Bust-A-Move 2 - Arcade Edition (USA).zip | 2019-05-30 04:07 | 282M | |
![[ ]](/icons/compressed.gif) | Bust-A-Move 4 (USA).zip | 2019-05-30 04:07 | 380M | |
![[ ]](/icons/compressed.gif) | Bust A Groove (USA) (Demo).zip | 2019-05-30 04:07 | 238M | |
![[ ]](/icons/compressed.gif) | Bust A Groove (USA).zip | 2019-05-30 04:07 | 303M | |
![[ ]](/icons/compressed.gif) | Bust A Groove 2 (USA).zip | 2019-05-30 04:07 | 245M | |
![[ ]](/icons/compressed.gif) | Buster Bros. Collection (USA).zip | 2019-05-30 04:07 | 394M | |
![[ ]](/icons/compressed.gif) | C-12 - Final Resistance (USA).zip | 2019-05-30 04:07 | 250M | |
![[ ]](/icons/compressed.gif) | C - The Contra Adventure (USA).zip | 2019-05-30 04:07 | 277M | |
![[ ]](/icons/compressed.gif) | CART World Series (USA).zip | 2019-05-30 04:07 | 444M | |
![[ ]](/icons/compressed.gif) | CTR - Crash Team Racing (USA).zip | 2019-05-30 04:07 | 339M | |
![[ ]](/icons/compressed.gif) | Cabela's Big Game Hunter - Ultimate Challenge (USA).zip | 2019-05-30 04:07 | 293M | |
![[ ]](/icons/compressed.gif) | Cabela's Ultimate Deer Hunt - Open Season (USA).zip | 2019-05-30 04:07 | 297M | |
![[ ]](/icons/compressed.gif) | Caesars Palace (USA).zip | 2019-05-30 04:07 | 273M | |
![[ ]](/icons/compressed.gif) | Caesars Palace 2000 - Millennium Gold Edition (USA).zip | 2019-05-30 04:07 | 70M | |
![[ ]](/icons/compressed.gif) | Caesars Palace II (USA).zip | 2019-05-30 04:07 | 190M | |
![[ ]](/icons/compressed.gif) | Calamity 1 - The Natural World (USA).zip | 2019-05-30 04:07 | 279M | |
![[ ]](/icons/compressed.gif) | Calamity 2 - People and Traditions (USA).zip | 2019-05-30 04:07 | 261M | |
![[ ]](/icons/compressed.gif) | Calamity 3 - Around the World (USA).zip | 2019-05-30 04:07 | 316M | |
![[ ]](/icons/compressed.gif) | Cali's Geo Tools (USA).zip | 2019-05-30 04:07 | 28M | |
![[ ]](/icons/compressed.gif) | Capcom vs. SNK Pro (USA).zip | 2019-05-30 04:07 | 337M | |
![[ ]](/icons/compressed.gif) | Car and Driver Presents - Grand Tour Racing '98 (USA).zip | 2019-05-30 04:07 | 299M | |
![[ ]](/icons/compressed.gif) | Card Games (USA).zip | 2019-05-30 04:07 | 17M | |
![[ ]](/icons/compressed.gif) | Cardinal Syn (USA).zip | 2019-05-30 04:07 | 401M | |
![[ ]](/icons/compressed.gif) | Carnage Heart (USA) (Mission Briefing).zip | 2019-05-30 04:07 | 483M | |
![[ ]](/icons/compressed.gif) | Carnage Heart (USA).zip | 2019-05-30 04:07 | 96M | |
![[ ]](/icons/compressed.gif) | Casper (USA).zip | 2019-05-30 04:07 | 121M | |
![[ ]](/icons/compressed.gif) | Casper - Friends Around the World (USA).zip | 2019-05-30 04:07 | 135M | |
![[ ]](/icons/compressed.gif) | Castlevania - Symphony of the Night (USA).zip | 2019-05-30 04:07 | 388M | |
![[ ]](/icons/compressed.gif) | Castlevania Chronicles (USA).zip | 2019-05-30 04:07 | 387M | |
![[ ]](/icons/compressed.gif) | Castrol Honda Superbike Racing (USA).zip | 2019-05-30 04:07 | 261M | |
![[ ]](/icons/compressed.gif) | Cat in the Hat, The (USA).zip | 2019-05-30 04:07 | 54M | |
![[ ]](/icons/compressed.gif) | Centipede (USA).zip | 2019-05-30 04:07 | 316M | |
![[ ]](/icons/compressed.gif) | Championship Bass (USA).zip | 2019-05-30 04:07 | 142M | |
![[ ]](/icons/compressed.gif) | Championship Motocross 2001 featuring Ricky Carmichael (USA).zip | 2019-05-30 04:07 | 268M | |
![[ ]](/icons/compressed.gif) | Championship Motocross featuring Ricky Carmichael (USA).zip | 2019-05-30 04:07 | 525M | |
![[ ]](/icons/compressed.gif) | Championship Surfer (USA).zip | 2019-05-30 04:07 | 281M | |
![[ ]](/icons/compressed.gif) | Chess (USA).zip | 2019-05-30 04:07 | 182M | |
![[ ]](/icons/compressed.gif) | Chessmaster 3-D, The (USA).zip | 2019-05-30 04:07 | 116M | |
![[ ]](/icons/compressed.gif) | Chessmaster II (USA).zip | 2019-05-30 04:07 | 259M | |
![[ ]](/icons/compressed.gif) | Chicken Run (USA).zip | 2019-05-30 04:07 | 306M | |
![[ ]](/icons/compressed.gif) | Chocobo's Dungeon 2 (USA).zip | 2019-05-30 04:07 | 310M | |
![[ ]](/icons/compressed.gif) | Chocobo Racing (USA).zip | 2019-05-30 04:07 | 219M | |
![[ ]](/icons/compressed.gif) | Chronicles of the Sword (USA) (Disc 1).zip | 2019-05-30 04:07 | 457M | |
![[ ]](/icons/compressed.gif) | Chronicles of the Sword (USA) (Disc 2).zip | 2019-05-30 04:07 | 321M | |
![[ ]](/icons/compressed.gif) | Chrono Cross (USA) (Disc 1).zip | 2019-05-30 04:07 | 492M | |
![[ ]](/icons/compressed.gif) | Chrono Cross (USA) (Disc 2).zip | 2019-05-30 04:07 | 475M | |
![[ ]](/icons/compressed.gif) | Circuit Breakers (USA).zip | 2019-05-30 04:07 | 253M | |
![[ ]](/icons/compressed.gif) | City of Lost Children, The (USA) (En,Es,It).zip | 2019-05-30 04:07 | 247M | |
![[ ]](/icons/compressed.gif) | Civilization II (USA).zip | 2019-05-30 04:07 | 305M | |
![[ ]](/icons/compressed.gif) | Cleopatra's Fortune (USA).zip | 2019-05-30 04:07 | 55M | |
![[ ]](/icons/compressed.gif) | Clock Tower (USA).zip | 2019-05-30 04:07 | 224M | |
![[ ]](/icons/compressed.gif) | Clock Tower II - The Struggle Within (USA).zip | 2019-05-30 04:07 | 116M | |
![[ ]](/icons/compressed.gif) | Code Breaker (USA) (Unl).zip | 2019-05-30 04:07 | 356K | |
![[ ]](/icons/compressed.gif) | Code Breaker Version 3 (USA) (Unl).zip | 2019-05-30 04:07 | 1.5M | |
![[ ]](/icons/compressed.gif) | Codename - Tenka (USA) (v1.0).zip | 2019-05-30 04:07 | 544M | |
![[ ]](/icons/compressed.gif) | Codename - Tenka (USA) (v1.1).zip | 2019-05-30 04:07 | 544M | |
![[ ]](/icons/compressed.gif) | Colin McRae Rally (USA).zip | 2019-05-30 04:07 | 241M | |
![[ ]](/icons/compressed.gif) | Colin McRae Rally 2.0 (USA) (En,Fr,Es).zip | 2019-05-30 04:07 | 279M | |
![[ ]](/icons/compressed.gif) | College Slam (USA).zip | 2019-05-30 04:07 | 391M | |
![[ ]](/icons/compressed.gif) | Colony Wars (USA) (Disc 1).zip | 2019-05-30 04:07 | 365M | |
![[ ]](/icons/compressed.gif) | Colony Wars (USA) (Disc 2).zip | 2019-05-30 04:07 | 447M | |
![[ ]](/icons/compressed.gif) | Colony Wars - Red Sun (USA).zip | 2019-05-30 04:07 | 411M | |
![[ ]](/icons/compressed.gif) | Colony Wars - Vengeance (USA).zip | 2019-05-30 04:07 | 375M | |
![[ ]](/icons/compressed.gif) | Command & Conquer (USA) (Disc 1) (GDI).zip | 2019-05-30 04:07 | 489M | |
![[ ]](/icons/compressed.gif) | Command & Conquer (USA) (Disc 2) (NOD).zip | 2019-05-30 04:07 | 471M | |
![[ ]](/icons/compressed.gif) | Command & Conquer - Red Alert (USA) (Disc 1) (Allies).zip | 2019-05-30 04:07 | 507M | |
![[ ]](/icons/compressed.gif) | Command & Conquer - Red Alert (USA) (Disc 2) (Soviet).zip | 2019-05-30 04:07 | 539M | |
![[ ]](/icons/compressed.gif) | Command & Conquer - Red Alert - Retaliation (USA) (Disc 1) (Allies).zip | 2019-05-30 04:07 | 375M | |
![[ ]](/icons/compressed.gif) | Command & Conquer - Red Alert - Retaliation (USA) (Disc 2) (Soviet).zip | 2019-05-30 04:07 | 387M | |
![[ ]](/icons/compressed.gif) | Contender (USA).zip | 2019-05-30 04:07 | 286M | |
![[ ]](/icons/compressed.gif) | Contender 2 (USA).zip | 2019-05-30 04:08 | 67M | |
![[ ]](/icons/compressed.gif) | Contra - Legacy of War (USA).zip | 2019-05-30 04:07 | 376M | |
![[ ]](/icons/compressed.gif) | Cool Boarders (USA).zip | 2019-05-30 04:08 | 294M | |
![[ ]](/icons/compressed.gif) | Cool Boarders 2 (USA).zip | 2019-05-30 04:08 | 605M | |
![[ ]](/icons/compressed.gif) | Cool Boarders 3 (USA).zip | 2019-05-30 04:08 | 158M | |
![[ ]](/icons/compressed.gif) | Cool Boarders 4 (USA).zip | 2019-05-30 04:08 | 129M | |
![[ ]](/icons/compressed.gif) | Cool Boarders 2001 (USA).zip | 2019-05-30 04:08 | 113M | |
![[ ]](/icons/compressed.gif) | Cosmic Cookoff - Language Arts (USA).zip | 2019-05-30 04:08 | 166M | |
![[ ]](/icons/compressed.gif) | Cosmic Cookoff - Mathematics (USA).zip | 2019-05-30 04:08 | 186M | |
![[ ]](/icons/compressed.gif) | Countdown Vampires (USA) (Disc 1).zip | 2019-05-30 04:08 | 204M | |
![[ ]](/icons/compressed.gif) | Countdown Vampires (USA) (Disc 2).zip | 2019-05-30 04:08 | 302M | |
![[ ]](/icons/compressed.gif) | Courier Crisis - The Saga of the Modern Fatalist (USA).zip | 2019-05-30 04:08 | 256M | |
![[ ]](/icons/compressed.gif) | Covert Ops - Nuclear Dawn (USA) (Disc 1).zip | 2019-05-30 04:08 | 481M | |
![[ ]](/icons/compressed.gif) | Covert Ops - Nuclear Dawn (USA) (Disc 2).zip | 2019-05-30 04:08 | 494M | |
![[ ]](/icons/compressed.gif) | Crash Bandicoot (USA).zip | 2019-05-30 04:08 | 521M | |
![[ ]](/icons/compressed.gif) | Crash Bandicoot - Warped (USA).zip | 2019-05-30 04:08 | 123M | |
![[ ]](/icons/compressed.gif) | Crash Bandicoot 2 - Cortex Strikes Back (USA).zip | 2019-05-30 04:08 | 123M | |
![[ ]](/icons/compressed.gif) | Crash Bash & Spyro - Year of the Dragon (USA) (Demo).zip | 2019-05-30 04:08 | 54M | |
![[ ]](/icons/compressed.gif) | Crash Bash (USA).zip | 2019-05-30 04:08 | 74M | |
![[ ]](/icons/compressed.gif) | Creative Camp (USA).zip | 2019-05-30 04:08 | 31M | |
![[ ]](/icons/compressed.gif) | Creative Isle (USA).zip | 2019-05-30 04:08 | 31M | |
![[ ]](/icons/compressed.gif) | Creative Journey 1 (USA).zip | 2019-05-30 04:08 | 30M | |
![[ ]](/icons/compressed.gif) | Creative Voyage (USA).zip | 2019-05-30 04:08 | 28M | |
![[ ]](/icons/compressed.gif) | Creatures (USA).zip | 2019-05-30 04:08 | 208M | |
![[ ]](/icons/compressed.gif) | Creatures - Raised in Space (USA).zip | 2019-05-30 04:08 | 171M | |
![[ ]](/icons/compressed.gif) | Crime Killer (USA) (Demo).zip | 2019-05-30 04:08 | 47M | |
![[ ]](/icons/compressed.gif) | Crime Killer (USA).zip | 2019-05-30 04:08 | 489M | |
![[ ]](/icons/compressed.gif) | Critical Depth (USA).zip | 2019-05-30 04:08 | 530M | |
![[ ]](/icons/compressed.gif) | Criticom (USA).zip | 2019-05-30 04:08 | 411M | |
![[ ]](/icons/compressed.gif) | Croc - Legend of the Gobbos (USA).zip | 2019-05-30 04:08 | 370M | |
![[ ]](/icons/compressed.gif) | Croc 2 (USA) (Demo).zip | 2019-05-30 04:08 | 37M | |
![[ ]](/icons/compressed.gif) | Croc 2 (USA).zip | 2019-05-30 04:08 | 395M | |
![[ ]](/icons/compressed.gif) | Crossroad Crisis (USA).zip | 2019-05-30 04:08 | 2.5M | |
![[ ]](/icons/compressed.gif) | Crow, The - City of Angels (USA).zip | 2019-05-30 04:08 | 177M | |
![[ ]](/icons/compressed.gif) | Crusader - No Remorse (USA).zip | 2019-05-30 04:08 | 561M | |
![[ ]](/icons/compressed.gif) | Crusaders of Might and Magic (USA).zip | 2019-05-30 04:08 | 260M | |
![[ ]](/icons/compressed.gif) | Crypt Killer (USA).zip | 2019-05-30 04:08 | 208M | |
![[ ]](/icons/compressed.gif) | Cubix Robots for Everyone - Race 'n Robots (USA).zip | 2019-05-30 04:08 | 298M | |
![[ ]](/icons/compressed.gif) | CyberSled (USA).zip | 2019-05-30 04:08 | 414M | |
![[ ]](/icons/compressed.gif) | CyberSpeed (USA) (v1.0).zip | 2019-05-30 04:08 | 533M | |
![[ ]](/icons/compressed.gif) | CyberSpeed (USA) (v1.1).zip | 2019-05-30 04:08 | 533M | |
![[ ]](/icons/compressed.gif) | CyberTiger (USA).zip | 2019-05-30 04:08 | 192M | |
![[ ]](/icons/compressed.gif) | Cyberia (USA).zip | 2019-05-30 04:08 | 267M | |
![[ ]](/icons/compressed.gif) | D (USA) (Disc 1).zip | 2019-05-30 04:08 | 482M | |
![[ ]](/icons/compressed.gif) | D (USA) (Disc 2).zip | 2019-05-30 04:08 | 518M | |
![[ ]](/icons/compressed.gif) | D (USA) (Disc 3).zip | 2019-05-30 04:08 | 311M | |
![[ ]](/icons/compressed.gif) | DBZ - Dead Ball Zone (USA) (En,Fr,De,Es,It).zip | 2019-05-30 04:08 | 261M | |
![[ ]](/icons/compressed.gif) | Dance Dance Revolution (USA).zip | 2019-05-30 04:08 | 213M | |
![[ ]](/icons/compressed.gif) | Dance Dance Revolution - Disney Mix (USA).zip | 2019-05-30 04:08 | 136M | |
![[ ]](/icons/compressed.gif) | Dance Dance Revolution Konamix (USA).zip | 2019-05-30 04:08 | 326M | |
![[ ]](/icons/compressed.gif) | Danger Girl (USA).zip | 2019-05-30 04:08 | 376M | |
![[ ]](/icons/compressed.gif) | Dare Devil Derby 3D (USA).zip | 2019-05-30 04:08 | 431M | |
![[ ]](/icons/compressed.gif) | Darklight Conflict (USA) (En,Fr,De,Es,It,Sv).zip | 2019-05-30 04:08 | 440M | |
![[ ]](/icons/compressed.gif) | Darkstalkers - The Night Warriors (USA).zip | 2019-05-30 04:08 | 419M | |
![[ ]](/icons/compressed.gif) | Darkstalkers 3 (USA).zip | 2019-05-30 04:08 | 481M | |
![[ ]](/icons/compressed.gif) | Darkstone (USA).zip | 2019-05-30 04:08 | 515M | |
![[ ]](/icons/compressed.gif) | Dave Mirra Freestyle BMX (USA).zip | 2019-05-30 04:08 | 214M | |
![[ ]](/icons/compressed.gif) | Dave Mirra Freestyle BMX - Maximum Remix (USA).zip | 2019-05-30 04:08 | 249M | |
![[ ]](/icons/compressed.gif) | David Beckham Soccer (USA).zip | 2019-05-30 04:08 | 125M | |
![[ ]](/icons/compressed.gif) | Dead in the Water (USA).zip | 2019-05-30 04:08 | 442M | |
![[ ]](/icons/compressed.gif) | Dead or Alive (USA).zip | 2019-05-30 04:08 | 459M | |
![[ ]](/icons/compressed.gif) | Deception III - Dark Delusion (USA).zip | 2019-05-30 04:08 | 439M | |
![[ ]](/icons/compressed.gif) | Defcon 5 - Peace Has a Price (USA).zip | 2019-05-30 04:08 | 330M | |
![[ ]](/icons/compressed.gif) | Delta Force Urban Warfare (USA) (En,Fr,Es).zip | 2019-05-30 04:08 | 115M | |
![[ ]](/icons/compressed.gif) | Demolition Racer (USA).zip | 2019-05-30 04:08 | 171M | |
![[ ]](/icons/compressed.gif) | Descent (USA).zip | 2019-05-30 04:08 | 349M | |
![[ ]](/icons/compressed.gif) | Descent Maximum (USA).zip | 2019-05-30 04:08 | 317M | |
![[ ]](/icons/compressed.gif) | Destrega (USA).zip | 2019-05-30 04:08 | 300M | |
![[ ]](/icons/compressed.gif) | Destruction Derby (USA).zip | 2019-05-30 04:08 | 562M | |
![[ ]](/icons/compressed.gif) | Destruction Derby 2 (USA).zip | 2019-05-30 04:08 | 561M | |
![[ ]](/icons/compressed.gif) | Destruction Derby Raw (USA).zip | 2019-05-30 04:08 | 551M | |
![[ ]](/icons/compressed.gif) | Detective Barbie - The Mystery Cruise (USA).zip | 2019-05-30 04:08 | 173M | |
![[ ]](/icons/compressed.gif) | Devil Dice (USA).zip | 2019-05-30 04:08 | 408M | |
![[ ]](/icons/compressed.gif) | Dexter's Laboratory - Mandark's Lab (USA).zip | 2019-05-30 04:08 | 244M | |
![[ ]](/icons/compressed.gif) | Diablo (USA) (En,Fr,De,Sv).zip | 2019-05-30 04:08 | 425M | |
![[ ]](/icons/compressed.gif) | Die Hard Trilogy (USA) (v1.0).zip | 2019-05-30 04:08 | 449M | |
![[ ]](/icons/compressed.gif) | Die Hard Trilogy (USA) (v1.1).zip | 2019-05-30 04:08 | 449M | |
![[ ]](/icons/compressed.gif) | Die Hard Trilogy 2 - Viva Las Vegas (USA).zip | 2019-05-30 04:08 | 418M | |
![[ ]](/icons/compressed.gif) | Digimon Digital Card Battle (USA).zip | 2019-05-30 04:08 | 111M | |
![[ ]](/icons/compressed.gif) | Digimon Rumble Arena (USA).zip | 2019-05-30 04:08 | 172M | |
![[ ]](/icons/compressed.gif) | Digimon World (USA).zip | 2019-05-30 04:08 | 227M | |
![[ ]](/icons/compressed.gif) | Digimon World 2 (USA).zip | 2019-05-30 04:08 | 207M | |
![[ ]](/icons/compressed.gif) | Digimon World 3 (USA).zip | 2019-05-30 04:08 | 428M | |
![[ ]](/icons/compressed.gif) | Dino Crisis (USA) (Demo).zip | 2019-05-30 04:08 | 15M | |
![[ ]](/icons/compressed.gif) | Dino Crisis (USA) (v1.0).zip | 2019-05-30 04:08 | 266M | |
![[ ]](/icons/compressed.gif) | Dino Crisis (USA) (v1.1).zip | 2019-05-30 04:08 | 266M | |
![[ ]](/icons/compressed.gif) | Dino Crisis 2 (USA).zip | 2019-05-30 04:08 | 346M | |
![[ ]](/icons/compressed.gif) | Dirt Jockey - Heavy Equipment Operator (USA).zip | 2019-05-30 04:08 | 225M | |
![[ ]](/icons/compressed.gif) | Discworld II - Mortality Bytes! (USA).zip | 2019-05-30 04:08 | 490M | |
![[ ]](/icons/compressed.gif) | Disney's 101 Dalmatians II - Patch's London Adventure (USA).zip | 2019-05-30 04:09 | 541M | |
![[ ]](/icons/compressed.gif) | Disney's 102 Dalmatians - Puppies to the Rescue (USA).zip | 2019-05-30 04:09 | 84M | |
![[ ]](/icons/compressed.gif) | Disney's Aladdin in Nasira's Revenge (USA).zip | 2019-05-30 04:09 | 417M | |
![[ ]](/icons/compressed.gif) | Disney's Atlantis - The Lost Empire (USA).zip | 2019-05-30 04:09 | 215M | |
![[ ]](/icons/compressed.gif) | Disney's Dinosaur (USA).zip | 2019-05-30 04:09 | 362M | |
![[ ]](/icons/compressed.gif) | Disney's Donald Duck - Goin' Quackers (USA).zip | 2019-05-30 04:09 | 237M | |
![[ ]](/icons/compressed.gif) | Disney's Goofy's Fun House (USA).zip | 2019-05-30 04:09 | 513M | |
![[ ]](/icons/compressed.gif) | Disney's Hercules Action Game (USA) (v1.0).zip | 2019-05-30 04:09 | 230M | |
![[ ]](/icons/compressed.gif) | Disney's Hercules Action Game (USA) (v1.1).zip | 2019-05-30 04:09 | 230M | |
![[ ]](/icons/compressed.gif) | Disney's Lilo & Stitch (USA).zip | 2019-05-30 04:09 | 271M | |
![[ ]](/icons/compressed.gif) | Disney's Pooh's Party Game - In Search of the Treasure (USA).zip | 2019-05-30 04:09 | 416M | |
![[ ]](/icons/compressed.gif) | Disney's Story Studio - Mulan (USA).zip | 2019-05-30 04:09 | 94M | |
![[ ]](/icons/compressed.gif) | Disney's Tarzan (USA) (v1.0).zip | 2019-05-30 04:09 | 331M | |
![[ ]](/icons/compressed.gif) | Disney's Tarzan (USA) (v1.1).zip | 2019-05-30 04:09 | 325M | |
![[ ]](/icons/compressed.gif) | Disney's The Emperor's New Groove (USA).zip | 2019-05-30 04:09 | 436M | |
![[ ]](/icons/compressed.gif) | Disney's The Lion King II - Simba's Mighty Adventure (USA).zip | 2019-05-30 04:09 | 466M | |
![[ ]](/icons/compressed.gif) | Disney's The Little Mermaid II (USA).zip | 2019-05-30 04:09 | 350M | |
![[ ]](/icons/compressed.gif) | Disney's Treasure Planet (USA).zip | 2019-05-30 04:09 | 336M | |
![[ ]](/icons/compressed.gif) | Disney's Winnie the Pooh - Kindergarten (USA).zip | 2019-05-30 04:09 | 116M | |
![[ ]](/icons/compressed.gif) | Disney's Winnie the Pooh - Preschool (USA).zip | 2019-05-30 04:09 | 465M | |
![[ ]](/icons/compressed.gif) | Disney-Pixar A Bug's Life (USA) (v1.0).zip | 2019-05-30 04:09 | 497M | |
![[ ]](/icons/compressed.gif) | Disney-Pixar A Bug's Life (USA) (v1.1).zip | 2019-05-30 04:09 | 495M | |
![[ ]](/icons/compressed.gif) | Disney-Pixar Buzz Lightyear of Star Command (USA).zip | 2019-05-30 04:09 | 313M | |
![[ ]](/icons/compressed.gif) | Disney-Pixar Monsters, Inc. - Scream Team (USA).zip | 2019-05-30 04:09 | 403M | |
![[ ]](/icons/compressed.gif) | Disney-Pixar Toy Story 2 - Buzz Lightyear to the Rescue! (USA).zip | 2019-05-30 04:09 | 425M | |
![[ ]](/icons/compressed.gif) | Disney-Pixar Toy Story Racer (USA).zip | 2019-05-30 04:09 | 131M | |
![[ ]](/icons/compressed.gif) | Disney Presents Tigger's Honey Hunt (USA) (v1.0).zip | 2019-05-30 04:08 | 153M | |
![[ ]](/icons/compressed.gif) | Disney Presents Tigger's Honey Hunt (USA) (v1.1).zip | 2019-05-30 04:08 | 171M | |
![[ ]](/icons/compressed.gif) | Disruptor (USA).zip | 2019-05-30 04:09 | 499M | |
![[ ]](/icons/compressed.gif) | Divide, The - Enemies Within (USA).zip | 2019-05-30 04:09 | 188M | |
![[ ]](/icons/compressed.gif) | Doom (USA).zip | 2019-05-30 04:09 | 249M | |
![[ ]](/icons/compressed.gif) | Dora the Explorer - Barnyard Buddies (USA).zip | 2019-05-30 04:09 | 290M | |
![[ ]](/icons/compressed.gif) | Dracula - The Last Sanctuary (USA) (Disc 1).zip | 2019-05-30 04:09 | 504M | |
![[ ]](/icons/compressed.gif) | Dracula - The Last Sanctuary (USA) (Disc 2).zip | 2019-05-30 04:09 | 409M | |
![[ ]](/icons/compressed.gif) | Dracula - The Resurrection (USA) (Disc 1).zip | 2019-05-30 04:09 | 483M | |
![[ ]](/icons/compressed.gif) | Dracula - The Resurrection (USA) (Disc 2).zip | 2019-05-30 04:09 | 514M | |
![[ ]](/icons/compressed.gif) | Dragon Ball GT - Final Bout (USA).zip | 2019-05-30 04:09 | 56M | |
![[ ]](/icons/compressed.gif) | Dragon Ball Z - Ultimate Battle 22 (USA).zip | 2019-05-30 04:09 | 203M | |
![[ ]](/icons/compressed.gif) | DragonHeart - Fire & Steel (USA).zip | 2019-05-30 04:09 | 411M | |
![[ ]](/icons/compressed.gif) | Dragon Seeds (USA).zip | 2019-05-30 04:09 | 158M | |
![[ ]](/icons/compressed.gif) | Dragon Tales - Dragonseek (USA).zip | 2019-05-30 04:09 | 233M | |
![[ ]](/icons/compressed.gif) | Dragon Valor (USA) (Disc 1).zip | 2019-05-30 04:09 | 310M | |
![[ ]](/icons/compressed.gif) | Dragon Valor (USA) (Disc 2).zip | 2019-05-30 04:09 | 341M | |
![[ ]](/icons/compressed.gif) | Dragon Warrior VII (USA) (Disc 1).zip | 2019-05-30 04:09 | 523M | |
![[ ]](/icons/compressed.gif) | Dragon Warrior VII (USA) (Disc 2).zip | 2019-05-30 04:09 | 523M | |
![[ ]](/icons/compressed.gif) | Driver - You Are the Wheelman (USA) (Demo).zip | 2019-05-30 04:09 | 29M | |
![[ ]](/icons/compressed.gif) | Driver - You Are the Wheelman (USA) (v1.0).zip | 2019-05-30 04:09 | 465M | |
![[ ]](/icons/compressed.gif) | Driver - You Are the Wheelman (USA) (v1.1).zip | 2019-05-30 04:09 | 465M | |
![[ ]](/icons/compressed.gif) | Driver 2 (USA) (Disc 1) (v1.0).zip | 2019-05-30 04:09 | 441M | |
![[ ]](/icons/compressed.gif) | Driver 2 (USA) (Disc 1) (v1.1).zip | 2019-05-30 04:09 | 441M | |
![[ ]](/icons/compressed.gif) | Driver 2 (USA) (Disc 2) (v1.0).zip | 2019-05-30 04:09 | 374M | |
![[ ]](/icons/compressed.gif) | Driver 2 (USA) (Disc 2) (v1.1).zip | 2019-05-30 04:09 | 374M | |
![[ ]](/icons/compressed.gif) | Ducati World - Racing Challenge (USA).zip | 2019-05-30 04:09 | 533M | |
![[ ]](/icons/compressed.gif) | Duke Nukem - Land of the Babes (USA).zip | 2019-05-30 04:09 | 314M | |
![[ ]](/icons/compressed.gif) | Duke Nukem - Time to Kill (USA) (Demo).zip | 2019-05-30 04:09 | 32M | |
![[ ]](/icons/compressed.gif) | Duke Nukem - Time to Kill (USA).zip | 2019-05-30 04:09 | 204M | |
![[ ]](/icons/compressed.gif) | Duke Nukem - Total Meltdown (USA).zip | 2019-05-30 04:09 | 504M | |
![[ ]](/icons/compressed.gif) | Dukes of Hazzard, The - Racing for Home (USA) (Alt).zip | 2019-05-30 04:09 | 469M | |
![[ ]](/icons/compressed.gif) | Dukes of Hazzard, The - Racing for Home (USA).zip | 2019-05-30 04:09 | 469M | |
![[ ]](/icons/compressed.gif) | Dukes of Hazzard II, The - Daisy Dukes It Out (USA).zip | 2019-05-30 04:09 | 516M | |
![[ ]](/icons/compressed.gif) | Dune 2000 (USA).zip | 2019-05-30 04:09 | 485M | |
![[ ]](/icons/compressed.gif) | Dynasty Warriors (USA).zip | 2019-05-30 04:09 | 310M | |
![[ ]](/icons/compressed.gif) | E.T. the Extra-Terrestrial - Interplanetary Mission (USA).zip | 2019-05-30 04:09 | 150M | |
![[ ]](/icons/compressed.gif) | EA Sports Superbike 2000 (USA).zip | 2019-05-30 04:09 | 160M | |
![[ ]](/icons/compressed.gif) | EA Sports Supercross (USA).zip | 2019-05-30 04:09 | 244M | |
![[ ]](/icons/compressed.gif) | EA Sports Supercross 2000 (USA).zip | 2019-05-30 04:09 | 134M | |
![[ ]](/icons/compressed.gif) | ECW Anarchy Rulz (USA).zip | 2019-05-30 04:09 | 380M | |
![[ ]](/icons/compressed.gif) | ECW Hardcore Revolution (USA).zip | 2019-05-30 04:09 | 228M | |
![[ ]](/icons/compressed.gif) | ESPN Extreme Games (USA).zip | 2019-05-30 04:09 | 542M | |
![[ ]](/icons/compressed.gif) | ESPN MLS Gamenight (USA).zip | 2019-05-30 04:09 | 205M | |
![[ ]](/icons/compressed.gif) | Eagle One - Harrier Attack (USA) (En,Fr,Es).zip | 2019-05-30 04:09 | 341M | |
![[ ]](/icons/compressed.gif) | Easter Bunny's Big Day (USA).zip | 2019-05-30 04:09 | 160M | |
![[ ]](/icons/compressed.gif) | Echo Night (USA).zip | 2019-05-30 04:09 | 216M | |
![[ ]](/icons/compressed.gif) | Eggs of Steel - Charlie's Eggcellent Adventure (USA).zip | 2019-05-30 04:10 | 482M | |
![[ ]](/icons/compressed.gif) | Ehrgeiz - God Bless the Ring (USA).zip | 2019-05-30 04:10 | 469M | |
![[ ]](/icons/compressed.gif) | Eidos Demo CD (USA).zip | 2019-05-30 04:10 | 170M | |
![[ ]](/icons/compressed.gif) | Eidos Demo CD Volume 4 (USA).zip | 2019-05-30 04:10 | 188M | |
![[ ]](/icons/compressed.gif) | Einhaender (USA).zip | 2019-05-30 04:10 | 307M | |
![[ ]](/icons/compressed.gif) | Elemental Gearbolt (USA).zip | 2019-05-30 04:10 | 373M | |
![[ ]](/icons/compressed.gif) | Eliminator (USA).zip | 2019-05-30 04:10 | 483M | |
![[ ]](/icons/compressed.gif) | Epidemic (USA).zip | 2019-05-30 04:10 | 456M | |
![[ ]](/icons/compressed.gif) | Equestrian Showcase (USA).zip | 2019-05-30 04:10 | 157M | |
![[ ]](/icons/compressed.gif) | Eternal Eyes (USA).zip | 2019-05-30 04:10 | 179M | |
![[ ]](/icons/compressed.gif) | Evil Dead - Hail to the King (USA) (Disc 1).zip | 2019-05-30 04:10 | 275M | |
![[ ]](/icons/compressed.gif) | Evil Dead - Hail to the King (USA) (Disc 2).zip | 2019-05-30 04:10 | 438M | |
![[ ]](/icons/compressed.gif) | Evil Zone (USA).zip | 2019-05-30 04:10 | 458M | |
![[ ]](/icons/compressed.gif) | Excalibur 2555 A.D. (USA).zip | 2019-05-30 04:10 | 480M | |
![[ ]](/icons/compressed.gif) | Expendable (USA).zip | 2019-05-30 04:10 | 495M | |
![[ ]](/icons/compressed.gif) | Extreme Go-Kart Racing (USA).zip | 2019-05-30 04:10 | 175M | |
![[ ]](/icons/compressed.gif) | Extreme Pinball (USA).zip | 2019-05-30 04:10 | 137M | |
![[ ]](/icons/compressed.gif) | F1 2000 (USA).zip | 2019-05-30 04:10 | 320M | |
![[ ]](/icons/compressed.gif) | F1 Championship Season 2000 (USA).zip | 2019-05-30 04:10 | 386M | |
![[ ]](/icons/compressed.gif) | F1 Racing Championship (USA) (En,Fr).zip | 2019-05-30 04:10 | 325M | |
![[ ]](/icons/compressed.gif) | F1 World Grand Prix (USA).zip | 2019-05-30 04:10 | 211M | |
![[ ]](/icons/compressed.gif) | F1 World Grand Prix - 1999 Season (USA) (En,Fr,De,Es,It).zip | 2019-05-30 04:10 | 500M | |
![[ ]](/icons/compressed.gif) | FIFA - Road to World Cup 98 (USA) (En,Fr,De,Es,Nl,Sv).zip | 2019-05-30 04:10 | 422M | |
![[ ]](/icons/compressed.gif) | FIFA 99 (USA).zip | 2019-05-30 04:10 | 503M | |
![[ ]](/icons/compressed.gif) | FIFA 2000 - Major League Soccer (USA) (En,De,Es,Nl,Sv).zip | 2019-05-30 04:10 | 351M | |
![[ ]](/icons/compressed.gif) | FIFA 2001 (USA).zip | 2019-05-30 04:10 | 446M | |
![[ ]](/icons/compressed.gif) | FIFA Soccer 96 (USA).zip | 2019-05-30 04:10 | 341M | |
![[ ]](/icons/compressed.gif) | FIFA Soccer 97 (USA).zip | 2019-05-30 04:10 | 452M | |
![[ ]](/icons/compressed.gif) | FIFA Soccer 2002 (USA) (En,Es).zip | 2019-05-30 04:10 | 507M | |
![[ ]](/icons/compressed.gif) | FIFA Soccer 2003 (USA).zip | 2019-05-30 04:10 | 498M | |
![[ ]](/icons/compressed.gif) | FIFA Soccer 2004 (USA) (En,Es).zip | 2019-05-30 04:10 | 449M | |
![[ ]](/icons/compressed.gif) | FIFA Soccer 2005 (USA) (En,Es).zip | 2019-05-30 04:10 | 435M | |
![[ ]](/icons/compressed.gif) | FOX Sports Golf '99 (USA).zip | 2019-05-30 04:10 | 216M | |
![[ ]](/icons/compressed.gif) | FOX Sports Soccer '99 (USA) (En,Es).zip | 2019-05-30 04:10 | 159M | |
![[ ]](/icons/compressed.gif) | Fade to Black (USA) (En,Fr,De,Es,It).zip | 2019-05-30 04:10 | 369M | |
![[ ]](/icons/compressed.gif) | Faire Games - Language Arts (USA).zip | 2019-05-30 04:10 | 224M | |
![[ ]](/icons/compressed.gif) | Faire Games - Mathematics (USA).zip | 2019-05-30 04:10 | 250M | |
![[ ]](/icons/compressed.gif) | Family Card Games Fun Pack (USA).zip | 2019-05-30 04:10 | 516M | |
![[ ]](/icons/compressed.gif) | Family Connection - A Guide to Lightspan (USA).zip | 2019-05-30 04:10 | 543M | |
![[ ]](/icons/compressed.gif) | Family Feud (USA).zip | 2019-05-30 04:10 | 364M | |
![[ ]](/icons/compressed.gif) | Family Game Pack (USA).zip | 2019-05-30 04:10 | 77M | |
![[ ]](/icons/compressed.gif) | Fantastic Four (USA).zip | 2019-05-30 04:10 | 422M | |
![[ ]](/icons/compressed.gif) | Fatal Fury - Wild Ambition (USA).zip | 2019-05-30 04:10 | 461M | |
![[ ]](/icons/compressed.gif) | Fear Effect (USA) (Disc 1).zip | 2019-05-30 04:10 | 352M | |
![[ ]](/icons/compressed.gif) | Fear Effect (USA) (Disc 2).zip | 2019-05-30 04:10 | 388M | |
![[ ]](/icons/compressed.gif) | Fear Effect (USA) (Disc 3).zip | 2019-05-30 04:10 | 319M | |
![[ ]](/icons/compressed.gif) | Fear Effect (USA) (Disc 4).zip | 2019-05-30 04:10 | 356M | |
![[ ]](/icons/compressed.gif) | Fear Effect 2 - Retro Helix (USA) (Disc 1) (v1.0).zip | 2019-05-30 04:10 | 571M | |
![[ ]](/icons/compressed.gif) | Fear Effect 2 - Retro Helix (USA) (Disc 1) (v1.1).zip | 2019-05-30 04:10 | 571M | |
![[ ]](/icons/compressed.gif) | Fear Effect 2 - Retro Helix (USA) (Disc 2) (v1.0).zip | 2019-05-30 04:10 | 541M | |
![[ ]](/icons/compressed.gif) | Fear Effect 2 - Retro Helix (USA) (Disc 2) (v1.1).zip | 2019-05-30 04:11 | 541M | |
![[ ]](/icons/compressed.gif) | Fear Effect 2 - Retro Helix (USA) (Disc 3) (v1.0).zip | 2019-05-30 04:11 | 478M | |
![[ ]](/icons/compressed.gif) | Fear Effect 2 - Retro Helix (USA) (Disc 3) (v1.1).zip | 2019-05-30 04:11 | 478M | |
![[ ]](/icons/compressed.gif) | Fear Effect 2 - Retro Helix (USA) (Disc 4) (v1.0).zip | 2019-05-30 04:11 | 511M | |
![[ ]](/icons/compressed.gif) | Fear Effect 2 - Retro Helix (USA) (Disc 4) (v1.1).zip | 2019-05-30 04:11 | 511M | |
![[ ]](/icons/compressed.gif) | Felony 11-79 (USA).zip | 2019-05-30 04:11 | 241M | |
![[ ]](/icons/compressed.gif) | Fifth Element, The (USA).zip | 2019-05-30 04:11 | 519M | |
![[ ]](/icons/compressed.gif) | Fighter Maker (USA).zip | 2019-05-30 04:11 | 423M | |
![[ ]](/icons/compressed.gif) | Fighting Force (USA) (v1.0).zip | 2019-05-30 04:11 | 433M | |
![[ ]](/icons/compressed.gif) | Fighting Force (USA) (v1.1).zip | 2019-05-30 04:11 | 440M | |
![[ ]](/icons/compressed.gif) | Fighting Force (USA) (v1.2).zip | 2019-05-30 04:11 | 544M | |
![[ ]](/icons/compressed.gif) | Fighting Force 2 (USA).zip | 2019-05-30 04:11 | 188M | |
![[ ]](/icons/compressed.gif) | Final Doom (USA).zip | 2019-05-30 04:11 | 216M | |
![[ ]](/icons/compressed.gif) | Final Fantasy Anthology - Final Fantasy V (USA) (v1.0).zip | 2019-05-30 04:11 | 163M | |
![[ ]](/icons/compressed.gif) | Final Fantasy Anthology - Final Fantasy V (USA) (v1.1).zip | 2019-05-30 04:11 | 111M | |
![[ ]](/icons/compressed.gif) | Final Fantasy Anthology - Final Fantasy VI (USA) (v1.0).zip | 2019-05-30 04:11 | 202M | |
![[ ]](/icons/compressed.gif) | Final Fantasy Anthology - Final Fantasy VI (USA) (v1.1).zip | 2019-05-30 04:11 | 150M | |
![[ ]](/icons/compressed.gif) | Final Fantasy Chronicles - Chrono Trigger (USA) (v1.0).zip | 2019-05-30 04:11 | 296M | |
![[ ]](/icons/compressed.gif) | Final Fantasy Chronicles - Chrono Trigger (USA) (v1.1).zip | 2019-05-30 04:11 | 311M | |
![[ ]](/icons/compressed.gif) | Final Fantasy Chronicles - Final Fantasy IV (USA) (v1.0).zip | 2019-05-30 04:11 | 245M | |
![[ ]](/icons/compressed.gif) | Final Fantasy Chronicles - Final Fantasy IV (USA) (v1.1).zip | 2019-05-30 04:11 | 245M | |
![[ ]](/icons/compressed.gif) | Final Fantasy IX (USA) (Disc 1) (v1.0).zip | 2019-05-30 04:11 | 480M | |
![[ ]](/icons/compressed.gif) | Final Fantasy IX (USA) (Disc 1) (v1.1).zip | 2019-05-30 04:11 | 480M | |
![[ ]](/icons/compressed.gif) | Final Fantasy IX (USA) (Disc 2) (v1.0).zip | 2019-05-30 04:11 | 412M | |
![[ ]](/icons/compressed.gif) | Final Fantasy IX (USA) (Disc 2) (v1.1).zip | 2019-05-30 04:11 | 412M | |
![[ ]](/icons/compressed.gif) | Final Fantasy IX (USA) (Disc 3) (v1.0).zip | 2019-05-30 04:11 | 444M | |
![[ ]](/icons/compressed.gif) | Final Fantasy IX (USA) (Disc 3) (v1.1).zip | 2019-05-30 04:11 | 444M | |
![[ ]](/icons/compressed.gif) | Final Fantasy IX (USA) (Disc 4) (v1.0).zip | 2019-05-30 04:11 | 447M | |
![[ ]](/icons/compressed.gif) | Final Fantasy IX (USA) (Disc 4) (v1.1).zip | 2019-05-30 04:11 | 447M | |
![[ ]](/icons/compressed.gif) | Final Fantasy Origins (USA) (v1.0).zip | 2019-05-30 04:11 | 125M | |
![[ ]](/icons/compressed.gif) | Final Fantasy Origins (USA) (v1.1).zip | 2019-05-30 04:11 | 125M | |
![[ ]](/icons/compressed.gif) | Final Fantasy Tactics (USA).zip | 2019-05-30 04:11 | 239M | |
![[ ]](/icons/compressed.gif) | Final Fantasy VII (USA) (Disc 1).zip | 2019-05-30 04:11 | 519M | |
![[ ]](/icons/compressed.gif) | Final Fantasy VII (USA) (Disc 2).zip | 2019-05-30 04:11 | 507M | |
![[ ]](/icons/compressed.gif) | Final Fantasy VII (USA) (Disc 3).zip | 2019-05-30 04:11 | 456M | |
![[ ]](/icons/compressed.gif) | Final Fantasy VIII (USA) (Disc 1).zip | 2019-05-30 04:11 | 552M | |
![[ ]](/icons/compressed.gif) | Final Fantasy VIII (USA) (Disc 2).zip | 2019-05-30 04:11 | 510M | |
![[ ]](/icons/compressed.gif) | Final Fantasy VIII (USA) (Disc 3).zip | 2019-05-30 04:11 | 527M | |
![[ ]](/icons/compressed.gif) | Final Fantasy VIII (USA) (Disc 4).zip | 2019-05-30 04:11 | 497M | |
![[ ]](/icons/compressed.gif) | Final Fantasy VII Interactive Sampler CD (USA).zip | 2019-05-30 04:11 | 89M | |
![[ ]](/icons/compressed.gif) | Final Round, The (USA).zip | 2019-05-30 04:11 | 93M | |
![[ ]](/icons/compressed.gif) | Fisherman's Bait - A Bass Challenge (USA).zip | 2019-05-30 04:11 | 33M | |
![[ ]](/icons/compressed.gif) | Fisherman's Bait 2 - Big Ol' Bass (USA).zip | 2019-05-30 04:11 | 47M | |
![[ ]](/icons/compressed.gif) | Flintstones, The - Bedrock Bowling (USA).zip | 2019-05-30 04:11 | 270M | |
![[ ]](/icons/compressed.gif) | Floating Runner - Quest for the 7 Crystals (USA).zip | 2019-05-30 04:11 | 504M | |
![[ ]](/icons/compressed.gif) | Ford Racing (USA).zip | 2019-05-30 04:11 | 407M | |
![[ ]](/icons/compressed.gif) | Ford Truck Mania (USA).zip | 2019-05-30 04:11 | 147M | |
![[ ]](/icons/compressed.gif) | Formula 1 (USA) (v1.0).zip | 2019-05-30 04:11 | 480M | |
![[ ]](/icons/compressed.gif) | Formula 1 (USA) (v1.1).zip | 2019-05-30 04:11 | 432M | |
![[ ]](/icons/compressed.gif) | Formula 1 98 (USA) (En,Fr,De,Es,It,Fi).zip | 2019-05-30 04:11 | 344M | |
![[ ]](/icons/compressed.gif) | Formula 1 Championship Edition (USA) (En,Fr,De,Es,It).zip | 2019-05-30 04:11 | 457M | |
![[ ]](/icons/compressed.gif) | Formula One 99 (USA) (En,Fr,Es).zip | 2019-05-30 04:11 | 346M | |
![[ ]](/icons/compressed.gif) | Formula One 2000 (USA).zip | 2019-05-30 04:11 | 305M | |
![[ ]](/icons/compressed.gif) | Forsaken (USA).zip | 2019-05-30 04:11 | 549M | |
![[ ]](/icons/compressed.gif) | Fox Hunt (USA) (Disc 1).zip | 2019-05-30 04:12 | 496M | |
![[ ]](/icons/compressed.gif) | Fox Hunt (USA) (Disc 2).zip | 2019-05-30 04:12 | 524M | |
![[ ]](/icons/compressed.gif) | Fox Hunt (USA) (Disc 3).zip | 2019-05-30 04:12 | 523M | |
![[ ]](/icons/compressed.gif) | FoxKids.com - Micro Maniacs Racing (USA).zip | 2019-05-30 04:12 | 286M | |
![[ ]](/icons/compressed.gif) | Frank Thomas Big Hurt Baseball (USA).zip | 2019-05-30 04:12 | 125M | |
![[ ]](/icons/compressed.gif) | Freestyle Boardin' '99 (USA).zip | 2019-05-30 04:12 | 436M | |
![[ ]](/icons/compressed.gif) | Freestyle Motocross - McGrath vs. Pastrana (USA).zip | 2019-05-30 04:12 | 128M | |
![[ ]](/icons/compressed.gif) | Frogger (USA).zip | 2019-05-30 04:12 | 143M | |
![[ ]](/icons/compressed.gif) | Frogger 2 - Swampy's Revenge (USA).zip | 2019-05-30 04:12 | 196M | |
![[ ]](/icons/compressed.gif) | Front Mission 3 (USA).zip | 2019-05-30 04:12 | 369M | |
![[ ]](/icons/compressed.gif) | Future Cop - L.A.P.D. (USA) (Demo).zip | 2019-05-30 04:12 | 51M | |
![[ ]](/icons/compressed.gif) | Future Cop - L.A.P.D. (USA).zip | 2019-05-30 04:12 | 269M | |
![[ ]](/icons/compressed.gif) | G-Police (USA) (Disc 1).zip | 2019-05-30 04:12 | 439M | |
![[ ]](/icons/compressed.gif) | G-Police (USA) (Disc 2).zip | 2019-05-30 04:12 | 426M | |
![[ ]](/icons/compressed.gif) | G-Police - Weapons of Justice (USA).zip | 2019-05-30 04:12 | 401M | |
![[ ]](/icons/compressed.gif) | G. Darius (USA).zip | 2019-05-30 04:12 | 369M | |
![[ ]](/icons/compressed.gif) | Galaga - Destination Earth (USA).zip | 2019-05-30 04:12 | 323M | |
![[ ]](/icons/compressed.gif) | Galerians (USA) (Disc 1).zip | 2019-05-30 04:12 | 452M | |
![[ ]](/icons/compressed.gif) | Galerians (USA) (Disc 2).zip | 2019-05-30 04:12 | 432M | |
![[ ]](/icons/compressed.gif) | Galerians (USA) (Disc 3).zip | 2019-05-30 04:12 | 356M | |
![[ ]](/icons/compressed.gif) | Gallop Racer (USA).zip | 2019-05-30 04:12 | 224M | |
![[ ]](/icons/compressed.gif) | GameShark 2 Version 2 Code Archive Disc Version 1 (USA) (Unl).zip | 2019-05-30 04:12 | 44M | |
![[ ]](/icons/compressed.gif) | GameShark CDX Version 3.3 (USA) (Unl).zip | 2019-05-30 04:12 | 1.2M | |
![[ ]](/icons/compressed.gif) | GameShark CDX Version 3.4 (USA) (Unl).zip | 2019-05-30 04:12 | 63M | |
![[ ]](/icons/compressed.gif) | GameShark Lite (USA) (Unl).zip | 2019-05-30 04:12 | 158M | |
![[ ]](/icons/compressed.gif) | GameShark Sampler (USA) (Sample GameShark and Bonus Savegames) (Unl).zip | 2019-05-30 04:12 | 64M | |
![[ ]](/icons/compressed.gif) | GameShark Version 4.0 (USA) (Unl).zip | 2019-05-30 04:12 | 6.5M | |
![[ ]](/icons/compressed.gif) | Game of Life, The (USA).zip | 2019-05-30 04:12 | 325M | |
![[ ]](/icons/compressed.gif) | Gauntlet Legends (USA).zip | 2019-05-30 04:12 | 378M | |
![[ ]](/icons/compressed.gif) | Gekido - Urban Fighters (USA).zip | 2019-05-30 04:12 | 241M | |
![[ ]](/icons/compressed.gif) | Gekioh - Shooting King (USA).zip | 2019-05-30 04:12 | 437M | |
![[ ]](/icons/compressed.gif) | Geom Cube (USA).zip | 2019-05-30 04:12 | 526M | |
![[ ]](/icons/compressed.gif) | Gex (USA).zip | 2019-05-30 04:12 | 140M | |
![[ ]](/icons/compressed.gif) | Gex - Enter the Gecko (USA).zip | 2019-05-30 04:12 | 143M | |
![[ ]](/icons/compressed.gif) | Gex 3 - Deep Cover Gecko (USA).zip | 2019-05-30 04:12 | 242M | |
![[ ]](/icons/compressed.gif) | Ghost in the Shell (USA).zip | 2019-05-30 04:12 | 372M | |
![[ ]](/icons/compressed.gif) | Glover (USA).zip | 2019-05-30 04:12 | 179M | |
![[ ]](/icons/compressed.gif) | Goal Storm '97 (USA).zip | 2019-05-30 04:12 | 232M | |
![[ ]](/icons/compressed.gif) | Goal Storm (USA).zip | 2019-05-30 04:12 | 139M | |
![[ ]](/icons/compressed.gif) | Gold and Glory - The Road to El Dorado (USA).zip | 2019-05-30 04:12 | 315M | |
![[ ]](/icons/compressed.gif) | Golden Nugget (USA) (Disc 1).zip | 2019-05-30 04:12 | 410M | |
![[ ]](/icons/compressed.gif) | Golden Nugget (USA) (Disc 2).zip | 2019-05-30 04:12 | 267M | |
![[ ]](/icons/compressed.gif) | Gran Turismo (USA) (Demo).zip | 2019-05-30 04:12 | 396M | |
![[ ]](/icons/compressed.gif) | Gran Turismo (USA) (v1.0).zip | 2019-05-30 04:12 | 411M | |
![[ ]](/icons/compressed.gif) | Gran Turismo (USA) (v1.1).zip | 2019-05-30 04:12 | 411M | |
![[ ]](/icons/compressed.gif) | Gran Turismo 2 (USA) (Arcade Mode) (v1.0).zip | 2019-05-30 04:12 | 506M | |
![[ ]](/icons/compressed.gif) | Gran Turismo 2 (USA) (Arcade Mode) (v1.1).zip | 2019-05-30 04:12 | 506M | |
![[ ]](/icons/compressed.gif) | Gran Turismo 2 (USA) (Simulation Mode) (v1.0).zip | 2019-05-30 04:12 | 508M | |
![[ ]](/icons/compressed.gif) | Gran Turismo 2 (USA) (Simulation Mode) (v1.1).zip | 2019-05-30 04:12 | 508M | |
![[ ]](/icons/compressed.gif) | Gran Turismo 2 (USA) (Simulation Mode) (v1.2).zip | 2019-05-30 04:12 | 513M | |
![[ ]](/icons/compressed.gif) | Gran Turismo 2 - Music at the Speed of Sound - The Album (USA) (Bonus PlayStation Disc).zip | 2019-05-30 04:12 | 367M | |
![[ ]](/icons/compressed.gif) | Grand Slam (USA).zip | 2019-05-30 04:12 | 118M | |
![[ ]](/icons/compressed.gif) | Grand Theft Auto (USA).zip | 2019-05-30 04:12 | 621M | |
![[ ]](/icons/compressed.gif) | Grand Theft Auto - Mission Pack #1 - London 1969 (USA).zip | 2019-05-30 04:12 | 535M | |
![[ ]](/icons/compressed.gif) | Grand Theft Auto 2 (USA).zip | 2019-05-30 04:12 | 373M | |
![[ ]](/icons/compressed.gif) | Grandia (USA) (Disc 1).zip | 2019-05-30 04:12 | 483M | |
![[ ]](/icons/compressed.gif) | Grandia (USA) (Disc 2).zip | 2019-05-30 04:12 | 457M | |
![[ ]](/icons/compressed.gif) | Granstream Saga, The (USA).zip | 2019-05-30 04:12 | 396M | |
![[ ]](/icons/compressed.gif) | Grid Runner (USA).zip | 2019-05-30 04:12 | 447M | |
![[ ]](/icons/compressed.gif) | Grinch, The (USA) (En,Fr,Es).zip | 2019-05-30 04:12 | 242M | |
![[ ]](/icons/compressed.gif) | Grind Session (USA).zip | 2019-05-30 04:12 | 334M | |
![[ ]](/icons/compressed.gif) | Grudge Warriors (USA).zip | 2019-05-30 04:12 | 422M | |
![[ ]](/icons/compressed.gif) | Guardian's Crusade (USA).zip | 2019-05-30 04:12 | 214M | |
![[ ]](/icons/compressed.gif) | Gubble (USA).zip | 2019-05-30 04:12 | 555M | |
![[ ]](/icons/compressed.gif) | Guilty Gear (USA) (v1.0).zip | 2019-05-30 04:12 | 221M | |
![[ ]](/icons/compressed.gif) | Gundam Battle Assault (USA).zip | 2019-05-30 04:12 | 355M | |
![[ ]](/icons/compressed.gif) | Gundam Battle Assault 2 (USA).zip | 2019-05-30 04:13 | 119M | |
![[ ]](/icons/compressed.gif) | Gunfighter - The Legend of Jesse James (USA).zip | 2019-05-30 04:13 | 98M | |
![[ ]](/icons/compressed.gif) | Gunship (USA).zip | 2019-05-30 04:13 | 459M | |
![[ ]](/icons/compressed.gif) | HBO Boxing (USA).zip | 2019-05-30 04:13 | 303M | |
![[ ]](/icons/compressed.gif) | HardBall '99 (USA).zip | 2019-05-30 04:13 | 144M | |
![[ ]](/icons/compressed.gif) | HardBall 5 (USA).zip | 2019-05-30 04:13 | 69M | |
![[ ]](/icons/compressed.gif) | Harry Potter and the Chamber of Secrets (USA) (En,Fr,Es).zip | 2019-05-30 04:13 | 503M | |
![[ ]](/icons/compressed.gif) | Harry Potter and the Sorcerer's Stone (USA) (En,Fr,Es).zip | 2019-05-30 04:13 | 470M | |
![[ ]](/icons/compressed.gif) | Harvest Moon - Back to Nature (USA).zip | 2019-05-30 04:13 | 79M | |
![[ ]](/icons/compressed.gif) | Heart of Darkness (USA) (Disc 1).zip | 2019-05-30 04:13 | 376M | |
![[ ]](/icons/compressed.gif) | Heart of Darkness (USA) (Disc 2).zip | 2019-05-30 04:13 | 446M | |
![[ ]](/icons/compressed.gif) | Hellboy - Asylum Seeker (USA).zip | 2019-05-30 04:13 | 157M | |
![[ ]](/icons/compressed.gif) | Hello Kitty - Cube Frenzy (USA).zip | 2019-05-30 04:13 | 116M | |
![[ ]](/icons/compressed.gif) | Herc's Adventures (USA).zip | 2019-05-30 04:13 | 159M | |
![[ ]](/icons/compressed.gif) | Hexen (USA).zip | 2019-05-30 04:13 | 512M | |
![[ ]](/icons/compressed.gif) | Hi-Octane - The Track Fights Back! (USA) (En,Fr,De,Es).zip | 2019-05-30 04:13 | 295M | |
![[ ]](/icons/compressed.gif) | High Heat Baseball 2000 (USA).zip | 2019-05-30 04:13 | 188M | |
![[ ]](/icons/compressed.gif) | High Heat Major League Baseball 2002 (USA).zip | 2019-05-30 04:13 | 138M | |
![[ ]](/icons/compressed.gif) | Hive, The (USA) (Disc 1).zip | 2019-05-30 04:13 | 483M | |
![[ ]](/icons/compressed.gif) | Hive, The (USA) (Disc 2).zip | 2019-05-30 04:13 | 438M | |
![[ ]](/icons/compressed.gif) | Hogs of War (USA).zip | 2019-05-30 04:13 | 253M | |
![[ ]](/icons/compressed.gif) | Hooters Road Trip (USA).zip | 2019-05-30 04:13 | 176M | |
![[ ]](/icons/compressed.gif) | Hoshigami - Ruining Blue Earth (USA).zip | 2019-05-30 04:13 | 195M | |
![[ ]](/icons/compressed.gif) | Hot Shots Golf (USA).zip | 2019-05-30 04:13 | 159M | |
![[ ]](/icons/compressed.gif) | Hot Shots Golf 2 (USA).zip | 2019-05-30 04:13 | 168M | |
![[ ]](/icons/compressed.gif) | Hot Wheels - Extreme Racing (USA).zip | 2019-05-30 04:13 | 606M | |
![[ ]](/icons/compressed.gif) | Hot Wheels - Turbo Racing (USA).zip | 2019-05-30 04:13 | 601M | |
![[ ]](/icons/compressed.gif) | Hugo - The Evil Mirror (USA) (En,Es).zip | 2019-05-30 04:13 | 536M | |
![[ ]](/icons/compressed.gif) | Hydro Thunder (USA).zip | 2019-05-30 04:13 | 107M | |
![[ ]](/icons/compressed.gif) | I.Q - Intelligent Qube (USA).zip | 2019-05-30 04:13 | 115M | |
![[ ]](/icons/compressed.gif) | IHRA Drag Racing (USA).zip | 2019-05-30 04:13 | 464M | |
![[ ]](/icons/compressed.gif) | ISS Pro Evolution (USA).zip | 2019-05-30 04:13 | 308M | |
![[ ]](/icons/compressed.gif) | Ian Livingstone's Deathtrap Dungeon (USA).zip | 2019-05-30 04:13 | 258M | |
![[ ]](/icons/compressed.gif) | Impact Racing (USA).zip | 2019-05-30 04:13 | 494M | |
![[ ]](/icons/compressed.gif) | In Cold Blood (USA) (Disc 1).zip | 2019-05-30 04:13 | 349M | |
![[ ]](/icons/compressed.gif) | In Cold Blood (USA) (Disc 2).zip | 2019-05-30 04:13 | 426M | |
![[ ]](/icons/compressed.gif) | Incredible Crisis (USA).zip | 2019-05-30 04:13 | 427M | |
![[ ]](/icons/compressed.gif) | Incredible Hulk, The - The Pantheon Saga (USA).zip | 2019-05-30 04:13 | 540M | |
![[ ]](/icons/compressed.gif) | Independence Day (USA).zip | 2019-05-30 04:13 | 354M | |
![[ ]](/icons/compressed.gif) | Inspector Gadget - Gadget's Crazy Maze (USA) (En,Fr,De,Es,It,Nl).zip | 2019-05-30 04:13 | 362M | |
![[ ]](/icons/compressed.gif) | Intellivision Classic Games (USA).zip | 2019-05-30 04:13 | 237M | |
![[ ]](/icons/compressed.gif) | Interactive CD Sampler Disc 6 (USA).zip | 2019-05-30 04:13 | 471M | |
![[ ]](/icons/compressed.gif) | Interactive CD Sampler Disc Vol. 9 (USA).zip | 2019-05-30 04:13 | 460M | |
![[ ]](/icons/compressed.gif) | Interactive CD Sampler Disc Vol. 10 (USA).zip | 2019-05-30 04:13 | 413M | |
![[ ]](/icons/compressed.gif) | Interactive CD Sampler Disc Volume 4 (USA).zip | 2019-05-30 04:13 | 396M | |
![[ ]](/icons/compressed.gif) | Interactive CD Sampler Disc Volume 7 (USA).zip | 2019-05-30 04:13 | 437M | |
![[ ]](/icons/compressed.gif) | Interactive CD Sampler Disc Volume 8 (USA).zip | 2019-05-30 04:13 | 471M | |
![[ ]](/icons/compressed.gif) | Interactive CD Sampler Disk Volume 5 (USA) (v1.0).zip | 2019-05-30 04:13 | 338M | |
![[ ]](/icons/compressed.gif) | Interactive CD Sampler Disk Volume 5 (USA) (v1.1).zip | 2019-05-30 04:13 | 382M | |
![[ ]](/icons/compressed.gif) | Interactive CD Sampler Pack Volume 2 (USA).zip | 2019-05-30 04:13 | 474M | |
![[ ]](/icons/compressed.gif) | Interactive CD Sampler Pack Volume 3 (USA).zip | 2019-05-30 04:13 | 550M | |
![[ ]](/icons/compressed.gif) | Interactive CD Sampler Pack Volume 3.5 (USA) (SCUS-94177).zip | 2019-05-30 04:13 | 545M | |
![[ ]](/icons/compressed.gif) | Interactive CD Sampler Pack Volume 3.5 (USA) (SCUS-94966).zip | 2019-05-30 04:13 | 545M | |
![[ ]](/icons/compressed.gif) | International Superstar Soccer Pro '98 (USA) (En,Fr,De,Es,It).zip | 2019-05-30 04:13 | 322M | |
![[ ]](/icons/compressed.gif) | International Track & Field (USA).zip | 2019-05-30 04:13 | 72M | |
![[ ]](/icons/compressed.gif) | International Track & Field 2000 (USA).zip | 2019-05-30 04:13 | 170M | |
![[ ]](/icons/compressed.gif) | Interplay Sports Baseball 2000 (USA).zip | 2019-05-30 04:13 | 68M | |
![[ ]](/icons/compressed.gif) | In the Hunt (USA).zip | 2019-05-30 04:13 | 543M | |
![[ ]](/icons/compressed.gif) | Inuyasha - A Feudal Fairy Tale (USA) (v1.0).zip | 2019-05-30 04:13 | 260M | |
![[ ]](/icons/compressed.gif) | Inuyasha - A Feudal Fairy Tale (USA) (v1.1).zip | 2019-05-30 04:13 | 260M | |
![[ ]](/icons/compressed.gif) | Invasion from Beyond (USA).zip | 2019-05-30 04:13 | 397M | |
![[ ]](/icons/compressed.gif) | Iron Man & X-O Manowar in Heavy Metal (USA).zip | 2019-05-30 04:13 | 464M | |
![[ ]](/icons/compressed.gif) | Iron Soldier 3 (USA).zip | 2019-05-30 04:13 | 539M | |
![[ ]](/icons/compressed.gif) | Irritating Stick (USA).zip | 2019-05-30 04:14 | 23M | |
![[ ]](/icons/compressed.gif) | Italian Job, The (USA).zip | 2019-05-30 04:13 | 289M | |
![[ ]](/icons/compressed.gif) | Jackie Chan Stuntmaster (USA).zip | 2019-05-30 04:14 | 447M | |
![[ ]](/icons/compressed.gif) | Jade Cocoon - Story of the Tamamayu (USA) (Demo).zip | 2019-05-30 04:13 | 229M | |
![[ ]](/icons/compressed.gif) | Jade Cocoon - Story of the Tamamayu (USA).zip | 2019-05-30 04:14 | 400M | |
![[ ]](/icons/compressed.gif) | Jampack Vol. 1 (USA).zip | 2019-05-30 04:14 | 485M | |
![[ ]](/icons/compressed.gif) | Jampack Vol. 2 (USA).zip | 2019-05-30 04:14 | 387M | |
![[ ]](/icons/compressed.gif) | Jarrett & Labonte Stock Car Racing (USA).zip | 2019-05-30 04:14 | 167M | |
![[ ]](/icons/compressed.gif) | Jeopardy! (USA).zip | 2019-05-30 04:14 | 364M | |
![[ ]](/icons/compressed.gif) | Jeopardy! 2nd Edition (USA).zip | 2019-05-30 04:14 | 496M | |
![[ ]](/icons/compressed.gif) | Jeremy McGrath Supercross 98 (USA).zip | 2019-05-30 04:14 | 486M | |
![[ ]](/icons/compressed.gif) | Jeremy McGrath Supercross 2000 (USA).zip | 2019-05-30 04:14 | 139M | |
![[ ]](/icons/compressed.gif) | Jersey Devil (USA).zip | 2019-05-30 04:14 | 603M | |
![[ ]](/icons/compressed.gif) | Jet Moto (USA).zip | 2019-05-30 04:14 | 339M | |
![[ ]](/icons/compressed.gif) | Jet Moto 2 (USA).zip | 2019-05-30 04:14 | 472M | |
![[ ]](/icons/compressed.gif) | Jet Moto 2 - Championship Edition (USA).zip | 2019-05-30 04:14 | 472M | |
![[ ]](/icons/compressed.gif) | Jet Moto 3 (USA).zip | 2019-05-30 04:14 | 343M | |
![[ ]](/icons/compressed.gif) | Jigsaw Madness (USA).zip | 2019-05-30 04:14 | 221M | |
![[ ]](/icons/compressed.gif) | Jim Henson's Bear in the Big Blue House (USA).zip | 2019-05-30 04:14 | 148M | |
![[ ]](/icons/compressed.gif) | Jimmy Johnson's VR Football '98 (USA).zip | 2019-05-30 04:14 | 519M | |
![[ ]](/icons/compressed.gif) | Jimmy White's 2 - Cueball (USA).zip | 2019-05-30 04:14 | 150M | |
![[ ]](/icons/compressed.gif) | JoJo's Bizarre Adventure (USA).zip | 2019-05-30 04:14 | 418M | |
![[ ]](/icons/compressed.gif) | Johnny Bazookatone (USA).zip | 2019-05-30 04:14 | 264M | |
![[ ]](/icons/compressed.gif) | Judge Dredd (USA).zip | 2019-05-30 04:14 | 486M | |
![[ ]](/icons/compressed.gif) | Juggernaut (USA) (Disc 1).zip | 2019-05-30 04:14 | 472M | |
![[ ]](/icons/compressed.gif) | Juggernaut (USA) (Disc 2).zip | 2019-05-30 04:14 | 464M | |
![[ ]](/icons/compressed.gif) | Juggernaut (USA) (Disc 3).zip | 2019-05-30 04:14 | 453M | |
![[ ]](/icons/compressed.gif) | JumpStart Wildlife Safari - Field Trip (USA).zip | 2019-05-30 04:14 | 153M | |
![[ ]](/icons/compressed.gif) | Jumping Flash! (USA).zip | 2019-05-30 04:14 | 266M | |
![[ ]](/icons/compressed.gif) | Jumping Flash! 2 (USA).zip | 2019-05-30 04:14 | 280M | |
![[ ]](/icons/compressed.gif) | Jupiter Strike (USA).zip | 2019-05-30 04:14 | 242M | |
![[ ]](/icons/compressed.gif) | K-1 Grand Prix (USA).zip | 2019-05-30 04:14 | 442M | |
![[ ]](/icons/compressed.gif) | K-1 Revenge (USA).zip | 2019-05-30 04:14 | 411M | |
![[ ]](/icons/compressed.gif) | K-1 The Arena Fighters (USA).zip | 2019-05-30 04:14 | 406M | |
![[ ]](/icons/compressed.gif) | K9.5 1 - Live in Airedale (USA).zip | 2019-05-30 04:14 | 157M | |
![[ ]](/icons/compressed.gif) | K9.5 2 - We Are the Dogs! (USA).zip | 2019-05-30 04:14 | 121M | |
![[ ]](/icons/compressed.gif) | K9.5 3 - Webtunes (USA).zip | 2019-05-30 04:14 | 80M | |
![[ ]](/icons/compressed.gif) | K9.5 4 - The Tail-Wag Tour (USA).zip | 2019-05-30 04:14 | 98M | |
![[ ]](/icons/compressed.gif) | K9.5 5 - The Howlywood Premiere (USA).zip | 2019-05-30 04:14 | 560M | |
![[ ]](/icons/compressed.gif) | KISS Pinball (USA).zip | 2019-05-30 04:14 | 75M | |
![[ ]](/icons/compressed.gif) | Kagero - Deception II (USA) (Demo).zip | 2019-05-30 04:14 | 258M | |
![[ ]](/icons/compressed.gif) | Kagero - Deception II (USA).zip | 2019-05-30 04:14 | 326M | |
![[ ]](/icons/compressed.gif) | Kartia - The Word of Fate (USA).zip | 2019-05-30 04:14 | 262M | |
![[ ]](/icons/compressed.gif) | Kazmania 1 - Trail of Gems (USA).zip | 2019-05-30 04:14 | 219M | |
![[ ]](/icons/compressed.gif) | Kazmania 2 - Chaos in Kazmania (USA).zip | 2019-05-30 04:14 | 324M | |
![[ ]](/icons/compressed.gif) | Kensei - Sacred Fist (USA).zip | 2019-05-30 04:14 | 208M | |
![[ ]](/icons/compressed.gif) | Kickboxing (USA).zip | 2019-05-30 04:14 | 80M | |
![[ ]](/icons/compressed.gif) | Kileak - The DNA Imperative (USA).zip | 2019-05-30 04:14 | 365M | |
![[ ]](/icons/compressed.gif) | Killer Loop (USA).zip | 2019-05-30 04:14 | 577M | |
![[ ]](/icons/compressed.gif) | Killing Zone (USA).zip | 2019-05-30 04:14 | 211M | |
![[ ]](/icons/compressed.gif) | King's Field (USA).zip | 2019-05-30 04:14 | 145M | |
![[ ]](/icons/compressed.gif) | King's Field II (USA).zip | 2019-05-30 04:14 | 327M | |
![[ ]](/icons/compressed.gif) | King of Fighters '95, The (USA).zip | 2019-05-30 04:14 | 537M | |
![[ ]](/icons/compressed.gif) | King of Fighters '99, The (USA).zip | 2019-05-30 04:14 | 146M | |
![[ ]](/icons/compressed.gif) | Kingsley's Adventure (USA).zip | 2019-05-30 04:14 | 453M | |
![[ ]](/icons/compressed.gif) | Klonoa - Door to Phantomile (USA).zip | 2019-05-30 04:14 | 425M | |
![[ ]](/icons/compressed.gif) | Knockout Kings (USA).zip | 2019-05-30 04:14 | 170M | |
![[ ]](/icons/compressed.gif) | Knockout Kings 2000 (USA).zip | 2019-05-30 04:14 | 253M | |
![[ ]](/icons/compressed.gif) | Knockout Kings 2001 (USA).zip | 2019-05-30 04:14 | 462M | |
![[ ]](/icons/compressed.gif) | Konami Arcade Classics (USA).zip | 2019-05-30 04:14 | 81M | |
![[ ]](/icons/compressed.gif) | Koudelka (USA) (Disc 1).zip | 2019-05-30 04:14 | 266M | |
![[ ]](/icons/compressed.gif) | Koudelka (USA) (Disc 2).zip | 2019-05-30 04:14 | 267M | |
![[ ]](/icons/compressed.gif) | Koudelka (USA) (Disc 3).zip | 2019-05-30 04:14 | 324M | |
![[ ]](/icons/compressed.gif) | Koudelka (USA) (Disc 4).zip | 2019-05-30 04:14 | 328M | |
![[ ]](/icons/compressed.gif) | Krazy Ivan (USA).zip | 2019-05-30 04:14 | 508M | |
![[ ]](/icons/compressed.gif) | Kurt Warner's Arena Football Unleashed (USA).zip | 2019-05-30 04:14 | 349M | |
![[ ]](/icons/compressed.gif) | LEGO Island 2 - The Brickster's Revenge (USA).zip | 2019-05-30 04:14 | 172M | |
![[ ]](/icons/compressed.gif) | LEGO Racers (USA) (En,Fr,De,Es,It,Nl,Sv,No,Da,Fi).zip | 2019-05-30 04:14 | 178M | |
![[ ]](/icons/compressed.gif) | LEGO Rock Raiders (USA).zip | 2019-05-30 04:14 | 518M | |
![[ ]](/icons/compressed.gif) | Land Before Time, The - Big Water Adventure (USA).zip | 2019-05-30 04:14 | 280M | |
![[ ]](/icons/compressed.gif) | Land Before Time, The - Great Valley Racing Adventure (USA).zip | 2019-05-30 04:14 | 165M | |
![[ ]](/icons/compressed.gif) | Land Before Time, The - Return to the Great Valley (USA).zip | 2019-05-30 04:14 | 174M | |
![[ ]](/icons/compressed.gif) | Largo Winch - Commando SAR (USA).zip | 2019-05-30 04:14 | 107M | |
![[ ]](/icons/compressed.gif) | Legacy of Kain - Soul Reaver (USA).zip | 2019-05-30 04:15 | 421M | |
![[ ]](/icons/compressed.gif) | Legend of Dragoon, The (USA) (Disc 1).zip | 2019-05-30 04:14 | 272M | |
![[ ]](/icons/compressed.gif) | Legend of Dragoon, The (USA) (Disc 2).zip | 2019-05-30 04:14 | 317M | |
![[ ]](/icons/compressed.gif) | Legend of Dragoon, The (USA) (Disc 3).zip | 2019-05-30 04:15 | 355M | |
![[ ]](/icons/compressed.gif) | Legend of Dragoon, The (USA) (Disc 4).zip | 2019-05-30 04:15 | 424M | |
![[ ]](/icons/compressed.gif) | Legend of Legaia (USA) (Demo).zip | 2019-05-30 04:15 | 79M | |
![[ ]](/icons/compressed.gif) | Legend of Legaia (USA).zip | 2019-05-30 04:15 | 270M | |
![[ ]](/icons/compressed.gif) | Legend of Mana (USA).zip | 2019-05-30 04:15 | 415M | |
![[ ]](/icons/compressed.gif) | Lemmings & Oh No! More Lemmings (USA).zip | 2019-05-30 04:15 | 408M | |
![[ ]](/icons/compressed.gif) | Lethal Enforcers I & II (USA).zip | 2019-05-30 04:15 | 273M | |
![[ ]](/icons/compressed.gif) | Liquid Books Adventure 1 - Lety's Favorite Stories (USA).zip | 2019-05-30 04:15 | 217M | |
![[ ]](/icons/compressed.gif) | Liquid Books Adventure 2 - Amrita's Trees and Cerdito and the Coyote (USA).zip | 2019-05-30 04:15 | 427M | |
![[ ]](/icons/compressed.gif) | Liquid Books Adventure 3 - Far-Fetched Frontier Tales (USA).zip | 2019-05-30 04:15 | 272M | |
![[ ]](/icons/compressed.gif) | Liquid Books Adventure 4 - The Adventures of Adelita and Bo (USA).zip | 2019-05-30 04:15 | 310M | |
![[ ]](/icons/compressed.gif) | Liquid Books Adventure 5 - Pop-Out Prose (USA).zip | 2019-05-30 04:15 | 182M | |
![[ ]](/icons/compressed.gif) | Liquid Books Adventure 6 - The Wandering Path (USA).zip | 2019-05-30 04:15 | 276M | |
![[ ]](/icons/compressed.gif) | Loaded (USA) (En,Fr).zip | 2019-05-30 04:15 | 514M | |
![[ ]](/icons/compressed.gif) | Lode Runner (USA).zip | 2019-05-30 04:15 | 439M | |
![[ ]](/icons/compressed.gif) | Looney Tunes - Sheep Raider (USA) (En,Fr,Es,Pt).zip | 2019-05-30 04:15 | 302M | |
![[ ]](/icons/compressed.gif) | Looney Tunes Racing (USA) (En,Fr,Es).zip | 2019-05-30 04:15 | 312M | |
![[ ]](/icons/compressed.gif) | Lost World, The - Jurassic Park (USA).zip | 2019-05-30 04:15 | 562M | |
![[ ]](/icons/compressed.gif) | Lost World, The - Jurassic Park - Special Edition (USA).zip | 2019-05-30 04:15 | 564M | |
![[ ]](/icons/compressed.gif) | Lucky Luke (USA).zip | 2019-05-30 04:15 | 377M | |
![[ ]](/icons/compressed.gif) | Lunar - Silver Star Story Complete (USA) (Disc 1).zip | 2019-05-30 04:15 | 355M | |
![[ ]](/icons/compressed.gif) | Lunar - Silver Star Story Complete (USA) (Disc 2).zip | 2019-05-30 04:15 | 427M | |
![[ ]](/icons/compressed.gif) | Lunar - Silver Star Story Complete (USA) (The Making of).zip | 2019-05-30 04:15 | 544M | |
![[ ]](/icons/compressed.gif) | Lunar 2 - Eternal Blue Complete (USA) (Demo).zip | 2019-05-30 04:15 | 360M | |
![[ ]](/icons/compressed.gif) | Lunar 2 - Eternal Blue Complete (USA) (Disc 1).zip | 2019-05-30 04:15 | 455M | |
![[ ]](/icons/compressed.gif) | Lunar 2 - Eternal Blue Complete (USA) (Disc 2).zip | 2019-05-30 04:15 | 433M | |
![[ ]](/icons/compressed.gif) | Lunar 2 - Eternal Blue Complete (USA) (Disc 3).zip | 2019-05-30 04:15 | 440M | |
![[ ]](/icons/compressed.gif) | Lunar 2 - Eternal Blue Complete (USA) (The Making of).zip | 2019-05-30 04:15 | 513M | |
![[ ]](/icons/compressed.gif) | M&M's - Shell Shocked (USA).zip | 2019-05-30 04:15 | 270M | |
![[ ]](/icons/compressed.gif) | MDK (USA).zip | 2019-05-30 04:15 | 540M | |
![[ ]](/icons/compressed.gif) | MLB 98 (USA).zip | 2019-05-30 04:15 | 177M | |
![[ ]](/icons/compressed.gif) | MLB 99 (USA).zip | 2019-05-30 04:15 | 363M | |
![[ ]](/icons/compressed.gif) | MLB 2000 (USA).zip | 2019-05-30 04:15 | 351M | |
![[ ]](/icons/compressed.gif) | MLB 2001 (USA) (Demo).zip | 2019-05-30 04:15 | 374M | |
![[ ]](/icons/compressed.gif) | MLB 2001 (USA).zip | 2019-05-30 04:15 | 374M | |
![[ ]](/icons/compressed.gif) | MLB 2002 (USA).zip | 2019-05-30 04:15 | 434M | |
![[ ]](/icons/compressed.gif) | MLB 2003 (USA).zip | 2019-05-30 04:15 | 358M | |
![[ ]](/icons/compressed.gif) | MLB 2004 (USA).zip | 2019-05-30 04:15 | 381M | |
![[ ]](/icons/compressed.gif) | MLB 2005 (USA).zip | 2019-05-30 04:15 | 416M | |
![[ ]](/icons/compressed.gif) | MLB Pennant Race (USA).zip | 2019-05-30 04:15 | 279M | |
![[ ]](/icons/compressed.gif) | MTV Celebrity Deathmatch (USA).zip | 2019-05-30 04:15 | 34M | |
![[ ]](/icons/compressed.gif) | MTV Music Generator (USA).zip | 2019-05-30 04:15 | 322M | |
![[ ]](/icons/compressed.gif) | MTV Sports - Pure Ride (USA).zip | 2019-05-30 04:15 | 334M | |
![[ ]](/icons/compressed.gif) | MTV Sports - Skateboarding featuring Andy Macdonald (USA).zip | 2019-05-30 04:15 | 360M | |
![[ ]](/icons/compressed.gif) | MTV Sports - Snowboarding (USA).zip | 2019-05-30 04:15 | 240M | |
![[ ]](/icons/compressed.gif) | MTV Sports - T.J. Lavin's Ultimate BMX (USA).zip | 2019-05-30 04:15 | 267M | |
![[ ]](/icons/compressed.gif) | Machine Head (USA).zip | 2019-05-30 04:15 | 527M | |
![[ ]](/icons/compressed.gif) | Machine Hunter (USA).zip | 2019-05-30 04:15 | 448M | |
![[ ]](/icons/compressed.gif) | Madden NFL 97 (USA).zip | 2019-05-30 04:15 | 433M | |
![[ ]](/icons/compressed.gif) | Madden NFL 98 (USA) (Alt).zip | 2019-05-30 04:15 | 468M | |
![[ ]](/icons/compressed.gif) | Madden NFL 98 (USA).zip | 2019-05-30 04:16 | 468M | |
![[ ]](/icons/compressed.gif) | Madden NFL 99 (USA).zip | 2019-05-30 04:15 | 458M | |
![[ ]](/icons/compressed.gif) | Madden NFL 2000 (USA).zip | 2019-05-30 04:15 | 509M | |
![[ ]](/icons/compressed.gif) | Madden NFL 2001 (USA).zip | 2019-05-30 04:15 | 234M | |
![[ ]](/icons/compressed.gif) | Madden NFL 2002 (USA).zip | 2019-05-30 04:15 | 253M | |
![[ ]](/icons/compressed.gif) | Madden NFL 2003 (USA).zip | 2019-05-30 04:15 | 286M | |
![[ ]](/icons/compressed.gif) | Madden NFL 2004 (USA).zip | 2019-05-30 04:15 | 280M | |
![[ ]](/icons/compressed.gif) | Madden NFL 2005 (USA).zip | 2019-05-30 04:15 | 282M | |
![[ ]](/icons/compressed.gif) | Magic - The Gathering - BattleMage (USA).zip | 2019-05-30 04:15 | 392M | |
![[ ]](/icons/compressed.gif) | Magic Carpet (USA) (En,Fr,De,Es,Sv).zip | 2019-05-30 04:15 | 343M | |
![[ ]](/icons/compressed.gif) | Marble Master (USA).zip | 2019-05-30 04:16 | 367M | |
![[ ]](/icons/compressed.gif) | March Madness '98 (USA).zip | 2019-05-30 04:16 | 284M | |
![[ ]](/icons/compressed.gif) | Mars Moose Adventure - Walkabout 1 - The Natural History Museum (USA).zip | 2019-05-30 04:16 | 344M | |
![[ ]](/icons/compressed.gif) | Mars Moose Adventure - Walkabout 2 - The Shakespeare Festival (USA).zip | 2019-05-30 04:16 | 495M | |
![[ ]](/icons/compressed.gif) | Mars Moose Adventure - Walkabout 3 - World Sports Day (USA).zip | 2019-05-30 04:16 | 199M | |
![[ ]](/icons/compressed.gif) | Mars Moose Cosmic Quest 1 - City Sights (USA).zip | 2019-05-30 04:16 | 360M | |
![[ ]](/icons/compressed.gif) | Mars Moose Cosmic Quest 2 - Fairy Tale Island (USA).zip | 2019-05-30 04:16 | 274M | |
![[ ]](/icons/compressed.gif) | Mars Moose Cosmic Quest 3 - Race Through France (USA).zip | 2019-05-30 04:16 | 357M | |
![[ ]](/icons/compressed.gif) | Mars Moose Stay and Play 1 - In the Clubhouse (USA).zip | 2019-05-30 04:16 | 288M | |
![[ ]](/icons/compressed.gif) | Mars Moose Stay and Play 2 - In Mars' Bedroom (USA).zip | 2019-05-30 04:16 | 228M | |
![[ ]](/icons/compressed.gif) | Mars Moose Stay and Play 3 - In Lonnie's Classroom (USA).zip | 2019-05-30 04:16 | 295M | |
![[ ]](/icons/compressed.gif) | Martian Gothic - Unification (USA).zip | 2019-05-30 04:16 | 260M | |
![[ ]](/icons/compressed.gif) | Marvel Super Heroes (USA).zip | 2019-05-30 04:16 | 303M | |
![[ ]](/icons/compressed.gif) | Marvel Super Heroes vs. Street Fighter (USA).zip | 2019-05-30 04:16 | 285M | |
![[ ]](/icons/compressed.gif) | Marvel vs. Capcom - Clash of Super Heroes (USA).zip | 2019-05-30 04:16 | 267M | |
![[ ]](/icons/compressed.gif) | Mary-Kate and Ashley - Crush Course (USA).zip | 2019-05-30 04:16 | 287M | |
![[ ]](/icons/compressed.gif) | Mary-Kate and Ashley - Magical Mystery Mall (USA).zip | 2019-05-30 04:16 | 198M | |
![[ ]](/icons/compressed.gif) | Mary-Kate and Ashley - Winners Circle (USA).zip | 2019-05-30 04:16 | 134M | |
![[ ]](/icons/compressed.gif) | Mass Destruction (USA).zip | 2019-05-30 04:16 | 377M | |
![[ ]](/icons/compressed.gif) | Master of Monsters - Disciples of Gaia (USA).zip | 2019-05-30 04:16 | 137M | |
![[ ]](/icons/compressed.gif) | Mat Hoffman's Pro BMX (USA).zip | 2019-05-30 04:16 | 480M | |
![[ ]](/icons/compressed.gif) | Math Gallery - Collection 1 (USA).zip | 2019-05-30 04:16 | 235M | |
![[ ]](/icons/compressed.gif) | Math Gallery - Collection 2 (USA).zip | 2019-05-30 04:16 | 228M | |
![[ ]](/icons/compressed.gif) | Math on the Move! 1 - Addition & Subtraction - Advanced (USA).zip | 2019-05-30 04:16 | 499M | |
![[ ]](/icons/compressed.gif) | Math on the Move! 1 - Addition & Subtraction - Intermediate (USA).zip | 2019-05-30 04:16 | 492M | |
![[ ]](/icons/compressed.gif) | Math on the Move! 2 - Multiplication & Division - Advanced (USA).zip | 2019-05-30 04:16 | 250M | |
![[ ]](/icons/compressed.gif) | Math on the Move! 2 - Multiplication & Division - Intermediate (USA).zip | 2019-05-30 04:16 | 233M | |
![[ ]](/icons/compressed.gif) | Maximum Force (USA).zip | 2019-05-30 04:16 | 366M | |
![[ ]](/icons/compressed.gif) | MechWarrior 2 - 31st Century Combat - Arcade Combat Edition (USA).zip | 2019-05-30 04:16 | 331M | |
![[ ]](/icons/compressed.gif) | Medal of Honor (USA).zip | 2019-05-30 04:16 | 502M | |
![[ ]](/icons/compressed.gif) | Medal of Honor - Underground (USA).zip | 2019-05-30 04:16 | 534M | |
![[ ]](/icons/compressed.gif) | MediEvil (USA) (Demo).zip | 2019-05-30 04:16 | 30M | |
![[ ]](/icons/compressed.gif) | MediEvil (USA).zip | 2019-05-30 04:16 | 338M | |
![[ ]](/icons/compressed.gif) | MediEvil II (USA).zip | 2019-05-30 04:16 | 265M | |
![[ ]](/icons/compressed.gif) | Mega Man 8 (USA).zip | 2019-05-30 04:16 | 292M | |
![[ ]](/icons/compressed.gif) | Mega Man Legends (USA).zip | 2019-05-30 04:16 | 222M | |
![[ ]](/icons/compressed.gif) | Mega Man Legends 2 (USA) (Demo).zip | 2019-05-30 04:16 | 38M | |
![[ ]](/icons/compressed.gif) | Mega Man Legends 2 (USA).zip | 2019-05-30 04:16 | 240M | |
![[ ]](/icons/compressed.gif) | Mega Man X4 (USA).zip | 2019-05-30 04:16 | 392M | |
![[ ]](/icons/compressed.gif) | Mega Man X5 (USA).zip | 2019-05-30 04:16 | 333M | |
![[ ]](/icons/compressed.gif) | Mega Man X6 (USA) (v1.0).zip | 2019-05-30 04:16 | 360M | |
![[ ]](/icons/compressed.gif) | Mega Man X6 (USA) (v1.1).zip | 2019-05-30 04:16 | 360M | |
![[ ]](/icons/compressed.gif) | Men in Black - The Series - Crashdown (USA).zip | 2019-05-30 04:16 | 416M | |
![[ ]](/icons/compressed.gif) | Metal Gear Solid (USA) (Disc 1) (v1.0).zip | 2019-05-30 04:16 | 475M | |
![[ ]](/icons/compressed.gif) | Metal Gear Solid (USA) (Disc 1) (v1.1).zip | 2019-05-30 04:16 | 475M | |
![[ ]](/icons/compressed.gif) | Metal Gear Solid (USA) (Disc 2) (v1.0).zip | 2019-05-30 04:16 | 434M | |
![[ ]](/icons/compressed.gif) | Metal Gear Solid (USA) (Disc 2) (v1.1).zip | 2019-05-30 04:16 | 434M | |
![[ ]](/icons/compressed.gif) | Metal Gear Solid - VR Missions (USA) (Demo).zip | 2019-05-30 04:16 | 69M | |
![[ ]](/icons/compressed.gif) | Metal Gear Solid - VR Missions (USA).zip | 2019-05-30 04:16 | 339M | |
![[ ]](/icons/compressed.gif) | Metal Slug X (USA).zip | 2019-05-30 04:16 | 71M | |
![[ ]](/icons/compressed.gif) | Michelin Rally Masters - Race of Champions (USA) (En,Fr,Es).zip | 2019-05-30 04:16 | 407M | |
![[ ]](/icons/compressed.gif) | Micro Machines V3 (USA).zip | 2019-05-30 04:16 | 204M | |
![[ ]](/icons/compressed.gif) | Mike Tyson Boxing (USA) (En,Fr,Es).zip | 2019-05-30 04:16 | 254M | |
![[ ]](/icons/compressed.gif) | Miracle Space Race (USA).zip | 2019-05-30 04:16 | 36M | |
![[ ]](/icons/compressed.gif) | Misadventures of Tron Bonne, The (USA).zip | 2019-05-30 04:16 | 155M | |
![[ ]](/icons/compressed.gif) | Miss Spider's Tea Party (USA).zip | 2019-05-30 04:16 | 123M | |
![[ ]](/icons/compressed.gif) | Missile Command (USA).zip | 2019-05-30 04:16 | 198M | |
![[ ]](/icons/compressed.gif) | Mission - Impossible (USA) (En,Fr,Es).zip | 2019-05-30 04:16 | 370M | |
![[ ]](/icons/compressed.gif) | Mobil 1 Rally Championship (USA).zip | 2019-05-30 04:16 | 332M | |
![[ ]](/icons/compressed.gif) | Mobile Armor (USA).zip | 2019-05-30 04:16 | 474M | |
![[ ]](/icons/compressed.gif) | Mobile Light Force (USA).zip | 2019-05-30 04:16 | 243M | |
![[ ]](/icons/compressed.gif) | Mona & Moki 1 - Drive Me Wild! (USA).zip | 2019-05-30 04:16 | 326M | |
![[ ]](/icons/compressed.gif) | Mona & Moki 2 - Drive Me Wilder! (USA).zip | 2019-05-30 04:16 | 330M | |
![[ ]](/icons/compressed.gif) | Monaco Grand Prix (USA).zip | 2019-05-30 04:16 | 222M | |
![[ ]](/icons/compressed.gif) | Monkey Hero (USA).zip | 2019-05-30 04:16 | 118M | |
![[ ]](/icons/compressed.gif) | Monkey Magic (USA).zip | 2019-05-30 04:16 | 271M | |
![[ ]](/icons/compressed.gif) | Monopoly (USA).zip | 2019-05-30 04:16 | 208M | |
![[ ]](/icons/compressed.gif) | Monster Bass (USA).zip | 2019-05-30 04:16 | 459M | |
![[ ]](/icons/compressed.gif) | Monster Rancher (USA).zip | 2019-05-30 04:17 | 211M | |
![[ ]](/icons/compressed.gif) | Monster Rancher 2 (USA).zip | 2019-05-30 04:16 | 224M | |
![[ ]](/icons/compressed.gif) | Monster Rancher Battle Card - Episode II (USA).zip | 2019-05-30 04:16 | 86M | |
![[ ]](/icons/compressed.gif) | Monster Rancher Hop-A-Bout (USA).zip | 2019-05-30 04:16 | 145M | |
![[ ]](/icons/compressed.gif) | MonsterSeed (USA).zip | 2019-05-30 04:16 | 167M | |
![[ ]](/icons/compressed.gif) | Mortal Kombat - Special Forces (USA).zip | 2019-05-30 04:16 | 166M | |
![[ ]](/icons/compressed.gif) | Mortal Kombat 3 (USA).zip | 2019-05-30 04:16 | 337M | |
![[ ]](/icons/compressed.gif) | Mortal Kombat 4 (USA).zip | 2019-05-30 04:17 | 371M | |
![[ ]](/icons/compressed.gif) | Mortal Kombat Mythologies - Sub-Zero (USA).zip | 2019-05-30 04:17 | 335M | |
![[ ]](/icons/compressed.gif) | Mortal Kombat Trilogy (USA) (v1.0).zip | 2019-05-30 04:17 | 475M | |
![[ ]](/icons/compressed.gif) | Mortal Kombat Trilogy (USA) (v1.1).zip | 2019-05-30 04:17 | 483M | |
![[ ]](/icons/compressed.gif) | Mort the Chicken (USA).zip | 2019-05-30 04:16 | 405M | |
![[ ]](/icons/compressed.gif) | Moto Racer (USA).zip | 2019-05-30 04:17 | 393M | |
![[ ]](/icons/compressed.gif) | Moto Racer 2 (USA).zip | 2019-05-30 04:17 | 377M | |
![[ ]](/icons/compressed.gif) | Moto Racer World Tour (USA).zip | 2019-05-30 04:17 | 550M | |
![[ ]](/icons/compressed.gif) | Motocross Mania (USA).zip | 2019-05-30 04:17 | 348M | |
![[ ]](/icons/compressed.gif) | Motocross Mania 2 (USA).zip | 2019-05-30 04:17 | 95M | |
![[ ]](/icons/compressed.gif) | Motor Toon Grand Prix (USA).zip | 2019-05-30 04:17 | 239M | |
![[ ]](/icons/compressed.gif) | Motorhead (USA).zip | 2019-05-30 04:17 | 558M | |
![[ ]](/icons/compressed.gif) | Mr. Driller (USA).zip | 2019-05-30 04:17 | 155M | |
![[ ]](/icons/compressed.gif) | Ms. Pac-Man Maze Madness (USA) (Demo).zip | 2019-05-30 04:17 | 163M | |
![[ ]](/icons/compressed.gif) | Ms. Pac-Man Maze Madness (USA) (v1.0).zip | 2019-05-30 04:17 | 274M | |
![[ ]](/icons/compressed.gif) | Ms. Pac-Man Maze Madness (USA) (v1.1).zip | 2019-05-30 04:17 | 274M | |
![[ ]](/icons/compressed.gif) | Mummy, The (USA).zip | 2019-05-30 04:17 | 292M | |
![[ ]](/icons/compressed.gif) | Muppet Monster Adventure (USA).zip | 2019-05-30 04:17 | 363M | |
![[ ]](/icons/compressed.gif) | Muppet RaceMania (USA).zip | 2019-05-30 04:17 | 325M | |
![[ ]](/icons/compressed.gif) | My Disney Kitchen (USA).zip | 2019-05-30 04:17 | 162M | |
![[ ]](/icons/compressed.gif) | Myst (USA).zip | 2019-05-30 04:17 | 394M | |
![[ ]](/icons/compressed.gif) | N-Gen Racing (USA).zip | 2019-05-30 04:17 | 514M | |
![[ ]](/icons/compressed.gif) | N2O - Nitrous Oxide (USA).zip | 2019-05-30 04:17 | 381M | |
![[ ]](/icons/compressed.gif) | NASCAR 98 (USA).zip | 2019-05-30 04:17 | 360M | |
![[ ]](/icons/compressed.gif) | NASCAR 98 Collector's Edition (USA).zip | 2019-05-30 04:17 | 356M | |
![[ ]](/icons/compressed.gif) | NASCAR 99 (USA).zip | 2019-05-30 04:17 | 402M | |
![[ ]](/icons/compressed.gif) | NASCAR 99 Legacy (USA).zip | 2019-05-30 04:17 | 404M | |
![[ ]](/icons/compressed.gif) | NASCAR 2000 (USA).zip | 2019-05-30 04:17 | 473M | |
![[ ]](/icons/compressed.gif) | NASCAR 2001 (USA).zip | 2019-05-30 04:17 | 225M | |
![[ ]](/icons/compressed.gif) | NASCAR Heat (USA).zip | 2019-05-30 04:17 | 544M | |
![[ ]](/icons/compressed.gif) | NASCAR Racing (USA).zip | 2019-05-30 04:17 | 389M | |
![[ ]](/icons/compressed.gif) | NASCAR Rumble (USA).zip | 2019-05-30 04:17 | 159M | |
![[ ]](/icons/compressed.gif) | NASCAR Thunder 2002 (USA).zip | 2019-05-30 04:17 | 164M | |
![[ ]](/icons/compressed.gif) | NASCAR Thunder 2003 (USA).zip | 2019-05-30 04:17 | 180M | |
![[ ]](/icons/compressed.gif) | NASCAR Thunder 2004 (USA).zip | 2019-05-30 04:17 | 327M | |
![[ ]](/icons/compressed.gif) | NBA Basketball 2000 (USA).zip | 2019-05-30 04:17 | 192M | |
![[ ]](/icons/compressed.gif) | NBA Fastbreak '98 (USA).zip | 2019-05-30 04:17 | 225M | |
![[ ]](/icons/compressed.gif) | NBA Hangtime (USA).zip | 2019-05-30 04:17 | 33M | |
![[ ]](/icons/compressed.gif) | NBA Hoopz (USA).zip | 2019-05-30 04:17 | 108M | |
![[ ]](/icons/compressed.gif) | NBA Jam - Tournament Edition (USA).zip | 2019-05-30 04:17 | 368M | |
![[ ]](/icons/compressed.gif) | NBA Jam Extreme (USA).zip | 2019-05-30 04:17 | 71M | |
![[ ]](/icons/compressed.gif) | NBA Live 96 (USA).zip | 2019-05-30 04:17 | 430M | |
![[ ]](/icons/compressed.gif) | NBA Live 97 (USA).zip | 2019-05-30 04:17 | 528M | |
![[ ]](/icons/compressed.gif) | NBA Live 98 (USA).zip | 2019-05-30 04:17 | 431M | |
![[ ]](/icons/compressed.gif) | NBA Live 99 (USA).zip | 2019-05-30 04:17 | 410M | |
![[ ]](/icons/compressed.gif) | NBA Live 2000 (USA).zip | 2019-05-30 04:17 | 501M | |
![[ ]](/icons/compressed.gif) | NBA Live 2001 (USA).zip | 2019-05-30 04:17 | 313M | |
![[ ]](/icons/compressed.gif) | NBA Live 2002 (USA).zip | 2019-05-30 04:17 | 325M | |
![[ ]](/icons/compressed.gif) | NBA Live 2003 (USA).zip | 2019-05-30 04:17 | 314M | |
![[ ]](/icons/compressed.gif) | NBA Shoot Out '97 (USA).zip | 2019-05-30 04:17 | 197M | |
![[ ]](/icons/compressed.gif) | NBA Shoot Out (USA).zip | 2019-05-30 04:17 | 276M | |
![[ ]](/icons/compressed.gif) | NBA ShootOut 98 (USA).zip | 2019-05-30 04:17 | 311M | |
![[ ]](/icons/compressed.gif) | NBA ShootOut 2000 (USA).zip | 2019-05-30 04:17 | 266M | |
![[ ]](/icons/compressed.gif) | NBA ShootOut 2001 (USA).zip | 2019-05-30 04:17 | 255M | |
![[ ]](/icons/compressed.gif) | NBA ShootOut 2002 (USA).zip | 2019-05-30 04:17 | 269M | |
![[ ]](/icons/compressed.gif) | NBA ShootOut 2003 (USA).zip | 2019-05-30 04:17 | 228M | |
![[ ]](/icons/compressed.gif) | NBA ShootOut 2004 (USA).zip | 2019-05-30 04:17 | 257M | |
![[ ]](/icons/compressed.gif) | NBA Showtime - NBA on NBC (USA).zip | 2019-05-30 04:17 | 70M | |
![[ ]](/icons/compressed.gif) | NBA in the Zone '98 (USA) (v1.0).zip | 2019-05-30 04:17 | 293M | |
![[ ]](/icons/compressed.gif) | NBA in the Zone '98 (USA) (v1.1).zip | 2019-05-30 04:17 | 293M | |
![[ ]](/icons/compressed.gif) | NBA in the Zone '99 (USA).zip | 2019-05-30 04:17 | 350M | |
![[ ]](/icons/compressed.gif) | NBA in the Zone (USA).zip | 2019-05-30 04:17 | 231M | |
![[ ]](/icons/compressed.gif) | NBA in the Zone 2 (USA).zip | 2019-05-30 04:17 | 173M | |
![[ ]](/icons/compressed.gif) | NBA in the Zone 2000 (USA).zip | 2019-05-30 04:18 | 142M | |
![[ ]](/icons/compressed.gif) | NCAA Basketball Final Four 97 (USA).zip | 2019-05-30 04:17 | 289M | |
![[ ]](/icons/compressed.gif) | NCAA Final Four 99 (USA).zip | 2019-05-30 04:18 | 164M | |
![[ ]](/icons/compressed.gif) | NCAA Final Four 2000 (USA).zip | 2019-05-30 04:18 | 259M | |
![[ ]](/icons/compressed.gif) | NCAA Final Four 2001 (USA).zip | 2019-05-30 04:17 | 236M | |
![[ ]](/icons/compressed.gif) | NCAA Football 98 (USA).zip | 2019-05-30 04:18 | 235M | |
![[ ]](/icons/compressed.gif) | NCAA Football 99 (USA).zip | 2019-05-30 04:18 | 307M | |
![[ ]](/icons/compressed.gif) | NCAA Football 2000 (USA) (v1.0).zip | 2019-05-30 04:18 | 295M | |
![[ ]](/icons/compressed.gif) | NCAA Football 2000 (USA) (v1.1).zip | 2019-05-30 04:18 | 295M | |
![[ ]](/icons/compressed.gif) | NCAA Football 2001 (USA).zip | 2019-05-30 04:18 | 297M | |
![[ ]](/icons/compressed.gif) | NCAA Football GameBreaker (USA).zip | 2019-05-30 04:18 | 101M | |
![[ ]](/icons/compressed.gif) | NCAA GameBreaker 98 (USA).zip | 2019-05-30 04:18 | 241M | |
![[ ]](/icons/compressed.gif) | NCAA GameBreaker 99 (USA).zip | 2019-05-30 04:18 | 151M | |
![[ ]](/icons/compressed.gif) | NCAA GameBreaker 2000 (USA).zip | 2019-05-30 04:18 | 315M | |
![[ ]](/icons/compressed.gif) | NCAA GameBreaker 2001 (USA).zip | 2019-05-30 04:18 | 313M | |
![[ ]](/icons/compressed.gif) | NCAA March Madness 99 (USA).zip | 2019-05-30 04:18 | 480M | |
![[ ]](/icons/compressed.gif) | NCAA March Madness 2000 (USA).zip | 2019-05-30 04:18 | 378M | |
![[ ]](/icons/compressed.gif) | NCAA March Madness 2001 (USA).zip | 2019-05-30 04:18 | 369M | |
![[ ]](/icons/compressed.gif) | NFL Blitz (USA).zip | 2019-05-30 04:18 | 250M | |
![[ ]](/icons/compressed.gif) | NFL Blitz 2000 (USA).zip | 2019-05-30 04:18 | 206M | |
![[ ]](/icons/compressed.gif) | NFL Blitz 2001 (USA).zip | 2019-05-30 04:18 | 138M | |
![[ ]](/icons/compressed.gif) | NFL Full Contact (USA).zip | 2019-05-30 04:18 | 83M | |
![[ ]](/icons/compressed.gif) | NFL GameDay (USA).zip | 2019-05-30 04:18 | 209M | |
![[ ]](/icons/compressed.gif) | NFL GameDay 97 (USA).zip | 2019-05-30 04:18 | 229M | |
![[ ]](/icons/compressed.gif) | NFL GameDay 98 (USA).zip | 2019-05-30 04:18 | 345M | |
![[ ]](/icons/compressed.gif) | NFL GameDay 99 (USA) (v1.0).zip | 2019-05-30 04:18 | 195M | |
![[ ]](/icons/compressed.gif) | NFL GameDay 99 (USA) (v1.1).zip | 2019-05-30 04:18 | 195M | |
![[ ]](/icons/compressed.gif) | NFL GameDay 2000 (USA).zip | 2019-05-30 04:18 | 413M | |
![[ ]](/icons/compressed.gif) | NFL GameDay 2001 (USA).zip | 2019-05-30 04:18 | 314M | |
![[ ]](/icons/compressed.gif) | NFL GameDay 2002 (USA).zip | 2019-05-30 04:18 | 363M | |
![[ ]](/icons/compressed.gif) | NFL GameDay 2003 (USA).zip | 2019-05-30 04:18 | 380M | |
![[ ]](/icons/compressed.gif) | NFL GameDay 2004 (USA).zip | 2019-05-30 04:18 | 391M | |
![[ ]](/icons/compressed.gif) | NFL GameDay 2005 (USA).zip | 2019-05-30 04:18 | 350M | |
![[ ]](/icons/compressed.gif) | NFL Quarterback Club 97 (USA).zip | 2019-05-30 04:18 | 87M | |
![[ ]](/icons/compressed.gif) | NFL Xtreme (USA) (Demo).zip | 2019-05-30 04:18 | 35M | |
![[ ]](/icons/compressed.gif) | NFL Xtreme (USA).zip | 2019-05-30 04:18 | 211M | |
![[ ]](/icons/compressed.gif) | NFL Xtreme 2 (USA).zip | 2019-05-30 04:18 | 229M | |
![[ ]](/icons/compressed.gif) | NHL 97 (USA).zip | 2019-05-30 04:18 | 478M | |
![[ ]](/icons/compressed.gif) | NHL 98 (USA).zip | 2019-05-30 04:18 | 517M | |
![[ ]](/icons/compressed.gif) | NHL 99 (USA).zip | 2019-05-30 04:18 | 528M | |
![[ ]](/icons/compressed.gif) | NHL 2000 (USA).zip | 2019-05-30 04:18 | 539M | |
![[ ]](/icons/compressed.gif) | NHL 2001 (USA).zip | 2019-05-30 04:18 | 525M | |
![[ ]](/icons/compressed.gif) | NHL Blades of Steel 2000 (USA).zip | 2019-05-30 04:18 | 220M | |
![[ ]](/icons/compressed.gif) | NHL Breakaway 98 (USA).zip | 2019-05-30 04:18 | 105M | |
![[ ]](/icons/compressed.gif) | NHL Championship 2000 (USA).zip | 2019-05-30 04:18 | 254M | |
![[ ]](/icons/compressed.gif) | NHL Face Off '97 (USA).zip | 2019-05-30 04:18 | 173M | |
![[ ]](/icons/compressed.gif) | NHL Face Off (USA).zip | 2019-05-30 04:18 | 55M | |
![[ ]](/icons/compressed.gif) | NHL FaceOff 98 (USA).zip | 2019-05-30 04:18 | 146M | |
![[ ]](/icons/compressed.gif) | NHL FaceOff 99 (USA).zip | 2019-05-30 04:18 | 286M | |
![[ ]](/icons/compressed.gif) | NHL FaceOff 2000 (USA).zip | 2019-05-30 04:18 | 339M | |
![[ ]](/icons/compressed.gif) | NHL FaceOff 2001 (USA).zip | 2019-05-30 04:18 | 337M | |
![[ ]](/icons/compressed.gif) | NHL Open Ice - 2 on 2 Challenge (USA).zip | 2019-05-30 04:18 | 58M | |
![[ ]](/icons/compressed.gif) | NHL Powerplay '96 (USA).zip | 2019-05-30 04:18 | 163M | |
![[ ]](/icons/compressed.gif) | NHL Powerplay 98 (USA) (En,Fr,De).zip | 2019-05-30 04:18 | 277M | |
![[ ]](/icons/compressed.gif) | NHL Rock the Rink (USA).zip | 2019-05-30 04:18 | 354M | |
![[ ]](/icons/compressed.gif) | Nagano Winter Olympics '98 (USA).zip | 2019-05-30 04:18 | 166M | |
![[ ]](/icons/compressed.gif) | Namco Demo CD (USA).zip | 2019-05-30 04:18 | 287M | |
![[ ]](/icons/compressed.gif) | Namco Museum Vol. 1 (USA) (v1.0).zip | 2019-05-30 04:18 | 157M | |
![[ ]](/icons/compressed.gif) | Namco Museum Vol. 1 (USA) (v1.1).zip | 2019-05-30 04:18 | 157M | |
![[ ]](/icons/compressed.gif) | Namco Museum Vol. 2 (USA).zip | 2019-05-30 04:18 | 261M | |
![[ ]](/icons/compressed.gif) | Namco Museum Vol. 3 (USA).zip | 2019-05-30 04:18 | 243M | |
![[ ]](/icons/compressed.gif) | Namco Museum Vol. 4 (USA).zip | 2019-05-30 04:18 | 411M | |
![[ ]](/icons/compressed.gif) | Namco Museum Vol. 5 (USA).zip | 2019-05-30 04:18 | 261M | |
![[ ]](/icons/compressed.gif) | NanoTek Warrior (USA).zip | 2019-05-30 04:18 | 559M | |
![[ ]](/icons/compressed.gif) | Nectaris - Military Madness (USA).zip | 2019-05-30 04:18 | 287M | |
![[ ]](/icons/compressed.gif) | Need for Speed - High Stakes (USA).zip | 2019-05-30 04:18 | 572M | |
![[ ]](/icons/compressed.gif) | Need for Speed - Porsche Unleashed (USA).zip | 2019-05-30 04:18 | 524M | |
![[ ]](/icons/compressed.gif) | Need for Speed - V-Rally (USA).zip | 2019-05-30 04:18 | 248M | |
![[ ]](/icons/compressed.gif) | Need for Speed - V-Rally 2 (USA).zip | 2019-05-30 04:18 | 473M | |
![[ ]](/icons/compressed.gif) | Need for Speed II (USA).zip | 2019-05-30 04:18 | 344M | |
![[ ]](/icons/compressed.gif) | Need for Speed III - Hot Pursuit (USA).zip | 2019-05-30 04:18 | 407M | |
![[ ]](/icons/compressed.gif) | Newman Haas Racing (USA).zip | 2019-05-30 04:18 | 215M | |
![[ ]](/icons/compressed.gif) | Next Tetris, The (USA).zip | 2019-05-30 04:18 | 356M | |
![[ ]](/icons/compressed.gif) | Nickelodeon Rocket Power - Team Rocket Rescue (USA).zip | 2019-05-30 04:18 | 262M | |
![[ ]](/icons/compressed.gif) | Nickelodeon Rugrats - Search for Reptar (USA).zip | 2019-05-30 04:18 | 180M | |
![[ ]](/icons/compressed.gif) | Nickelodeon Rugrats - Studio Tour (USA).zip | 2019-05-30 04:18 | 188M | |
![[ ]](/icons/compressed.gif) | Nickelodeon Rugrats - Totally Angelica (USA).zip | 2019-05-30 04:19 | 83M | |
![[ ]](/icons/compressed.gif) | Nickelodeon Rugrats in Paris - The Movie (USA).zip | 2019-05-30 04:18 | 90M | |
![[ ]](/icons/compressed.gif) | Nickelodeon SpongeBob SquarePants - SuperSponge (USA).zip | 2019-05-30 04:19 | 38M | |
![[ ]](/icons/compressed.gif) | Nicktoons Racing (USA).zip | 2019-05-30 04:19 | 180M | |
![[ ]](/icons/compressed.gif) | Nightmare Creatures (USA).zip | 2019-05-30 04:19 | 556M | |
![[ ]](/icons/compressed.gif) | Nightmare Creatures II (USA).zip | 2019-05-30 04:19 | 367M | |
![[ ]](/icons/compressed.gif) | Ninja - Shadow of Darkness (USA).zip | 2019-05-30 04:19 | 555M | |
![[ ]](/icons/compressed.gif) | No Fear Downhill Mountain Bike Racing (USA).zip | 2019-05-30 04:19 | 177M | |
![[ ]](/icons/compressed.gif) | No One Can Stop Mr. Domino (USA).zip | 2019-05-30 04:19 | 151M | |
![[ ]](/icons/compressed.gif) | Norse by Norsewest - The Return of the Lost Vikings (USA).zip | 2019-05-30 04:19 | 169M | |
![[ ]](/icons/compressed.gif) | Novastorm (USA) (Disc 1).zip | 2019-05-30 04:19 | 369M | |
![[ ]](/icons/compressed.gif) | Novastorm (USA) (Disc 2).zip | 2019-05-30 04:19 | 436M | |
![[ ]](/icons/compressed.gif) | Nuclear Strike (USA).zip | 2019-05-30 04:19 | 557M | |
![[ ]](/icons/compressed.gif) | O.D.T. (USA).zip | 2019-05-30 04:19 | 407M | |
![[ ]](/icons/compressed.gif) | Oddworld - Abe's Exoddus (USA) (Disc 1).zip | 2019-05-30 04:19 | 439M | |
![[ ]](/icons/compressed.gif) | Oddworld - Abe's Exoddus (USA) (Disc 2).zip | 2019-05-30 04:19 | 361M | |
![[ ]](/icons/compressed.gif) | Oddworld - Abe's Oddysee (USA) (v1.0).zip | 2019-05-30 04:19 | 498M | |
![[ ]](/icons/compressed.gif) | Oddworld - Abe's Oddysee (USA) (v1.1).zip | 2019-05-30 04:19 | 482M | |
![[ ]](/icons/compressed.gif) | Off-World Interceptor Extreme (USA).zip | 2019-05-30 04:19 | 484M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 01 (USA).zip | 2019-05-30 04:19 | 99M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 02 (USA).zip | 2019-05-30 04:19 | 181M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 03 (USA).zip | 2019-05-30 04:19 | 181M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 04 (USA).zip | 2019-05-30 04:19 | 149M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 05 (USA).zip | 2019-05-30 04:19 | 185M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 06 (USA).zip | 2019-05-30 04:19 | 199M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 07 (USA).zip | 2019-05-30 04:19 | 134M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 08 (USA).zip | 2019-05-30 04:19 | 165M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 09 (USA).zip | 2019-05-30 04:19 | 233M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 10 (USA).zip | 2019-05-30 04:19 | 268M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 11 (USA).zip | 2019-05-30 04:19 | 249M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 12 (USA).zip | 2019-05-30 04:19 | 288M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 13 (USA).zip | 2019-05-30 04:19 | 372M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 14 (USA).zip | 2019-05-30 04:19 | 334M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 15 (USA).zip | 2019-05-30 04:19 | 383M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 16 (USA).zip | 2019-05-30 04:19 | 306M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 17 (USA).zip | 2019-05-30 04:19 | 471M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 18 (USA).zip | 2019-05-30 04:19 | 254M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 19 (USA).zip | 2019-05-30 04:19 | 207M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 20 (USA).zip | 2019-05-30 04:19 | 311M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 21 (USA).zip | 2019-05-30 04:19 | 313M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 22 (USA).zip | 2019-05-30 04:19 | 251M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 23 (USA).zip | 2019-05-30 04:19 | 330M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 24 (USA).zip | 2019-05-30 04:19 | 280M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 25 (USA).zip | 2019-05-30 04:19 | 385M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 26 (USA).zip | 2019-05-30 04:19 | 470M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 27 (USA).zip | 2019-05-30 04:19 | 234M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 28 (USA).zip | 2019-05-30 04:19 | 237M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 29 (USA).zip | 2019-05-30 04:19 | 132M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 30 (USA).zip | 2019-05-30 04:19 | 356M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 31 (USA).zip | 2019-05-30 04:19 | 189M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 32 (USA).zip | 2019-05-30 04:19 | 262M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 33 (USA).zip | 2019-05-30 04:19 | 288M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 34 (USA).zip | 2019-05-30 04:19 | 202M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 35 (USA).zip | 2019-05-30 04:19 | 140M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 36 (USA).zip | 2019-05-30 04:19 | 236M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 37 (USA).zip | 2019-05-30 04:19 | 261M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 38 (USA).zip | 2019-05-30 04:19 | 352M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 39 (USA).zip | 2019-05-30 04:19 | 232M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 40 (USA).zip | 2019-05-30 04:19 | 134M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 41 (USA).zip | 2019-05-30 04:19 | 192M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 42 (USA).zip | 2019-05-30 04:19 | 166M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 43 (USA) (EDC).zip | 2019-05-30 04:19 | 158M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 43 (USA) (No EDC).zip | 2019-05-30 04:19 | 158M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 44 (USA).zip | 2019-05-30 04:19 | 341M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 45 (USA).zip | 2019-05-30 04:19 | 132M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 46 (USA).zip | 2019-05-30 04:19 | 228M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 47 (USA).zip | 2019-05-30 04:19 | 399M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 48 (USA).zip | 2019-05-30 04:19 | 205M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 50 (USA).zip | 2019-05-30 04:19 | 312M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 52 (USA).zip | 2019-05-30 04:19 | 322M | |
![[ ]](/icons/compressed.gif) | Official U.S. PlayStation Magazine Demo Disc 54 (USA).zip | 2019-05-30 04:19 | 211M | |
![[ ]](/icons/compressed.gif) | Ogre Battle - Limited Edition (USA).zip | 2019-05-30 04:19 | 118M | |
![[ ]](/icons/compressed.gif) | Olympic Soccer (USA).zip | 2019-05-30 04:20 | 437M | |
![[ ]](/icons/compressed.gif) | Olympic Summer Games (USA).zip | 2019-05-30 04:20 | 382M | |
![[ ]](/icons/compressed.gif) | Omega Boost (USA).zip | 2019-05-30 04:20 | 322M | |
![[ ]](/icons/compressed.gif) | One (USA).zip | 2019-05-30 04:20 | 68M | |
![[ ]](/icons/compressed.gif) | One Piece Mansion (USA).zip | 2019-05-30 04:20 | 202M | |
![[ ]](/icons/compressed.gif) | OverBlood (USA).zip | 2019-05-30 04:20 | 352M | |
![[ ]](/icons/compressed.gif) | P.K.'s Math Studio 1 (USA).zip | 2019-05-30 04:20 | 38M | |
![[ ]](/icons/compressed.gif) | P.K.'s Place 1 - Party on the Patio! (USA).zip | 2019-05-30 04:20 | 366M | |
![[ ]](/icons/compressed.gif) | P.K.'s Place 2 - Hoopo at Sea (USA).zip | 2019-05-30 04:20 | 105M | |
![[ ]](/icons/compressed.gif) | P.K.'s Place 3 - Carlos at the Races! (USA).zip | 2019-05-30 04:20 | 132M | |
![[ ]](/icons/compressed.gif) | P.K.'s Place 4 - Daphne and the Seventh Wonder (USA).zip | 2019-05-30 04:20 | 100M | |
![[ ]](/icons/compressed.gif) | PGA Tour 96 (USA).zip | 2019-05-30 04:20 | 459M | |
![[ ]](/icons/compressed.gif) | PGA Tour 97 (USA).zip | 2019-05-30 04:20 | 339M | |
![[ ]](/icons/compressed.gif) | PGA Tour 98 (USA).zip | 2019-05-30 04:20 | 270M | |
![[ ]](/icons/compressed.gif) | PO'ed (USA).zip | 2019-05-30 04:20 | 66M | |
![[ ]](/icons/compressed.gif) | PS-X-Change Version 2.0 (USA) (Unl).zip | 2019-05-30 04:20 | 22K | |
![[ ]](/icons/compressed.gif) | PSone - Wherever, Whenever, Forever. (USA).zip | 2019-05-30 04:20 | 269M | |
![[ ]](/icons/compressed.gif) | PaRappa the Rapper (USA) (En,Fr,De,Es,It).zip | 2019-05-30 04:20 | 381M | |
![[ ]](/icons/compressed.gif) | Pac-Man World (USA).zip | 2019-05-30 04:20 | 442M | |
![[ ]](/icons/compressed.gif) | Pajama Sam - You Are What You Eat from Your Head to Your Feet (USA).zip | 2019-05-30 04:20 | 140M | |
![[ ]](/icons/compressed.gif) | Pandemonium! (USA).zip | 2019-05-30 04:20 | 92M | |
![[ ]](/icons/compressed.gif) | Pandemonium 2 (USA).zip | 2019-05-30 04:20 | 203M | |
![[ ]](/icons/compressed.gif) | Panzer Front (USA).zip | 2019-05-30 04:20 | 121M | |
![[ ]](/icons/compressed.gif) | Panzer General (USA).zip | 2019-05-30 04:20 | 268M | |
![[ ]](/icons/compressed.gif) | Parasite Eve (USA) (Disc 1).zip | 2019-05-30 04:20 | 316M | |
![[ ]](/icons/compressed.gif) | Parasite Eve (USA) (Disc 2).zip | 2019-05-30 04:20 | 331M | |
![[ ]](/icons/compressed.gif) | Parasite Eve II (USA) (Disc 1).zip | 2019-05-30 04:20 | 408M | |
![[ ]](/icons/compressed.gif) | Parasite Eve II (USA) (Disc 2).zip | 2019-05-30 04:20 | 452M | |
![[ ]](/icons/compressed.gif) | Patriotic Pinball (USA).zip | 2019-05-30 04:20 | 103M | |
![[ ]](/icons/compressed.gif) | Peak Performance (USA).zip | 2019-05-30 04:20 | 552M | |
![[ ]](/icons/compressed.gif) | Perfect Weapon (USA).zip | 2019-05-30 04:20 | 270M | |
![[ ]](/icons/compressed.gif) | Persona (USA).zip | 2019-05-30 04:20 | 405M | |
![[ ]](/icons/compressed.gif) | Persona 2 - Eternal Punishment (USA) (Bonus Disc).zip | 2019-05-30 04:20 | 240M | |
![[ ]](/icons/compressed.gif) | Persona 2 - Eternal Punishment (USA).zip | 2019-05-30 04:20 | 487M | |
![[ ]](/icons/compressed.gif) | Peter Jacobsen's Golden Tee Golf (USA).zip | 2019-05-30 04:20 | 143M | |
![[ ]](/icons/compressed.gif) | Peter Pan in Disney's Return to Never Land (USA).zip | 2019-05-30 04:20 | 381M | |
![[ ]](/icons/compressed.gif) | Philosoma (USA).zip | 2019-05-30 04:20 | 367M | |
![[ ]](/icons/compressed.gif) | Phix - The Adventure (USA).zip | 2019-05-30 04:20 | 478M | |
![[ ]](/icons/compressed.gif) | Pink Panther - Pinkadelic Pursuit (USA).zip | 2019-05-30 04:20 | 368M | |
![[ ]](/icons/compressed.gif) | Pinobee (USA).zip | 2019-05-30 04:20 | 193M | |
![[ ]](/icons/compressed.gif) | Pipe Dreams 3D (USA).zip | 2019-05-30 04:20 | 143M | |
![[ ]](/icons/compressed.gif) | Pitball (USA).zip | 2019-05-30 04:20 | 491M | |
![[ ]](/icons/compressed.gif) | Pitfall 3D - Beyond the Jungle (USA) (Demo).zip | 2019-05-30 04:20 | 134M | |
![[ ]](/icons/compressed.gif) | Pitfall 3D - Beyond the Jungle (USA).zip | 2019-05-30 04:20 | 340M | |
![[ ]](/icons/compressed.gif) | Pizza Hut Demo CD (USA).zip | 2019-05-30 04:20 | 179M | |
![[ ]](/icons/compressed.gif) | Pizza Hut Disc 1 (USA).zip | 2019-05-30 04:20 | 180M | |
![[ ]](/icons/compressed.gif) | Pizza Hut Disc 2 (USA).zip | 2019-05-30 04:20 | 156M | |
![[ ]](/icons/compressed.gif) | Planet of the Apes (USA).zip | 2019-05-30 04:20 | 322M | |
![[ ]](/icons/compressed.gif) | PlayStation Demo Disc - Shock Your System! (USA) (SCUS-94482).zip | 2019-05-30 04:20 | 283M | |
![[ ]](/icons/compressed.gif) | PlayStation Demo Disc - Shock Your System! (USA) (SCUS-94496).zip | 2019-05-30 04:20 | 379M | |
![[ ]](/icons/compressed.gif) | PlayStation Demo Disc Version 1.3 (USA).zip | 2019-05-30 04:20 | 400M | |
![[ ]](/icons/compressed.gif) | PlayStation Demo Disc Version 1.5 (USA).zip | 2019-05-30 04:20 | 243M | |
![[ ]](/icons/compressed.gif) | PlayStation Developer's Demo Disc (USA).zip | 2019-05-30 04:20 | 310M | |
![[ ]](/icons/compressed.gif) | PlayStation Kiosk Demo Disc Version 1.16 (USA).zip | 2019-05-30 04:21 | 228M | |
![[ ]](/icons/compressed.gif) | PlayStation Picks (USA) (SCUS-94952).zip | 2019-05-30 04:21 | 459M | |
![[ ]](/icons/compressed.gif) | PlayStation Picks (USA) (SCUS-94960).zip | 2019-05-30 04:21 | 383M | |
![[ ]](/icons/compressed.gif) | PlayStation Underground 3.1 (USA) (Disc 1).zip | 2019-05-30 04:21 | 428M | |
![[ ]](/icons/compressed.gif) | PlayStation Underground 3.1 (USA) (Disc 2).zip | 2019-05-30 04:21 | 481M | |
![[ ]](/icons/compressed.gif) | PlayStation Underground 3.2 (USA) (Disc 1).zip | 2019-05-30 04:21 | 435M | |
![[ ]](/icons/compressed.gif) | PlayStation Underground 3.2 (USA) (Disc 2).zip | 2019-05-30 04:21 | 284M | |
![[ ]](/icons/compressed.gif) | PlayStation Underground 3.3 (USA) (Disc 1).zip | 2019-05-30 04:21 | 522M | |
![[ ]](/icons/compressed.gif) | PlayStation Underground 3.3 (USA) (Disc 2).zip | 2019-05-30 04:21 | 331M | |
![[ ]](/icons/compressed.gif) | PlayStation Underground 3.4 (USA) (Disc 1).zip | 2019-05-30 04:21 | 488M | |
![[ ]](/icons/compressed.gif) | PlayStation Underground 3.4 (USA) (Disc 2).zip | 2019-05-30 04:21 | 446M | |
![[ ]](/icons/compressed.gif) | PlayStation Underground 4.1 (USA) (Disc 1).zip | 2019-05-30 04:21 | 588M | |
![[ ]](/icons/compressed.gif) | PlayStation Underground 4.1 (USA) (Disc 2).zip | 2019-05-30 04:21 | 480M | |
![[ ]](/icons/compressed.gif) | PlayStation Underground 4.2 (USA) (Disc 1).zip | 2019-05-30 04:21 | 544M | |
![[ ]](/icons/compressed.gif) | PlayStation Underground 4.2 (USA) (Disc 2).zip | 2019-05-30 04:21 | 325M | |
![[ ]](/icons/compressed.gif) | PlayStation Underground 4.3 (USA) (Disc 1).zip | 2019-05-30 04:21 | 372M | |
![[ ]](/icons/compressed.gif) | PlayStation Underground 4.3 (USA) (Disc 2).zip | 2019-05-30 04:21 | 494M | |
![[ ]](/icons/compressed.gif) | PlayStation Underground 4.4 (USA) (Disc 1).zip | 2019-05-30 04:21 | 447M | |
![[ ]](/icons/compressed.gif) | PlayStation Underground Jampack (USA).zip | 2019-05-30 04:21 | 446M | |
![[ ]](/icons/compressed.gif) | PlayStation Underground Jampack - Fall 2001 (USA).zip | 2019-05-30 04:21 | 363M | |
![[ ]](/icons/compressed.gif) | PlayStation Underground Jampack - Summer '99 (USA).zip | 2019-05-30 04:21 | 413M | |
![[ ]](/icons/compressed.gif) | PlayStation Underground Jampack - Summer 2K (USA).zip | 2019-05-30 04:21 | 393M | |
![[ ]](/icons/compressed.gif) | PlayStation Underground Jampack - Winter '98 (USA).zip | 2019-05-30 04:21 | 483M | |
![[ ]](/icons/compressed.gif) | PlayStation Underground Jampack - Winter '99 (USA).zip | 2019-05-30 04:21 | 505M | |
![[ ]](/icons/compressed.gif) | PlayStation Underground Jampack - Winter 2000 (USA).zip | 2019-05-30 04:21 | 371M | |
![[ ]](/icons/compressed.gif) | PlayStation Underground Number 1 (USA) (Disc 1).zip | 2019-05-30 04:21 | 568M | |
![[ ]](/icons/compressed.gif) | PlayStation Underground Number 1 (USA) (Disc 2).zip | 2019-05-30 04:21 | 538M | |
![[ ]](/icons/compressed.gif) | PlayStation Underground Number 2 (USA) (Disc 1).zip | 2019-05-30 04:21 | 492M | |
![[ ]](/icons/compressed.gif) | PlayStation Underground Number 2 (USA) (Disc 2).zip | 2019-05-30 04:21 | 216M | |
![[ ]](/icons/compressed.gif) | PlayStation Underground Number 3 (USA) (Disc 1).zip | 2019-05-30 04:21 | 533M | |
![[ ]](/icons/compressed.gif) | PlayStation Underground Number 3 (USA) (Disc 2).zip | 2019-05-30 04:21 | 515M | |
![[ ]](/icons/compressed.gif) | PlayStation Underground Number 4 (USA) (Disc 1).zip | 2019-05-30 04:21 | 453M | |
![[ ]](/icons/compressed.gif) | PlayStation Underground Number 4 (USA) (Disc 2).zip | 2019-05-30 04:21 | 355M | |
![[ ]](/icons/compressed.gif) | PlayStation Underground Volume 2.3 (USA) (Disc 1).zip | 2019-05-30 04:21 | 571M | |
![[ ]](/icons/compressed.gif) | PlayStation Underground Volume 2.3 (USA) (Disc 2).zip | 2019-05-30 04:21 | 420M | |
![[ ]](/icons/compressed.gif) | PlayStation Underground Volume 2 Issue 1 (USA) (Disc 1).zip | 2019-05-30 04:21 | 530M | |
![[ ]](/icons/compressed.gif) | PlayStation Underground Volume 2 Issue 1 (USA) (Disc 2).zip | 2019-05-30 04:21 | 306M | |
![[ ]](/icons/compressed.gif) | PlayStation Underground Volume 2 Issue 2 (USA) (Disc 1).zip | 2019-05-30 04:21 | 398M | |
![[ ]](/icons/compressed.gif) | PlayStation Underground Volume 2 Issue 2 (USA) (Disc 2).zip | 2019-05-30 04:21 | 428M | |
![[ ]](/icons/compressed.gif) | PlayStation Underground Volume 2 Issue 4 (USA) (Disc 1).zip | 2019-05-30 04:21 | 519M | |
![[ ]](/icons/compressed.gif) | PlayStation Underground Volume 2 Issue 4 (USA) (Disc 2).zip | 2019-05-30 04:21 | 368M | |
![[ ]](/icons/compressed.gif) | Play with the Teletubbies (USA).zip | 2019-05-30 04:20 | 509M | |
![[ ]](/icons/compressed.gif) | Pocket Fighter (USA).zip | 2019-05-30 04:21 | 153M | |
![[ ]](/icons/compressed.gif) | Point Blank (USA).zip | 2019-05-30 04:21 | 160M | |
![[ ]](/icons/compressed.gif) | Point Blank 2 (USA).zip | 2019-05-30 04:21 | 217M | |
![[ ]](/icons/compressed.gif) | Point Blank 3 (USA).zip | 2019-05-30 04:21 | 76M | |
![[ ]](/icons/compressed.gif) | Polaris SnoCross (USA).zip | 2019-05-30 04:21 | 142M | |
![[ ]](/icons/compressed.gif) | Pong - The Next Level (USA).zip | 2019-05-30 04:21 | 281M | |
![[ ]](/icons/compressed.gif) | Pool Hustler (USA).zip | 2019-05-30 04:21 | 270M | |
![[ ]](/icons/compressed.gif) | Populous - The Beginning (USA).zip | 2019-05-30 04:21 | 263M | |
![[ ]](/icons/compressed.gif) | Porsche Challenge (USA) (En,Fr,Es).zip | 2019-05-30 04:21 | 318M | |
![[ ]](/icons/compressed.gif) | Power Move Pro Wrestling (USA).zip | 2019-05-30 04:21 | 176M | |
![[ ]](/icons/compressed.gif) | Power Play - Sports Trivia (USA).zip | 2019-05-30 04:21 | 8.8M | |
![[ ]](/icons/compressed.gif) | Power Serve 3D Tennis (USA).zip | 2019-05-30 04:21 | 247M | |
![[ ]](/icons/compressed.gif) | Power Shovel (USA).zip | 2019-05-30 04:21 | 192M | |
![[ ]](/icons/compressed.gif) | Power Spike - Pro Beach Volleyball (USA).zip | 2019-05-30 04:21 | 198M | |
![[ ]](/icons/compressed.gif) | Powerpuff Girls, The - Chemical X-Traction (USA) (En,Es).zip | 2019-05-30 04:21 | 331M | |
![[ ]](/icons/compressed.gif) | Powerslave (USA).zip | 2019-05-30 04:21 | 175M | |
![[ ]](/icons/compressed.gif) | Poy Poy (USA).zip | 2019-05-30 04:21 | 159M | |
![[ ]](/icons/compressed.gif) | Primal Rage (USA).zip | 2019-05-30 04:21 | 319M | |
![[ ]](/icons/compressed.gif) | Pro-Pinball (USA).zip | 2019-05-30 04:22 | 324M | |
![[ ]](/icons/compressed.gif) | Pro 18 - World Tour Golf (USA).zip | 2019-05-30 04:21 | 205M | |
![[ ]](/icons/compressed.gif) | Pro Pinball - Big Race USA (USA).zip | 2019-05-30 04:21 | 340M | |
![[ ]](/icons/compressed.gif) | Pro Pinball - Fantastic Journey (USA).zip | 2019-05-30 04:22 | 276M | |
![[ ]](/icons/compressed.gif) | Pro Pinball - Timeshock! (USA).zip | 2019-05-30 04:22 | 405M | |
![[ ]](/icons/compressed.gif) | Professional Underground League of Pain (USA).zip | 2019-05-30 04:22 | 179M | |
![[ ]](/icons/compressed.gif) | Project - Horned Owl (USA).zip | 2019-05-30 04:22 | 209M | |
![[ ]](/icons/compressed.gif) | Project Overkill (USA).zip | 2019-05-30 04:22 | 430M | |
![[ ]](/icons/compressed.gif) | Psybadek (USA).zip | 2019-05-30 04:22 | 582M | |
![[ ]](/icons/compressed.gif) | Psychic Detective (USA) (Disc 1).zip | 2019-05-30 04:22 | 644M | |
![[ ]](/icons/compressed.gif) | Psychic Detective (USA) (Disc 2).zip | 2019-05-30 04:22 | 472M | |
![[ ]](/icons/compressed.gif) | Psychic Detective (USA) (Disc 3).zip | 2019-05-30 04:22 | 590M | |
![[ ]](/icons/compressed.gif) | Psychic Force (USA).zip | 2019-05-30 04:22 | 350M | |
![[ ]](/icons/compressed.gif) | Punky Skunk (USA).zip | 2019-05-30 04:22 | 506M | |
![[ ]](/icons/compressed.gif) | Putter Golf (USA).zip | 2019-05-30 04:22 | 97M | |
![[ ]](/icons/compressed.gif) | Puzzle Star Sweep (USA).zip | 2019-05-30 04:22 | 78M | |
![[ ]](/icons/compressed.gif) | Puzznic (USA).zip | 2019-05-30 04:22 | 114M | |
![[ ]](/icons/compressed.gif) | Q-bert (USA).zip | 2019-05-30 04:22 | 131M | |
![[ ]](/icons/compressed.gif) | Qix Neo (USA).zip | 2019-05-30 04:22 | 26M | |
![[ ]](/icons/compressed.gif) | Quaddle Family Mysteries, The 1 - The Case of the Scarce Scarab - Lobby - Kitchen (USA).zip | 2019-05-30 04:22 | 394M | |
![[ ]](/icons/compressed.gif) | Quaddle Family Mysteries, The 2 - The Case of the Scarce Scarab - Garden (USA).zip | 2019-05-30 04:22 | 506M | |
![[ ]](/icons/compressed.gif) | Quaddle Family Mysteries, The 3 - The Case of the Scarce Scarab - Parlor - Family Room (USA).zip | 2019-05-30 04:22 | 450M | |
![[ ]](/icons/compressed.gif) | Quake II (USA).zip | 2019-05-30 04:22 | 212M | |
![[ ]](/icons/compressed.gif) | R-Type Delta (USA).zip | 2019-05-30 04:22 | 222M | |
![[ ]](/icons/compressed.gif) | R-Types (USA).zip | 2019-05-30 04:22 | 255M | |
![[ ]](/icons/compressed.gif) | R4 - Ridge Racer Type 4 (USA).zip | 2019-05-30 04:22 | 363M | |
![[ ]](/icons/compressed.gif) | RC Helicopter (USA).zip | 2019-05-30 04:22 | 16M | |
![[ ]](/icons/compressed.gif) | RC Revenge (USA).zip | 2019-05-30 04:22 | 311M | |
![[ ]](/icons/compressed.gif) | RC Stunt Copter (USA).zip | 2019-05-30 04:22 | 257M | |
![[ ]](/icons/compressed.gif) | RC de Go! (USA).zip | 2019-05-30 04:22 | 146M | |
![[ ]](/icons/compressed.gif) | RPG Maker (USA).zip | 2019-05-30 04:22 | 47M | |
![[ ]](/icons/compressed.gif) | Racing (USA) (En,Fr,Es).zip | 2019-05-30 04:22 | 61M | |
![[ ]](/icons/compressed.gif) | Rage Racer (USA).zip | 2019-05-30 04:22 | 647M | |
![[ ]](/icons/compressed.gif) | Rageball (USA).zip | 2019-05-30 04:22 | 57M | |
![[ ]](/icons/compressed.gif) | Raiden Project, The (USA).zip | 2019-05-30 04:22 | 22M | |
![[ ]](/icons/compressed.gif) | Railroad Tycoon II (USA).zip | 2019-05-30 04:22 | 310M | |
![[ ]](/icons/compressed.gif) | Rally Cross (USA).zip | 2019-05-30 04:22 | 456M | |
![[ ]](/icons/compressed.gif) | Rally Cross 2 (USA).zip | 2019-05-30 04:22 | 498M | |
![[ ]](/icons/compressed.gif) | Rampage - Through Time (USA).zip | 2019-05-30 04:22 | 275M | |
![[ ]](/icons/compressed.gif) | Rampage - World Tour (USA).zip | 2019-05-30 04:22 | 177M | |
![[ ]](/icons/compressed.gif) | Rampage 2 - Universal Tour (USA).zip | 2019-05-30 04:22 | 245M | |
![[ ]](/icons/compressed.gif) | Rascal (USA) (Demo).zip | 2019-05-30 04:22 | 18M | |
![[ ]](/icons/compressed.gif) | Rascal (USA).zip | 2019-05-30 04:22 | 240M | |
![[ ]](/icons/compressed.gif) | Rascal Racers (USA).zip | 2019-05-30 04:22 | 39M | |
![[ ]](/icons/compressed.gif) | Rat Attack! (USA).zip | 2019-05-30 04:22 | 308M | |
![[ ]](/icons/compressed.gif) | RayCrisis - Series Termination (USA).zip | 2019-05-30 04:22 | 276M | |
![[ ]](/icons/compressed.gif) | RayStorm (USA).zip | 2019-05-30 04:22 | 382M | |
![[ ]](/icons/compressed.gif) | Ray Tracers (USA).zip | 2019-05-30 04:22 | 318M | |
![[ ]](/icons/compressed.gif) | Rayman (USA) (Playable Game Preview).zip | 2019-05-30 04:22 | 213M | |
![[ ]](/icons/compressed.gif) | Rayman (USA).zip | 2019-05-30 04:22 | 481M | |
![[ ]](/icons/compressed.gif) | Rayman 2 - The Great Escape (USA) (En,Fr,Es).zip | 2019-05-30 04:22 | 467M | |
![[ ]](/icons/compressed.gif) | Rayman Brain Games (USA).zip | 2019-05-30 04:22 | 257M | |
![[ ]](/icons/compressed.gif) | Rayman Rush (USA).zip | 2019-05-30 04:22 | 320M | |
![[ ]](/icons/compressed.gif) | Razor Freestyle Scooter (USA).zip | 2019-05-30 04:23 | 449M | |
![[ ]](/icons/compressed.gif) | Razor Racing (USA).zip | 2019-05-30 04:23 | 97M | |
![[ ]](/icons/compressed.gif) | Re-Loaded - The Hardcore Sequel (USA).zip | 2019-05-30 04:23 | 594M | |
![[ ]](/icons/compressed.gif) | Re-Volt (USA).zip | 2019-05-30 04:23 | 500M | |
![[ ]](/icons/compressed.gif) | ReBoot (USA).zip | 2019-05-30 04:23 | 481M | |
![[ ]](/icons/compressed.gif) | Ready 2 Rumble Boxing (USA).zip | 2019-05-30 04:23 | 124M | |
![[ ]](/icons/compressed.gif) | Ready 2 Rumble Boxing - Round 2 (USA).zip | 2019-05-30 04:23 | 228M | |
![[ ]](/icons/compressed.gif) | Red Asphalt (USA).zip | 2019-05-30 04:23 | 547M | |
![[ ]](/icons/compressed.gif) | Reel Fishing (USA).zip | 2019-05-30 04:23 | 137M | |
![[ ]](/icons/compressed.gif) | Reel Fishing II (USA).zip | 2019-05-30 04:23 | 237M | |
![[ ]](/icons/compressed.gif) | Renegade Racers (USA).zip | 2019-05-30 04:23 | 369M | |
![[ ]](/icons/compressed.gif) | Rescue Copter (USA).zip | 2019-05-30 04:23 | 212M | |
![[ ]](/icons/compressed.gif) | Rescue Heroes - Molten Menace (USA).zip | 2019-05-30 04:23 | 254M | |
![[ ]](/icons/compressed.gif) | Resident Evil (USA).zip | 2019-05-30 04:23 | 348M | |
![[ ]](/icons/compressed.gif) | Resident Evil - Director's Cut (USA).zip | 2019-05-30 04:23 | 364M | |
![[ ]](/icons/compressed.gif) | Resident Evil - Director's Cut - Dual Shock Ver. (USA).zip | 2019-05-30 04:23 | 339M | |
![[ ]](/icons/compressed.gif) | Resident Evil - Survivor (USA).zip | 2019-05-30 04:23 | 180M | |
![[ ]](/icons/compressed.gif) | Resident Evil 2 (USA) (Demo).zip | 2019-05-30 04:23 | 56M | |
![[ ]](/icons/compressed.gif) | Resident Evil 2 (USA) (Disc 1).zip | 2019-05-30 04:23 | 408M | |
![[ ]](/icons/compressed.gif) | Resident Evil 2 (USA) (Disc 2).zip | 2019-05-30 04:23 | 413M | |
![[ ]](/icons/compressed.gif) | Resident Evil 2 - Dual Shock Ver. (USA) (Disc 1) (Leon).zip | 2019-05-30 04:23 | 427M | |
![[ ]](/icons/compressed.gif) | Resident Evil 2 - Dual Shock Ver. (USA) (Disc 2) (Claire).zip | 2019-05-30 04:23 | 429M | |
![[ ]](/icons/compressed.gif) | Resident Evil 3 - Nemesis (USA) (Demo).zip | 2019-05-30 04:23 | 115M | |
![[ ]](/icons/compressed.gif) | Resident Evil 3 - Nemesis (USA).zip | 2019-05-30 04:23 | 421M | |
![[ ]](/icons/compressed.gif) | Return Fire (USA).zip | 2019-05-30 04:23 | 342M | |
![[ ]](/icons/compressed.gif) | Revolution X - Music Is the Weapon (USA).zip | 2019-05-30 04:23 | 598M | |
![[ ]](/icons/compressed.gif) | Rhapsody - A Musical Adventure (USA).zip | 2019-05-30 04:23 | 239M | |
![[ ]](/icons/compressed.gif) | Ridge Racer (USA).zip | 2019-05-30 04:23 | 387M | |
![[ ]](/icons/compressed.gif) | Ridge Racer Bonus Turbo Mode Disc (USA).zip | 2019-05-30 04:23 | 390M | |
![[ ]](/icons/compressed.gif) | Ridge Racer Revolution (USA).zip | 2019-05-30 04:23 | 664M | |
![[ ]](/icons/compressed.gif) | Rise 2 - Resurrection (USA) (En,Fr,De,Es,It).zip | 2019-05-30 04:23 | 512M | |
![[ ]](/icons/compressed.gif) | Rising Zan - The Samurai Gunman (USA).zip | 2019-05-30 04:23 | 523M | |
![[ ]](/icons/compressed.gif) | Risk - The Game of Global Domination (USA).zip | 2019-05-30 04:23 | 229M | |
![[ ]](/icons/compressed.gif) | Rival Schools - United by Fate (USA) (Disc 1) (Arcade Disc).zip | 2019-05-30 04:24 | 393M | |
![[ ]](/icons/compressed.gif) | Rival Schools - United by Fate (USA) (Disc 2) (Evolution Disc).zip | 2019-05-30 04:23 | 220M | |
![[ ]](/icons/compressed.gif) | Riven - The Sequel to Myst (USA) (Disc 1).zip | 2019-05-30 04:23 | 408M | |
![[ ]](/icons/compressed.gif) | Riven - The Sequel to Myst (USA) (Disc 2).zip | 2019-05-30 04:23 | 462M | |
![[ ]](/icons/compressed.gif) | Riven - The Sequel to Myst (USA) (Disc 3).zip | 2019-05-30 04:24 | 383M | |
![[ ]](/icons/compressed.gif) | Riven - The Sequel to Myst (USA) (Disc 4).zip | 2019-05-30 04:24 | 429M | |
![[ ]](/icons/compressed.gif) | Riven - The Sequel to Myst (USA) (Disc 5).zip | 2019-05-30 04:24 | 578M | |
![[ ]](/icons/compressed.gif) | Road & Track Presents - The Need for Speed (USA).zip | 2019-05-30 04:24 | 431M | |
![[ ]](/icons/compressed.gif) | Road Rash (USA).zip | 2019-05-30 04:24 | 508M | |
![[ ]](/icons/compressed.gif) | Road Rash - Jailbreak (USA).zip | 2019-05-30 04:24 | 386M | |
![[ ]](/icons/compressed.gif) | Road Rash 3D (USA).zip | 2019-05-30 04:24 | 436M | |
![[ ]](/icons/compressed.gif) | Road Writer (USA).zip | 2019-05-30 04:24 | 291M | |
![[ ]](/icons/compressed.gif) | Roadsters (USA).zip | 2019-05-30 04:24 | 297M | |
![[ ]](/icons/compressed.gif) | Robo Pit (USA).zip | 2019-05-30 04:24 | 316M | |
![[ ]](/icons/compressed.gif) | Robo Pit 2 (USA).zip | 2019-05-30 04:24 | 72M | |
![[ ]](/icons/compressed.gif) | Robotron X (USA).zip | 2019-05-30 04:24 | 621M | |
![[ ]](/icons/compressed.gif) | Rock 'Em Sock 'Em Robots Arena (USA).zip | 2019-05-30 04:24 | 346M | |
![[ ]](/icons/compressed.gif) | Rogue Trip - Vacation 2012 (USA).zip | 2019-05-30 04:24 | 613M | |
![[ ]](/icons/compressed.gif) | Roll Away (USA).zip | 2019-05-30 04:24 | 135M | |
![[ ]](/icons/compressed.gif) | Rollcage (USA) (Demo).zip | 2019-05-30 04:24 | 35M | |
![[ ]](/icons/compressed.gif) | Rollcage (USA).zip | 2019-05-30 04:24 | 584M | |
![[ ]](/icons/compressed.gif) | Rollcage Stage II (USA).zip | 2019-05-30 04:24 | 511M | |
![[ ]](/icons/compressed.gif) | Romance of the Three Kingdoms IV - Wall of Fire (USA).zip | 2019-05-30 04:24 | 558M | |
![[ ]](/icons/compressed.gif) | Romance of the Three Kingdoms VI - Awakening of the Dragon (USA).zip | 2019-05-30 04:24 | 134M | |
![[ ]](/icons/compressed.gif) | Rosco McQueen Firefighter Extreme (USA).zip | 2019-05-30 04:24 | 57M | |
![[ ]](/icons/compressed.gif) | Roswell Conspiracies - Aliens, Myths & Legends (USA).zip | 2019-05-30 04:24 | 437M | |
![[ ]](/icons/compressed.gif) | Runabout 2 (USA).zip | 2019-05-30 04:24 | 155M | |
![[ ]](/icons/compressed.gif) | Running Wild (USA).zip | 2019-05-30 04:24 | 449M | |
![[ ]](/icons/compressed.gif) | Rush Hour (USA).zip | 2019-05-30 04:24 | 509M | |
![[ ]](/icons/compressed.gif) | Rushdown (USA).zip | 2019-05-30 04:24 | 421M | |
![[ ]](/icons/compressed.gif) | S.C.A.R.S. (USA).zip | 2019-05-30 04:24 | 394M | |
![[ ]](/icons/compressed.gif) | SaGa Frontier (USA).zip | 2019-05-30 04:24 | 235M | |
![[ ]](/icons/compressed.gif) | SaGa Frontier 2 (USA).zip | 2019-05-30 04:24 | 347M | |
![[ ]](/icons/compressed.gif) | Saban's Power Rangers - Lightspeed Rescue (USA).zip | 2019-05-30 04:24 | 92M | |
![[ ]](/icons/compressed.gif) | Saban's Power Rangers - Time Force (USA).zip | 2019-05-30 04:24 | 105M | |
![[ ]](/icons/compressed.gif) | Saban's Power Rangers Zeo - Full Tilt Battle Pinball (USA).zip | 2019-05-30 04:24 | 196M | |
![[ ]](/icons/compressed.gif) | Sabrina the Teenage Witch - A Twitch in Time! (USA).zip | 2019-05-30 04:24 | 548M | |
![[ ]](/icons/compressed.gif) | Saiyuki - Journey West (USA).zip | 2019-05-30 04:24 | 356M | |
![[ ]](/icons/compressed.gif) | Saltwater Sportfishing (USA).zip | 2019-05-30 04:24 | 176M | |
![[ ]](/icons/compressed.gif) | Sammy Sosa High Heat Baseball 2001 (USA).zip | 2019-05-30 04:24 | 135M | |
![[ ]](/icons/compressed.gif) | Sammy Sosa Softball Slam (USA).zip | 2019-05-30 04:24 | 89M | |
![[ ]](/icons/compressed.gif) | Samurai Shodown - Warriors Rage (USA).zip | 2019-05-30 04:24 | 466M | |
![[ ]](/icons/compressed.gif) | Samurai Shodown III - Blades of Blood (USA).zip | 2019-05-30 04:24 | 206M | |
![[ ]](/icons/compressed.gif) | San Francisco Rush - Extreme Racing (USA).zip | 2019-05-30 04:24 | 181M | |
![[ ]](/icons/compressed.gif) | Scooby-Doo and the Cyber Chase (USA).zip | 2019-05-30 04:24 | 98M | |
![[ ]](/icons/compressed.gif) | Scrabble (USA).zip | 2019-05-30 04:24 | 7.9M | |
![[ ]](/icons/compressed.gif) | Sea-Doo Hydro Cross (USA).zip | 2019-05-30 04:24 | 289M | |
![[ ]](/icons/compressed.gif) | Secret of Googol 1a, The - Reshaping Googol - The Submarine (USA).zip | 2019-05-30 04:24 | 367M | |
![[ ]](/icons/compressed.gif) | Secret of Googol 1b, The - Reshaping Googol - The Tower (USA).zip | 2019-05-30 04:24 | 522M | |
![[ ]](/icons/compressed.gif) | Secret of Googol 2a, The - Reshaping Googol - The Castle (USA).zip | 2019-05-30 04:24 | 456M | |
![[ ]](/icons/compressed.gif) | Secret of Googol 2b, The - Reshaping Googol - Under the Ocean (USA).zip | 2019-05-30 04:24 | 568M | |
![[ ]](/icons/compressed.gif) | Secret of Googol 3, The - The Googol Counting Fair - Midways (USA).zip | 2019-05-30 04:24 | 520M | |
![[ ]](/icons/compressed.gif) | Secret of Googol 4, The - The Googol Counting Fair - Corral - Fun House (USA).zip | 2019-05-30 04:24 | 319M | |
![[ ]](/icons/compressed.gif) | Secret of Googol 5, The - Googolfest - Party Isle - Toy Isle (USA).zip | 2019-05-30 04:24 | 385M | |
![[ ]](/icons/compressed.gif) | Secret of Googol 6, The - Googolfest - Arcade Isle - Moon Feast Isle (USA).zip | 2019-05-30 04:24 | 314M | |
![[ ]](/icons/compressed.gif) | Secret of Googol 7, The - Eggs All Around - Egg Trek - Balloon Picnic (USA).zip | 2019-05-30 04:24 | 325M | |
![[ ]](/icons/compressed.gif) | Secret of Googol 8, The - Googol Gulch - General Store - Math Arcade (USA).zip | 2019-05-30 04:24 | 208M | |
![[ ]](/icons/compressed.gif) | Sentient (USA).zip | 2019-05-30 04:24 | 346M | |
![[ ]](/icons/compressed.gif) | Sentinel Returns (USA).zip | 2019-05-30 04:24 | 304M | |
![[ ]](/icons/compressed.gif) | Sesame Street - Elmo's Letter Adventure (USA).zip | 2019-05-30 04:25 | 198M | |
![[ ]](/icons/compressed.gif) | Sesame Street - Elmo's Number Journey (USA).zip | 2019-05-30 04:24 | 197M | |
![[ ]](/icons/compressed.gif) | Sesame Street Sports (USA).zip | 2019-05-30 04:24 | 115M | |
![[ ]](/icons/compressed.gif) | Shadow Madness (USA) (Disc 1).zip | 2019-05-30 04:24 | 461M | |
![[ ]](/icons/compressed.gif) | Shadow Madness (USA) (Disc 2).zip | 2019-05-30 04:25 | 464M | |
![[ ]](/icons/compressed.gif) | Shadow Man (USA).zip | 2019-05-30 04:25 | 438M | |
![[ ]](/icons/compressed.gif) | Shadow Master (USA).zip | 2019-05-30 04:24 | 342M | |
![[ ]](/icons/compressed.gif) | Shadow Tower (USA).zip | 2019-05-30 04:25 | 171M | |
![[ ]](/icons/compressed.gif) | Shanghai - True Valor (USA).zip | 2019-05-30 04:25 | 208M | |
![[ ]](/icons/compressed.gif) | Sheep (USA).zip | 2019-05-30 04:25 | 579M | |
![[ ]](/icons/compressed.gif) | Shellshock (USA).zip | 2019-05-30 04:25 | 444M | |
![[ ]](/icons/compressed.gif) | Shipwreckers! (USA).zip | 2019-05-30 04:25 | 536M | |
![[ ]](/icons/compressed.gif) | Shockwave Assault (USA) (Disc 1) (Shockwave - Invasion Earth).zip | 2019-05-30 04:25 | 529M | |
![[ ]](/icons/compressed.gif) | Shockwave Assault (USA) (Disc 2) (Shockwave - Operation Jumpgate).zip | 2019-05-30 04:25 | 238M | |
![[ ]](/icons/compressed.gif) | Shrek Treasure Hunt (USA).zip | 2019-05-30 04:25 | 115M | |
![[ ]](/icons/compressed.gif) | Silent Bomber (USA).zip | 2019-05-30 04:25 | 189M | |
![[ ]](/icons/compressed.gif) | Silent Hill (USA).zip | 2019-05-30 04:25 | 316M | |
![[ ]](/icons/compressed.gif) | Silhouette Mirage (USA).zip | 2019-05-30 04:25 | 576M | |
![[ ]](/icons/compressed.gif) | Silverload (USA).zip | 2019-05-30 04:25 | 439M | |
![[ ]](/icons/compressed.gif) | SimCity 2000 (USA).zip | 2019-05-30 04:25 | 39M | |
![[ ]](/icons/compressed.gif) | Sim Theme Park (USA).zip | 2019-05-30 04:25 | 277M | |
![[ ]](/icons/compressed.gif) | Simpsons Wrestling, The (USA).zip | 2019-05-30 04:25 | 136M | |
![[ ]](/icons/compressed.gif) | Skeleton Warriors (USA).zip | 2019-05-30 04:25 | 427M | |
![[ ]](/icons/compressed.gif) | Skullmonkeys (USA).zip | 2019-05-30 04:25 | 444M | |
![[ ]](/icons/compressed.gif) | Skydiving Extreme (USA).zip | 2019-05-30 04:25 | 300M | |
![[ ]](/icons/compressed.gif) | Slam 'n Jam '96 featuring Magic & Kareem (USA).zip | 2019-05-30 04:25 | 145M | |
![[ ]](/icons/compressed.gif) | Slamscape (USA).zip | 2019-05-30 04:25 | 377M | |
![[ ]](/icons/compressed.gif) | Sled Storm & Medal of Honor Demo CD (USA).zip | 2019-05-30 04:25 | 103M | |
![[ ]](/icons/compressed.gif) | Sled Storm (USA).zip | 2019-05-30 04:25 | 597M | |
![[ ]](/icons/compressed.gif) | Slots (USA).zip | 2019-05-30 04:25 | 61M | |
![[ ]](/icons/compressed.gif) | Small Soldiers (USA).zip | 2019-05-30 04:25 | 563M | |
![[ ]](/icons/compressed.gif) | Smurf Racer! (USA) (En,Fr,Es).zip | 2019-05-30 04:25 | 133M | |
![[ ]](/icons/compressed.gif) | Smurfs, The (USA) (En,Fr,Es).zip | 2019-05-30 04:25 | 373M | |
![[ ]](/icons/compressed.gif) | SnoCross Championship Racing (USA).zip | 2019-05-30 04:25 | 175M | |
![[ ]](/icons/compressed.gif) | Snowboarding (USA).zip | 2019-05-30 04:25 | 391M | |
![[ ]](/icons/compressed.gif) | Sol Divide (USA).zip | 2019-05-30 04:25 | 111M | |
![[ ]](/icons/compressed.gif) | Sorcerer's Maze (USA).zip | 2019-05-30 04:25 | 26M | |
![[ ]](/icons/compressed.gif) | Soul Blade (USA) (v1.0).zip | 2019-05-30 04:25 | 343M | |
![[ ]](/icons/compressed.gif) | Soul Blade (USA) (v1.1).zip | 2019-05-30 04:25 | 344M | |
![[ ]](/icons/compressed.gif) | Soul of the Samurai (USA).zip | 2019-05-30 04:25 | 326M | |
![[ ]](/icons/compressed.gif) | South Park (USA).zip | 2019-05-30 04:25 | 215M | |
![[ ]](/icons/compressed.gif) | South Park - Chef's Luv Shack (USA).zip | 2019-05-30 04:25 | 329M | |
![[ ]](/icons/compressed.gif) | South Park Rally (USA).zip | 2019-05-30 04:25 | 385M | |
![[ ]](/icons/compressed.gif) | Soviet Strike (USA).zip | 2019-05-30 04:25 | 568M | |
![[ ]](/icons/compressed.gif) | Space Griffon VF-9 (USA).zip | 2019-05-30 04:25 | 343M | |
![[ ]](/icons/compressed.gif) | Space Hulk - Vengeance of the Blood Angels (USA).zip | 2019-05-30 04:25 | 226M | |
![[ ]](/icons/compressed.gif) | Space Invaders (USA).zip | 2019-05-30 04:25 | 127M | |
![[ ]](/icons/compressed.gif) | Space Jam (USA).zip | 2019-05-30 04:25 | 110M | |
![[ ]](/icons/compressed.gif) | Space Shot (USA).zip | 2019-05-30 04:25 | 380M | |
![[ ]](/icons/compressed.gif) | Spawn - The Eternal (USA).zip | 2019-05-30 04:25 | 523M | |
![[ ]](/icons/compressed.gif) | Spec Ops - Airborne Commando (USA).zip | 2019-05-30 04:25 | 121M | |
![[ ]](/icons/compressed.gif) | Spec Ops - Covert Assault (USA).zip | 2019-05-30 04:25 | 60M | |
![[ ]](/icons/compressed.gif) | Spec Ops - Ranger Elite (USA).zip | 2019-05-30 04:25 | 89M | |
![[ ]](/icons/compressed.gif) | Spec Ops - Stealth Patrol (USA).zip | 2019-05-30 04:25 | 175M | |
![[ ]](/icons/compressed.gif) | Speed Punks (USA).zip | 2019-05-30 04:25 | 440M | |
![[ ]](/icons/compressed.gif) | Speed Racer (USA).zip | 2019-05-30 04:25 | 101M | |
![[ ]](/icons/compressed.gif) | Speedball 2100 (USA).zip | 2019-05-30 04:26 | 645M | |
![[ ]](/icons/compressed.gif) | Spice World (USA).zip | 2019-05-30 04:26 | 295M | |
![[ ]](/icons/compressed.gif) | Spider-Man (USA).zip | 2019-05-30 04:26 | 415M | |
![[ ]](/icons/compressed.gif) | Spider-Man 2 - Enter - Electro (USA).zip | 2019-05-30 04:26 | 349M | |
![[ ]](/icons/compressed.gif) | Spider - The Video Game (USA).zip | 2019-05-30 04:26 | 296M | |
![[ ]](/icons/compressed.gif) | Spin Jam (USA).zip | 2019-05-30 04:26 | 154M | |
![[ ]](/icons/compressed.gif) | Sports Car GT (USA).zip | 2019-05-30 04:26 | 334M | |
![[ ]](/icons/compressed.gif) | Sports Superbike 2 (USA).zip | 2019-05-30 04:26 | 133M | |
![[ ]](/icons/compressed.gif) | Spot Goes to Hollywood (USA).zip | 2019-05-30 04:26 | 567M | |
![[ ]](/icons/compressed.gif) | Spyro - Year of the Dragon (USA) (v1.0).zip | 2019-05-30 04:26 | 368M | |
![[ ]](/icons/compressed.gif) | Spyro - Year of the Dragon (USA) (v1.1).zip | 2019-05-30 04:26 | 421M | |
![[ ]](/icons/compressed.gif) | Spyro 2 - Ripto's Rage! (USA).zip | 2019-05-30 04:26 | 369M | |
![[ ]](/icons/compressed.gif) | Spyro the Dragon (USA) (Demo).zip | 2019-05-30 04:26 | 33M | |
![[ ]](/icons/compressed.gif) | Spyro the Dragon (USA).zip | 2019-05-30 04:26 | 351M | |
![[ ]](/icons/compressed.gif) | Squaresoft on PlayStation 1998 Collector's CD Vol. 1 (USA).zip | 2019-05-30 04:26 | 291M | |
![[ ]](/icons/compressed.gif) | Squaresoft on PlayStation 1998 Collector's CD Vol. 2 (USA) (Final Fantasy VIII Demo).zip | 2019-05-30 04:26 | 91M | |
![[ ]](/icons/compressed.gif) | Squaresoft on PlayStation 2000 Collector's CD Vol. 3 (USA).zip | 2019-05-30 04:26 | 327M | |
![[ ]](/icons/compressed.gif) | Squaresoft on PlayStation Collector's CD (USA).zip | 2019-05-30 04:26 | 176M | |
![[ ]](/icons/compressed.gif) | Star Fighter (USA).zip | 2019-05-30 04:26 | 215M | |
![[ ]](/icons/compressed.gif) | Star Gladiator - Episode I - Final Crusade (USA).zip | 2019-05-30 04:26 | 448M | |
![[ ]](/icons/compressed.gif) | Star Ocean - The Second Story (USA) (Disc 1).zip | 2019-05-30 04:26 | 412M | |
![[ ]](/icons/compressed.gif) | Star Ocean - The Second Story (USA) (Disc 2).zip | 2019-05-30 04:26 | 523M | |
![[ ]](/icons/compressed.gif) | Star Trek - Invasion (USA).zip | 2019-05-30 04:26 | 332M | |
![[ ]](/icons/compressed.gif) | Star Wars - Dark Forces (USA).zip | 2019-05-30 04:26 | 288M | |
![[ ]](/icons/compressed.gif) | Star Wars - Demolition (USA).zip | 2019-05-30 04:26 | 508M | |
![[ ]](/icons/compressed.gif) | Star Wars - Episode I - Jedi Power Battles (USA).zip | 2019-05-30 04:26 | 279M | |
![[ ]](/icons/compressed.gif) | Star Wars - Episode I - The Phantom Menace (USA).zip | 2019-05-30 04:26 | 503M | |
![[ ]](/icons/compressed.gif) | Star Wars - Masters of Teras Kasi (USA).zip | 2019-05-30 04:26 | 380M | |
![[ ]](/icons/compressed.gif) | Star Wars - Rebel Assault II - The Hidden Empire (USA) (Disc 1).zip | 2019-05-30 04:26 | 505M | |
![[ ]](/icons/compressed.gif) | Star Wars - Rebel Assault II - The Hidden Empire (USA) (Disc 2).zip | 2019-05-30 04:26 | 510M | |
![[ ]](/icons/compressed.gif) | Starblade Alpha (USA).zip | 2019-05-30 04:26 | 442M | |
![[ ]](/icons/compressed.gif) | Starfighter Sanvein (USA).zip | 2019-05-30 04:26 | 71M | |
![[ ]](/icons/compressed.gif) | Starwinder - The Ultimate Space Race (USA).zip | 2019-05-30 04:26 | 580M | |
![[ ]](/icons/compressed.gif) | Steel Harbinger (USA).zip | 2019-05-30 04:26 | 434M | |
![[ ]](/icons/compressed.gif) | Steel Reign (USA).zip | 2019-05-30 04:26 | 522M | |
![[ ]](/icons/compressed.gif) | Str.at.e.s. 1 - Match-A-Batch (USA).zip | 2019-05-30 04:26 | 571M | |
![[ ]](/icons/compressed.gif) | Str.at.e.s. 2 - Matchamania! (USA).zip | 2019-05-30 04:26 | 537M | |
![[ ]](/icons/compressed.gif) | Str.at.e.s. 3 - Title This! Title That! (USA).zip | 2019-05-30 04:26 | 549M | |
![[ ]](/icons/compressed.gif) | Str.at.e.s. 4 - Titlerama! (USA).zip | 2019-05-30 04:26 | 566M | |
![[ ]](/icons/compressed.gif) | Str.at.e.s. 5 - Parallel Lives! (USA).zip | 2019-05-30 04:26 | 566M | |
![[ ]](/icons/compressed.gif) | Str.at.e.s. 6 - Analogy-ology! (USA).zip | 2019-05-30 04:26 | 564M | |
![[ ]](/icons/compressed.gif) | Str.at.e.s. 7 - Riddle Roundup! (USA).zip | 2019-05-30 04:27 | 558M | |
![[ ]](/icons/compressed.gif) | Str.at.e.s. 8 - Riddle Wrangler! (USA).zip | 2019-05-30 04:27 | 515M | |
![[ ]](/icons/compressed.gif) | Streak Hoverboard Racing (USA).zip | 2019-05-30 04:27 | 357M | |
![[ ]](/icons/compressed.gif) | Street Fighter - The Movie (USA).zip | 2019-05-30 04:27 | 471M | |
![[ ]](/icons/compressed.gif) | Street Fighter Alpha - Warriors' Dreams (USA).zip | 2019-05-30 04:27 | 492M | |
![[ ]](/icons/compressed.gif) | Street Fighter Alpha 2 (USA).zip | 2019-05-30 04:27 | 352M | |
![[ ]](/icons/compressed.gif) | Street Fighter Alpha 3 (USA).zip | 2019-05-30 04:27 | 332M | |
![[ ]](/icons/compressed.gif) | Street Fighter Collection (USA) (Disc 1) (v1.0).zip | 2019-05-30 04:27 | 568M | |
![[ ]](/icons/compressed.gif) | Street Fighter Collection (USA) (Disc 1) (v1.1).zip | 2019-05-30 04:27 | 568M | |
![[ ]](/icons/compressed.gif) | Street Fighter Collection (USA) (Disc 2) (v1.0).zip | 2019-05-30 04:27 | 310M | |
![[ ]](/icons/compressed.gif) | Street Fighter Collection (USA) (Disc 2) (v1.1).zip | 2019-05-30 04:27 | 310M | |
![[ ]](/icons/compressed.gif) | Street Fighter Collection 2 (USA).zip | 2019-05-30 04:27 | 246M | |
![[ ]](/icons/compressed.gif) | Street Fighter EX2 Plus (USA).zip | 2019-05-30 04:27 | 203M | |
![[ ]](/icons/compressed.gif) | Street Fighter EX Plus Alpha (USA).zip | 2019-05-30 04:27 | 283M | |
![[ ]](/icons/compressed.gif) | Street Racer (USA).zip | 2019-05-30 04:27 | 386M | |
![[ ]](/icons/compressed.gif) | Street Racquetball (USA).zip | 2019-05-30 04:27 | 277M | |
![[ ]](/icons/compressed.gif) | Street Sk8er (USA).zip | 2019-05-30 04:27 | 596M | |
![[ ]](/icons/compressed.gif) | Street Sk8er 2 (USA).zip | 2019-05-30 04:27 | 464M | |
![[ ]](/icons/compressed.gif) | Strider (USA).zip | 2019-05-30 04:27 | 27M | |
![[ ]](/icons/compressed.gif) | Strider 2 (USA).zip | 2019-05-30 04:27 | 229M | |
![[ ]](/icons/compressed.gif) | Strike Point (USA).zip | 2019-05-30 04:27 | 219M | |
![[ ]](/icons/compressed.gif) | Striker 96 (USA).zip | 2019-05-30 04:27 | 204M | |
![[ ]](/icons/compressed.gif) | Striker Pro 2000 (USA).zip | 2019-05-30 04:27 | 167M | |
![[ ]](/icons/compressed.gif) | Strikers 1945 (USA).zip | 2019-05-30 04:27 | 83M | |
![[ ]](/icons/compressed.gif) | Stuart Little 2 (USA).zip | 2019-05-30 04:27 | 427M | |
![[ ]](/icons/compressed.gif) | Suikoden (USA) (v1.0).zip | 2019-05-30 04:27 | 381M | |
![[ ]](/icons/compressed.gif) | Suikoden (USA) (v1.1).zip | 2019-05-30 04:27 | 381M | |
![[ ]](/icons/compressed.gif) | Suikoden II (USA).zip | 2019-05-30 04:27 | 333M | |
![[ ]](/icons/compressed.gif) | Super Bubble Pop (USA).zip | 2019-05-30 04:27 | 576M | |
![[ ]](/icons/compressed.gif) | SuperCross Circuit (USA).zip | 2019-05-30 04:27 | 291M | |
![[ ]](/icons/compressed.gif) | Super Puzzle Fighter II Turbo (USA).zip | 2019-05-30 04:27 | 365M | |
![[ ]](/icons/compressed.gif) | Super Shot Soccer (USA).zip | 2019-05-30 04:27 | 278M | |
![[ ]](/icons/compressed.gif) | Superstar Dance Club - #1 Hits!!! (USA).zip | 2019-05-30 04:27 | 88M | |
![[ ]](/icons/compressed.gif) | Surf Riders (USA).zip | 2019-05-30 04:27 | 416M | |
![[ ]](/icons/compressed.gif) | Swagman (USA).zip | 2019-05-30 04:27 | 443M | |
![[ ]](/icons/compressed.gif) | Sydney 2000 (USA).zip | 2019-05-30 04:27 | 483M | |
![[ ]](/icons/compressed.gif) | Syndicate Wars (USA).zip | 2019-05-30 04:27 | 129M | |
![[ ]](/icons/compressed.gif) | Syphon Filter (USA) (v1.0).zip | 2019-05-30 04:27 | 424M | |
![[ ]](/icons/compressed.gif) | Syphon Filter (USA) (v1.1).zip | 2019-05-30 04:27 | 416M | |
![[ ]](/icons/compressed.gif) | Syphon Filter 2 (USA) (Disc 1).zip | 2019-05-30 04:27 | 462M | |
![[ ]](/icons/compressed.gif) | Syphon Filter 2 (USA) (Disc 2).zip | 2019-05-30 04:27 | 503M | |
![[ ]](/icons/compressed.gif) | Syphon Filter 3 (USA).zip | 2019-05-30 04:27 | 430M | |
![[ ]](/icons/compressed.gif) | T'ai Fu - Wrath of the Tiger (USA).zip | 2019-05-30 04:27 | 550M | |
![[ ]](/icons/compressed.gif) | T.R.A.G. - Mission of Mercy (USA).zip | 2019-05-30 04:27 | 511M | |
![[ ]](/icons/compressed.gif) | TNN Motor Sports HardCore 4X4 (USA).zip | 2019-05-30 04:27 | 330M | |
![[ ]](/icons/compressed.gif) | TNN Motorsports HardCore TR (USA).zip | 2019-05-30 04:27 | 591M | |
![[ ]](/icons/compressed.gif) | TOCA 2 Touring Car Challenge (USA) (En,Fr,Es).zip | 2019-05-30 04:27 | 273M | |
![[ ]](/icons/compressed.gif) | TOCA Championship Racing (USA) (En,Es).zip | 2019-05-30 04:27 | 401M | |
![[ ]](/icons/compressed.gif) | Tactics Ogre (USA).zip | 2019-05-30 04:27 | 48M | |
![[ ]](/icons/compressed.gif) | Tail Concerto (USA).zip | 2019-05-30 04:27 | 293M | |
![[ ]](/icons/compressed.gif) | Tail of the Sun (USA).zip | 2019-05-30 04:27 | 255M | |
![[ ]](/icons/compressed.gif) | Tales of Destiny (USA).zip | 2019-05-30 04:27 | 340M | |
![[ ]](/icons/compressed.gif) | Tales of Destiny II (USA) (Disc 1).zip | 2019-05-30 04:28 | 366M | |
![[ ]](/icons/compressed.gif) | Tales of Destiny II (USA) (Disc 2).zip | 2019-05-30 04:28 | 394M | |
![[ ]](/icons/compressed.gif) | Tales of Destiny II (USA) (Disc 3).zip | 2019-05-30 04:27 | 430M | |
![[ ]](/icons/compressed.gif) | Tall - Infinity (USA).zip | 2019-05-30 04:28 | 95M | |
![[ ]](/icons/compressed.gif) | Team Buddies (USA).zip | 2019-05-30 04:28 | 264M | |
![[ ]](/icons/compressed.gif) | Team Losi RC Racer (USA).zip | 2019-05-30 04:28 | 441M | |
![[ ]](/icons/compressed.gif) | Tecmo's Deception - Invitation to Darkness (USA).zip | 2019-05-30 04:28 | 218M | |
![[ ]](/icons/compressed.gif) | Tecmo Stackers (USA).zip | 2019-05-30 04:28 | 516M | |
![[ ]](/icons/compressed.gif) | Tecmo Super Bowl (USA).zip | 2019-05-30 04:28 | 128M | |
![[ ]](/icons/compressed.gif) | Tecmo World Golf - Japan (USA).zip | 2019-05-30 04:28 | 189M | |
![[ ]](/icons/compressed.gif) | Tekken (USA).zip | 2019-05-30 04:28 | 608M | |
![[ ]](/icons/compressed.gif) | Tekken 2 (USA) (v1.0).zip | 2019-05-30 04:28 | 516M | |
![[ ]](/icons/compressed.gif) | Tekken 2 (USA) (v1.1).zip | 2019-05-30 04:28 | 517M | |
![[ ]](/icons/compressed.gif) | Tekken 3 (USA).zip | 2019-05-30 04:28 | 472M | |
![[ ]](/icons/compressed.gif) | Tempest X3 (USA).zip | 2019-05-30 04:28 | 233M | |
![[ ]](/icons/compressed.gif) | Ten Pin Alley (USA).zip | 2019-05-30 04:28 | 499M | |
![[ ]](/icons/compressed.gif) | Tenchu - Stealth Assassins (USA) (v1.0).zip | 2019-05-30 04:28 | 384M | |
![[ ]](/icons/compressed.gif) | Tenchu - Stealth Assassins (USA) (v1.1).zip | 2019-05-30 04:28 | 380M | |
![[ ]](/icons/compressed.gif) | Tenchu 2 - Birth of the Stealth Assassins (USA).zip | 2019-05-30 04:28 | 489M | |
![[ ]](/icons/compressed.gif) | Tennis (USA).zip | 2019-05-30 04:28 | 65M | |
![[ ]](/icons/compressed.gif) | Tennis Arena (USA).zip | 2019-05-30 04:28 | 173M | |
![[ ]](/icons/compressed.gif) | Terry Pratchett's Discworld (USA).zip | 2019-05-30 04:28 | 425M | |
![[ ]](/icons/compressed.gif) | Test Drive 4 (USA).zip | 2019-05-30 04:28 | 161M | |
![[ ]](/icons/compressed.gif) | Test Drive 5 (USA).zip | 2019-05-30 04:28 | 361M | |
![[ ]](/icons/compressed.gif) | Test Drive 6 (USA).zip | 2019-05-30 04:28 | 262M | |
![[ ]](/icons/compressed.gif) | Test Drive Le Mans (USA) (En,Fr,Es).zip | 2019-05-30 04:28 | 316M | |
![[ ]](/icons/compressed.gif) | Test Drive Off-Road (USA).zip | 2019-05-30 04:28 | 546M | |
![[ ]](/icons/compressed.gif) | Test Drive Off-Road 2 (USA).zip | 2019-05-30 04:28 | 117M | |
![[ ]](/icons/compressed.gif) | Test Drive Off-Road 3 (USA).zip | 2019-05-30 04:28 | 223M | |
![[ ]](/icons/compressed.gif) | Tetris Plus (USA).zip | 2019-05-30 04:28 | 505M | |
![[ ]](/icons/compressed.gif) | Theme Hospital (USA).zip | 2019-05-30 04:28 | 124M | |
![[ ]](/icons/compressed.gif) | Theme Park (USA).zip | 2019-05-30 04:28 | 178M | |
![[ ]](/icons/compressed.gif) | Thousand Arms (USA) (Disc 1).zip | 2019-05-30 04:28 | 464M | |
![[ ]](/icons/compressed.gif) | Thousand Arms (USA) (Disc 2).zip | 2019-05-30 04:28 | 463M | |
![[ ]](/icons/compressed.gif) | Thrasher - Skate and Destroy (USA).zip | 2019-05-30 04:28 | 278M | |
![[ ]](/icons/compressed.gif) | Threads of Fate (USA).zip | 2019-05-30 04:28 | 238M | |
![[ ]](/icons/compressed.gif) | Three Decoders 1, The - Riddle of the Ring (USA).zip | 2019-05-30 04:28 | 190M | |
![[ ]](/icons/compressed.gif) | Three Decoders 2, The - Key to the Carousel (USA).zip | 2019-05-30 04:28 | 200M | |
![[ ]](/icons/compressed.gif) | Three Stooges, The (USA).zip | 2019-05-30 04:28 | 129M | |
![[ ]](/icons/compressed.gif) | Thunder Force V - Perfect System (USA).zip | 2019-05-30 04:28 | 318M | |
![[ ]](/icons/compressed.gif) | Thunder Truck Rally (USA).zip | 2019-05-30 04:28 | 162M | |
![[ ]](/icons/compressed.gif) | Thunderstrike 2 (USA).zip | 2019-05-30 04:28 | 411M | |
![[ ]](/icons/compressed.gif) | Tiger Woods 99 PGA Tour Golf (USA) (v1.0).zip | 2019-05-30 04:28 | 251M | |
![[ ]](/icons/compressed.gif) | Tiger Woods 99 PGA Tour Golf (USA) (v1.1).zip | 2019-05-30 04:28 | 200M | |
![[ ]](/icons/compressed.gif) | Tiger Woods PGA Tour 2000 (USA).zip | 2019-05-30 04:28 | 190M | |
![[ ]](/icons/compressed.gif) | Tiger Woods PGA Tour Golf (USA).zip | 2019-05-30 04:28 | 177M | |
![[ ]](/icons/compressed.gif) | Tigershark (USA).zip | 2019-05-30 04:28 | 492M | |
![[ ]](/icons/compressed.gif) | Time Commando (USA).zip | 2019-05-30 04:28 | 445M | |
![[ ]](/icons/compressed.gif) | Time Crisis (USA).zip | 2019-05-30 04:29 | 599M | |
![[ ]](/icons/compressed.gif) | Time Crisis - Project Titan (USA).zip | 2019-05-30 04:29 | 506M | |
![[ ]](/icons/compressed.gif) | Timeless Jade Trade (USA).zip | 2019-05-30 04:29 | 21M | |
![[ ]](/icons/compressed.gif) | Timeless Math 1 - Maya, Search and Rescue (USA).zip | 2019-05-30 04:29 | 355M | |
![[ ]](/icons/compressed.gif) | Timeless Math 2 - Maya, Observatory (USA).zip | 2019-05-30 04:29 | 369M | |
![[ ]](/icons/compressed.gif) | Timeless Math 3 - Maya, King Jaguar's Village (USA).zip | 2019-05-30 04:29 | 415M | |
![[ ]](/icons/compressed.gif) | Timeless Math 4 - Lunar Base (USA).zip | 2019-05-30 04:29 | 258M | |
![[ ]](/icons/compressed.gif) | Timeless Math 5 - Space Flight Rescue (USA).zip | 2019-05-30 04:29 | 150M | |
![[ ]](/icons/compressed.gif) | Timeless Math 6 - Brainswarm (USA).zip | 2019-05-30 04:29 | 232M | |
![[ ]](/icons/compressed.gif) | Timeless Math 7 - Rover Recovery (USA).zip | 2019-05-30 04:29 | 62M | |
![[ ]](/icons/compressed.gif) | Tiny Tank (USA).zip | 2019-05-30 04:29 | 462M | |
![[ ]](/icons/compressed.gif) | Tiny Toon Adventures - Plucky's Big Adventure (USA).zip | 2019-05-30 04:29 | 61M | |
![[ ]](/icons/compressed.gif) | Tiny Toon Adventures - The Great Beanstalk (USA).zip | 2019-05-30 04:29 | 127M | |
![[ ]](/icons/compressed.gif) | Tiny Toon Adventures - Toonenstein - Dare to Scare! (USA).zip | 2019-05-30 04:29 | 422M | |
![[ ]](/icons/compressed.gif) | Tobal No. 1 (USA).zip | 2019-05-30 04:29 | 451M | |
![[ ]](/icons/compressed.gif) | Tokyo Highway Battle (USA).zip | 2019-05-30 04:29 | 529M | |
![[ ]](/icons/compressed.gif) | Tom Clancy's Rainbow Six (USA).zip | 2019-05-30 04:29 | 271M | |
![[ ]](/icons/compressed.gif) | Tom Clancy's Rainbow Six - Lone Wolf (USA).zip | 2019-05-30 04:29 | 11M | |
![[ ]](/icons/compressed.gif) | Tom Clancy's Rainbow Six - Rogue Spear (USA).zip | 2019-05-30 04:29 | 186M | |
![[ ]](/icons/compressed.gif) | Tom and Jerry in House Trap (USA).zip | 2019-05-30 04:29 | 89M | |
![[ ]](/icons/compressed.gif) | Tomb Raider (USA) (v1.0).zip | 2019-05-30 04:29 | 403M | |
![[ ]](/icons/compressed.gif) | Tomb Raider (USA) (v1.1).zip | 2019-05-30 04:29 | 403M | |
![[ ]](/icons/compressed.gif) | Tomb Raider (USA) (v1.2).zip | 2019-05-30 04:29 | 411M | |
![[ ]](/icons/compressed.gif) | Tomb Raider (USA) (v1.3).zip | 2019-05-30 04:29 | 410M | |
![[ ]](/icons/compressed.gif) | Tomb Raider (USA) (v1.4).zip | 2019-05-30 04:29 | 453M | |
![[ ]](/icons/compressed.gif) | Tomb Raider (USA) (v1.5).zip | 2019-05-30 04:29 | 491M | |
![[ ]](/icons/compressed.gif) | Tomb Raider (USA) (v1.6).zip | 2019-05-30 04:29 | 436M | |
![[ ]](/icons/compressed.gif) | Tomb Raider - The Last Revelation (USA) (v1.0).zip | 2019-05-30 04:29 | 526M | |
![[ ]](/icons/compressed.gif) | Tomb Raider - The Last Revelation (USA) (v1.1).zip | 2019-05-30 04:29 | 527M | |
![[ ]](/icons/compressed.gif) | Tomb Raider Chronicles (USA).zip | 2019-05-30 04:29 | 444M | |
![[ ]](/icons/compressed.gif) | Tomb Raider II - Starring Lara Croft (USA) (v1.0).zip | 2019-05-30 04:29 | 540M | |
![[ ]](/icons/compressed.gif) | Tomb Raider II - Starring Lara Croft (USA) (v1.1).zip | 2019-05-30 04:29 | 538M | |
![[ ]](/icons/compressed.gif) | Tomb Raider II - Starring Lara Croft (USA) (v1.2).zip | 2019-05-30 04:29 | 487M | |
![[ ]](/icons/compressed.gif) | Tomb Raider II - Starring Lara Croft (USA) (v1.3).zip | 2019-05-30 04:29 | 507M | |
![[ ]](/icons/compressed.gif) | Tomb Raider III - Adventures of Lara Croft (USA) (v1.0).zip | 2019-05-30 04:29 | 377M | |
![[ ]](/icons/compressed.gif) | Tomb Raider III - Adventures of Lara Croft (USA) (v1.1).zip | 2019-05-30 04:29 | 393M | |
![[ ]](/icons/compressed.gif) | Tomb Raider III - Adventures of Lara Croft (USA) (v1.2).zip | 2019-05-30 04:29 | 411M | |
![[ ]](/icons/compressed.gif) | Tomba! (USA) (Demo).zip | 2019-05-30 04:29 | 62M | |
![[ ]](/icons/compressed.gif) | Tomba! (USA).zip | 2019-05-30 04:29 | 179M | |
![[ ]](/icons/compressed.gif) | Tomba! 2 - The Evil Swine Return (USA) (Demo).zip | 2019-05-30 04:29 | 9.8M | |
![[ ]](/icons/compressed.gif) | Tomba! 2 - The Evil Swine Return (USA).zip | 2019-05-30 04:29 | 216M | |
![[ ]](/icons/compressed.gif) | Tonka Space Station (USA).zip | 2019-05-30 04:29 | 407M | |
![[ ]](/icons/compressed.gif) | Tony Hawk's Pro Skater (USA).zip | 2019-05-30 04:29 | 382M | |
![[ ]](/icons/compressed.gif) | Tony Hawk's Pro Skater 2 (USA).zip | 2019-05-30 04:29 | 490M | |
![[ ]](/icons/compressed.gif) | Tony Hawk's Pro Skater 3 (USA).zip | 2019-05-30 04:29 | 399M | |
![[ ]](/icons/compressed.gif) | Tony Hawk's Pro Skater 4 (USA).zip | 2019-05-30 04:29 | 507M | |
![[ ]](/icons/compressed.gif) | Top Gun - Fire at Will! (USA).zip | 2019-05-30 04:29 | 470M | |
![[ ]](/icons/compressed.gif) | Total Eclipse Turbo (USA).zip | 2019-05-30 04:29 | 210M | |
![[ ]](/icons/compressed.gif) | Toys R Us - Attack of the Killer Demos! (USA).zip | 2019-05-30 04:29 | 216M | |
![[ ]](/icons/compressed.gif) | Toys R Us - Interactive CD Sampler Disc (USA).zip | 2019-05-30 04:29 | 170M | |
![[ ]](/icons/compressed.gif) | Transformers - Beast Wars Transmetals (USA).zip | 2019-05-30 04:29 | 261M | |
![[ ]](/icons/compressed.gif) | Trap Gunner (USA).zip | 2019-05-30 04:30 | 401M | |
![[ ]](/icons/compressed.gif) | Treasures of the Deep (USA).zip | 2019-05-30 04:30 | 295M | |
![[ ]](/icons/compressed.gif) | Trick'n Snowboarder (USA).zip | 2019-05-30 04:30 | 105M | |
![[ ]](/icons/compressed.gif) | Triple Play 97 (USA).zip | 2019-05-30 04:30 | 350M | |
![[ ]](/icons/compressed.gif) | Triple Play 98 (USA).zip | 2019-05-30 04:30 | 486M | |
![[ ]](/icons/compressed.gif) | Triple Play 99 (USA) (En,Es).zip | 2019-05-30 04:30 | 537M | |
![[ ]](/icons/compressed.gif) | Triple Play 2000 (USA).zip | 2019-05-30 04:30 | 465M | |
![[ ]](/icons/compressed.gif) | Triple Play 2001 (USA).zip | 2019-05-30 04:30 | 430M | |
![[ ]](/icons/compressed.gif) | Triple Play Baseball (USA).zip | 2019-05-30 04:30 | 430M | |
![[ ]](/icons/compressed.gif) | True Pinball (USA).zip | 2019-05-30 04:30 | 523M | |
![[ ]](/icons/compressed.gif) | Tunnel B1 (USA).zip | 2019-05-30 04:30 | 362M | |
![[ ]](/icons/compressed.gif) | Turbo Prop Racing (USA).zip | 2019-05-30 04:30 | 493M | |
![[ ]](/icons/compressed.gif) | Turnabout (USA).zip | 2019-05-30 04:30 | 180M | |
![[ ]](/icons/compressed.gif) | Twisted Metal (USA).zip | 2019-05-30 04:30 | 240M | |
![[ ]](/icons/compressed.gif) | Twisted Metal - Small Brawl (USA).zip | 2019-05-30 04:30 | 201M | |
![[ ]](/icons/compressed.gif) | Twisted Metal 2 (USA).zip | 2019-05-30 04:30 | 574M | |
![[ ]](/icons/compressed.gif) | Twisted Metal 4 (USA).zip | 2019-05-30 04:30 | 629M | |
![[ ]](/icons/compressed.gif) | Twisted Metal III (USA) (v1.0).zip | 2019-05-30 04:30 | 535M | |
![[ ]](/icons/compressed.gif) | Twisted Metal III (USA) (v1.1).zip | 2019-05-30 04:30 | 535M | |
![[ ]](/icons/compressed.gif) | Tyco R-C - Assault with a Battery (USA).zip | 2019-05-30 04:30 | 196M | |
![[ ]](/icons/compressed.gif) | Ultimate 8 Ball (USA).zip | 2019-05-30 04:30 | 548M | |
![[ ]](/icons/compressed.gif) | Ultimate Brain Games (USA).zip | 2019-05-30 04:30 | 486M | |
![[ ]](/icons/compressed.gif) | Ultimate Fighting Championship (USA).zip | 2019-05-30 04:30 | 301M | |
![[ ]](/icons/compressed.gif) | Um Jammer Lammy (USA) (Demo).zip | 2019-05-30 04:30 | 535M | |
![[ ]](/icons/compressed.gif) | Um Jammer Lammy (USA).zip | 2019-05-30 04:30 | 536M | |
![[ ]](/icons/compressed.gif) | Unholy War, The (USA).zip | 2019-05-30 04:30 | 128M | |
![[ ]](/icons/compressed.gif) | Uprising X (USA).zip | 2019-05-30 04:30 | 417M | |
![[ ]](/icons/compressed.gif) | Urban Chaos (USA).zip | 2019-05-30 04:30 | 289M | |
![[ ]](/icons/compressed.gif) | V-Tennis (USA).zip | 2019-05-30 04:30 | 154M | |
![[ ]](/icons/compressed.gif) | V.I.P. (USA).zip | 2019-05-30 04:30 | 487M | |
![[ ]](/icons/compressed.gif) | VMX Racing (USA).zip | 2019-05-30 04:30 | 424M | |
![[ ]](/icons/compressed.gif) | VR Baseball '97 (USA).zip | 2019-05-30 04:30 | 228M | |
![[ ]](/icons/compressed.gif) | VR Baseball 99 (USA).zip | 2019-05-30 04:30 | 223M | |
![[ ]](/icons/compressed.gif) | VR Golf '97 (USA) (En,Fr).zip | 2019-05-30 04:30 | 178M | |
![[ ]](/icons/compressed.gif) | VR Soccer '96 (USA).zip | 2019-05-30 04:30 | 83M | |
![[ ]](/icons/compressed.gif) | VR Sports Powerboat Racing (USA).zip | 2019-05-30 04:30 | 537M | |
![[ ]](/icons/compressed.gif) | Vagrant Story (USA).zip | 2019-05-30 04:30 | 111M | |
![[ ]](/icons/compressed.gif) | Valkyrie Profile (USA) (Disc 1).zip | 2019-05-30 04:30 | 527M | |
![[ ]](/icons/compressed.gif) | Valkyrie Profile (USA) (Disc 2).zip | 2019-05-30 04:30 | 535M | |
![[ ]](/icons/compressed.gif) | Vampire Hunter D (USA).zip | 2019-05-30 04:31 | 231M | |
![[ ]](/icons/compressed.gif) | Vanark (USA).zip | 2019-05-30 04:31 | 525M | |
![[ ]](/icons/compressed.gif) | Vandal Hearts (USA).zip | 2019-05-30 04:31 | 404M | |
![[ ]](/icons/compressed.gif) | Vandal Hearts II (USA).zip | 2019-05-30 04:31 | 139M | |
![[ ]](/icons/compressed.gif) | Vanguard Bandits (USA).zip | 2019-05-30 04:31 | 386M | |
![[ ]](/icons/compressed.gif) | Vanishing Point (USA).zip | 2019-05-30 04:31 | 483M | |
![[ ]](/icons/compressed.gif) | Vegas Games 2000 (USA).zip | 2019-05-30 04:31 | 146M | |
![[ ]](/icons/compressed.gif) | Viewpoint (USA).zip | 2019-05-30 04:31 | 420M | |
![[ ]](/icons/compressed.gif) | Vigilante 8 (USA) (Demo).zip | 2019-05-30 04:31 | 221M | |
![[ ]](/icons/compressed.gif) | Vigilante 8 (USA) (v1.0).zip | 2019-05-30 04:31 | 482M | |
![[ ]](/icons/compressed.gif) | Vigilante 8 (USA) (v1.1).zip | 2019-05-30 04:31 | 482M | |
![[ ]](/icons/compressed.gif) | Vigilante 8 - 2nd Offense (USA).zip | 2019-05-30 04:31 | 595M | |
![[ ]](/icons/compressed.gif) | Virtual Kasparov (USA) (En,Fr,Es).zip | 2019-05-30 04:31 | 501M | |
![[ ]](/icons/compressed.gif) | Virtual Pool (USA).zip | 2019-05-30 04:31 | 486M | |
![[ ]](/icons/compressed.gif) | Virtual Pool 3 (USA).zip | 2019-05-30 04:31 | 125M | |
![[ ]](/icons/compressed.gif) | Viva Soccer (USA) (En,Fr,De,Es,It,Pt).zip | 2019-05-30 04:31 | 451M | |
![[ ]](/icons/compressed.gif) | Vs. (USA).zip | 2019-05-30 04:31 | 128M | |
![[ ]](/icons/compressed.gif) | WCW-nWo Thunder (USA).zip | 2019-05-30 04:31 | 445M | |
![[ ]](/icons/compressed.gif) | WCW Backstage Assault (USA).zip | 2019-05-30 04:31 | 535M | |
![[ ]](/icons/compressed.gif) | WCW Mayhem (USA).zip | 2019-05-30 04:31 | 337M | |
![[ ]](/icons/compressed.gif) | WCW Nitro (USA).zip | 2019-05-30 04:31 | 472M | |
![[ ]](/icons/compressed.gif) | WCW vs. The World (USA).zip | 2019-05-30 04:31 | 487M | |
![[ ]](/icons/compressed.gif) | WWF Attitude (USA).zip | 2019-05-30 04:31 | 440M | |
![[ ]](/icons/compressed.gif) | WWF In Your House (USA) (v1.0).zip | 2019-05-30 04:31 | 141M | |
![[ ]](/icons/compressed.gif) | WWF In Your House (USA) (v1.1).zip | 2019-05-30 04:31 | 147M | |
![[ ]](/icons/compressed.gif) | WWF SmackDown! (USA).zip | 2019-05-30 04:31 | 429M | |
![[ ]](/icons/compressed.gif) | WWF SmackDown! 2 - Know Your Role (USA).zip | 2019-05-30 04:31 | 534M | |
![[ ]](/icons/compressed.gif) | WWF War Zone (USA) (v1.0).zip | 2019-05-30 04:31 | 513M | |
![[ ]](/icons/compressed.gif) | WWF War Zone (USA) (v1.1).zip | 2019-05-30 04:31 | 513M | |
![[ ]](/icons/compressed.gif) | WWF WrestleMania - The Arcade Game (USA).zip | 2019-05-30 04:31 | 42M | |
![[ ]](/icons/compressed.gif) | Walt Disney's The Jungle Book - Rhythm n' Groove (USA).zip | 2019-05-30 04:31 | 584M | |
![[ ]](/icons/compressed.gif) | Walt Disney World Quest - Magical Racing Tour (USA).zip | 2019-05-30 04:32 | 190M | |
![[ ]](/icons/compressed.gif) | WarCraft II - The Dark Saga (USA) (En,Fr,De,Es,It).zip | 2019-05-30 04:32 | 511M | |
![[ ]](/icons/compressed.gif) | WarGames - Defcon 1 (USA).zip | 2019-05-30 04:32 | 438M | |
![[ ]](/icons/compressed.gif) | War Gods (USA).zip | 2019-05-30 04:31 | 224M | |
![[ ]](/icons/compressed.gif) | Warhammer - Dark Omen (USA).zip | 2019-05-30 04:32 | 276M | |
![[ ]](/icons/compressed.gif) | Warhammer - Shadow of the Horned Rat (USA).zip | 2019-05-30 04:32 | 390M | |
![[ ]](/icons/compressed.gif) | Warhawk - The Red Mercury Missions (USA).zip | 2019-05-30 04:32 | 463M | |
![[ ]](/icons/compressed.gif) | Warpath - Jurassic Park (USA).zip | 2019-05-30 04:32 | 358M | |
![[ ]](/icons/compressed.gif) | Warriors of Might and Magic (USA).zip | 2019-05-30 04:32 | 248M | |
![[ ]](/icons/compressed.gif) | Warzone 2100 (USA).zip | 2019-05-30 04:32 | 429M | |
![[ ]](/icons/compressed.gif) | Wayne Gretzky's 3D Hockey '98 (USA).zip | 2019-05-30 04:32 | 40M | |
![[ ]](/icons/compressed.gif) | Weakest Link, The (USA).zip | 2019-05-30 04:32 | 354M | |
![[ ]](/icons/compressed.gif) | Wheel of Fortune (USA).zip | 2019-05-30 04:32 | 359M | |
![[ ]](/icons/compressed.gif) | Wheel of Fortune - 2nd Edition (USA).zip | 2019-05-30 04:32 | 455M | |
![[ ]](/icons/compressed.gif) | Who Wants to Be a Millionaire - 2nd Edition (USA).zip | 2019-05-30 04:32 | 306M | |
![[ ]](/icons/compressed.gif) | Who Wants to Be a Millionaire - 3rd Edition (USA).zip | 2019-05-30 04:32 | 246M | |
![[ ]](/icons/compressed.gif) | Wild 9 (USA).zip | 2019-05-30 04:32 | 489M | |
![[ ]](/icons/compressed.gif) | Wild Arms (USA).zip | 2019-05-30 04:32 | 273M | |
![[ ]](/icons/compressed.gif) | Wild Arms 2 (USA) (Disc 1).zip | 2019-05-30 04:32 | 311M | |
![[ ]](/icons/compressed.gif) | Wild Arms 2 (USA) (Disc 2).zip | 2019-05-30 04:32 | 343M | |
![[ ]](/icons/compressed.gif) | Wild Thornberrys, The - Animal Adventures (USA).zip | 2019-05-30 04:32 | 495M | |
![[ ]](/icons/compressed.gif) | Williams Arcade's Greatest Hits (USA).zip | 2019-05-30 04:32 | 269M | |
![[ ]](/icons/compressed.gif) | Wing Commander III - Heart of the Tiger (USA) (Disc 1).zip | 2019-05-30 04:32 | 635M | |
![[ ]](/icons/compressed.gif) | Wing Commander III - Heart of the Tiger (USA) (Disc 2).zip | 2019-05-30 04:32 | 656M | |
![[ ]](/icons/compressed.gif) | Wing Commander III - Heart of the Tiger (USA) (Disc 3).zip | 2019-05-30 04:32 | 649M | |
![[ ]](/icons/compressed.gif) | Wing Commander III - Heart of the Tiger (USA) (Disc 4).zip | 2019-05-30 04:32 | 632M | |
![[ ]](/icons/compressed.gif) | Wing Commander IV - The Price of Freedom (USA) (Disc 1).zip | 2019-05-30 04:32 | 656M | |
![[ ]](/icons/compressed.gif) | Wing Commander IV - The Price of Freedom (USA) (Disc 2).zip | 2019-05-30 04:32 | 633M | |
![[ ]](/icons/compressed.gif) | Wing Commander IV - The Price of Freedom (USA) (Disc 3).zip | 2019-05-30 04:33 | 662M | |
![[ ]](/icons/compressed.gif) | Wing Commander IV - The Price of Freedom (USA) (Disc 4).zip | 2019-05-30 04:33 | 613M | |
![[ ]](/icons/compressed.gif) | WipEout (USA).zip | 2019-05-30 04:33 | 434M | |
![[ ]](/icons/compressed.gif) | WipEout 3 (USA) (Demo).zip | 2019-05-30 04:33 | 62M | |
![[ ]](/icons/compressed.gif) | WipEout 3 (USA).zip | 2019-05-30 04:33 | 538M | |
![[ ]](/icons/compressed.gif) | Wipeout XL (USA) (Beta).zip | 2019-05-30 04:33 | 613M | |
![[ ]](/icons/compressed.gif) | Wipeout XL (USA).zip | 2019-05-30 04:33 | 613M | |
![[ ]](/icons/compressed.gif) | Woody Woodpecker Racing (USA).zip | 2019-05-30 04:33 | 44M | |
![[ ]](/icons/compressed.gif) | World's Scariest Police Chases (USA).zip | 2019-05-30 04:33 | 283M | |
![[ ]](/icons/compressed.gif) | World Cup 98 (USA).zip | 2019-05-30 04:33 | 555M | |
![[ ]](/icons/compressed.gif) | World Cup Golf - Professional Edition (USA).zip | 2019-05-30 04:33 | 578M | |
![[ ]](/icons/compressed.gif) | World Destruction League - Thunder Tanks (USA).zip | 2019-05-30 04:33 | 342M | |
![[ ]](/icons/compressed.gif) | World Destruction League - WarJetz (USA).zip | 2019-05-30 04:33 | 337M | |
![[ ]](/icons/compressed.gif) | World of Dragon Warrior - Torneko - The Last Hope (USA).zip | 2019-05-30 04:33 | 405M | |
![[ ]](/icons/compressed.gif) | Worms (USA).zip | 2019-05-30 04:33 | 414M | |
![[ ]](/icons/compressed.gif) | Worms Armageddon (USA).zip | 2019-05-30 04:33 | 291M | |
![[ ]](/icons/compressed.gif) | Worms World Party (USA) (En,Fr,De,Es,It,Nl,Sv,Da).zip | 2019-05-30 04:33 | 291M | |
![[ ]](/icons/compressed.gif) | Wreckin Crew - Drive Dangerously (USA) (En,Es).zip | 2019-05-30 04:33 | 162M | |
![[ ]](/icons/compressed.gif) | Wu-Tang - Shaolin Style (USA).zip | 2019-05-30 04:33 | 530M | |
![[ ]](/icons/compressed.gif) | X-Bladez - Inline Skater (USA).zip | 2019-05-30 04:33 | 457M | |
![[ ]](/icons/compressed.gif) | X-COM - UFO Defense (USA).zip | 2019-05-30 04:33 | 505M | |
![[ ]](/icons/compressed.gif) | X-Files, The (USA) (Disc 1).zip | 2019-05-30 04:33 | 469M | |
![[ ]](/icons/compressed.gif) | X-Files, The (USA) (Disc 2).zip | 2019-05-30 04:33 | 547M | |
![[ ]](/icons/compressed.gif) | X-Files, The (USA) (Disc 3).zip | 2019-05-30 04:33 | 436M | |
![[ ]](/icons/compressed.gif) | X-Files, The (USA) (Disc 4).zip | 2019-05-30 04:33 | 556M | |
![[ ]](/icons/compressed.gif) | X-Men - Children of the Atom (USA).zip | 2019-05-30 04:33 | 439M | |
![[ ]](/icons/compressed.gif) | X-Men - Mutant Academy (USA).zip | 2019-05-30 04:33 | 441M | |
![[ ]](/icons/compressed.gif) | X-Men - Mutant Academy 2 (USA).zip | 2019-05-30 04:33 | 532M | |
![[ ]](/icons/compressed.gif) | X-Men vs. Street Fighter (USA).zip | 2019-05-30 04:33 | 215M | |
![[ ]](/icons/compressed.gif) | X Games Pro Boarder (USA).zip | 2019-05-30 04:33 | 568M | |
![[ ]](/icons/compressed.gif) | XS Airboat Racing (USA).zip | 2019-05-30 04:33 | 36M | |
![[ ]](/icons/compressed.gif) | XS Junior League Dodgeball (USA).zip | 2019-05-30 04:33 | 260M | |
![[ ]](/icons/compressed.gif) | XS Junior League Football (USA).zip | 2019-05-30 04:33 | 28M | |
![[ ]](/icons/compressed.gif) | XS Junior League Soccer (USA).zip | 2019-05-30 04:33 | 40M | |
![[ ]](/icons/compressed.gif) | XS Moto (USA).zip | 2019-05-30 04:33 | 374M | |
![[ ]](/icons/compressed.gif) | Xena - Warrior Princess (USA).zip | 2019-05-30 04:33 | 176M | |
![[ ]](/icons/compressed.gif) | Xenogears (USA) (Disc 1).zip | 2019-05-30 04:33 | 426M | |
![[ ]](/icons/compressed.gif) | Xenogears (USA) (Disc 2).zip | 2019-05-30 04:33 | 431M | |
![[ ]](/icons/compressed.gif) | Xevious 3D-G+ (USA).zip | 2019-05-30 04:33 | 400M | |
![[ ]](/icons/compressed.gif) | You Don't Know Jack (USA) (Demo).zip | 2019-05-30 04:33 | 212M | |
![[ ]](/icons/compressed.gif) | You Don't Know Jack (USA) (Disc 1).zip | 2019-05-30 04:33 | 468M | |
![[ ]](/icons/compressed.gif) | You Don't Know Jack (USA) (Disc 2).zip | 2019-05-30 04:33 | 448M | |
![[ ]](/icons/compressed.gif) | You Don't Know Jack - Mock 2 (USA).zip | 2019-05-30 04:33 | 476M | |
![[ ]](/icons/compressed.gif) | Yu-Gi-Oh! Forbidden Memories (USA).zip | 2019-05-30 04:33 | 197M | |
![[ ]](/icons/compressed.gif) | Zero Divide (USA).zip | 2019-05-30 04:33 | 225M | |
![[ ]](/icons/compressed.gif) | Zoboomafoo - Leapin' Lemurs! (USA).zip | 2019-05-30 04:33 | 373M | |
![[ ]](/icons/compressed.gif) | Zoop - America's Largest Killer of Time! (USA).zip | 2019-05-30 04:33 | 170M | |
![[TXT]](/icons/text.gif) | links.txt | 2019-05-30 04:33 | 196K | |
|